diff --git a/bigbluebutton-client/resources/prod/BigBlueButton.html b/bigbluebutton-client/resources/prod/BigBlueButton.html
index bc3f9c4901b1fe2a1a61edcde14d3a6b920baf30..a799be30e65458465ffedbe1e3d610741d310b9b 100755
--- a/bigbluebutton-client/resources/prod/BigBlueButton.html
+++ b/bigbluebutton-client/resources/prod/BigBlueButton.html
@@ -143,7 +143,7 @@
<script src="lib/verto_extension.js" language="javascript"></script>
<script src="lib/kurento-extension.js" language="javascript"></script>
- <script src="lib/kurento-utils.min.js" language="javascript"></script>
+ <script src="lib/kurento-utils.js" language="javascript"></script>
<script src="lib/bbb_api_bridge.js?v=VERSION" language="javascript"></script>
<script src="lib/sip.js?v=VERSION" language="javascript"></script>
diff --git a/bigbluebutton-client/resources/prod/lib/kurento-utils.js b/bigbluebutton-client/resources/prod/lib/kurento-utils.js
new file mode 100644
index 0000000000000000000000000000000000000000..d171093e8784054a9f42264a0dccb960c5c25d10
--- /dev/null
+++ b/bigbluebutton-client/resources/prod/lib/kurento-utils.js
@@ -0,0 +1,4362 @@
+(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.kurentoUtils = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(require,module,exports){
+var freeice = require('freeice');
+var inherits = require('inherits');
+var UAParser = require('ua-parser-js');
+var uuid = require('uuid');
+var hark = require('hark');
+var EventEmitter = require('events').EventEmitter;
+var recursive = require('merge').recursive.bind(undefined, true);
+var sdpTranslator = require('sdp-translator');
+var logger = window.Logger || console;
+try {
+ require('kurento-browser-extensions');
+} catch (error) {
+ if (typeof getScreenConstraints === 'undefined') {
+ logger.warn('screen sharing is not available');
+ getScreenConstraints = function getScreenConstraints(sendSource, callback) {
+ callback(new Error('This library is not enabled for screen sharing'));
+ };
+ }
+}
+var MEDIA_CONSTRAINTS = {
+ audio: true,
+ video: {
+ width: 640,
+ framerate: 15
+ }
+ };
+var ua = window && window.navigator ? window.navigator.userAgent : '';
+var parser = new UAParser(ua);
+var browser = parser.getBrowser();
+var usePlanB = false;
+if (browser.name === 'Chrome' || browser.name === 'Chromium') {
+ logger.debug(browser.name + ': using SDP PlanB');
+ usePlanB = true;
+}
+function noop(error) {
+ if (error)
+ logger.error(error);
+}
+function trackStop(track) {
+ track.stop && track.stop();
+}
+function streamStop(stream) {
+ stream.getTracks().forEach(trackStop);
+}
+var dumpSDP = function (description) {
+ if (typeof description === 'undefined' || description === null) {
+ return '';
+ }
+ return 'type: ' + description.type + '\r\n' + description.sdp;
+};
+function bufferizeCandidates(pc, onerror) {
+ var candidatesQueue = [];
+ pc.addEventListener('signalingstatechange', function () {
+ if (this.signalingState === 'stable') {
+ while (candidatesQueue.length) {
+ var entry = candidatesQueue.shift();
+ this.addIceCandidate(entry.candidate, entry.callback, entry.callback);
+ }
+ }
+ });
+ return function (candidate, callback) {
+ callback = callback || onerror;
+ switch (pc.signalingState) {
+ case 'closed':
+ callback(new Error('PeerConnection object is closed'));
+ break;
+ case 'stable':
+ if (pc.remoteDescription) {
+ pc.addIceCandidate(candidate, callback, callback);
+ break;
+ }
+ default:
+ candidatesQueue.push({
+ candidate: candidate,
+ callback: callback
+ });
+ }
+ };
+}
+function removeFIDFromOffer(sdp) {
+ var n = sdp.indexOf('a=ssrc-group:FID');
+ if (n > 0) {
+ return sdp.slice(0, n);
+ } else {
+ return sdp;
+ }
+}
+function getSimulcastInfo(videoStream) {
+ var videoTracks = videoStream.getVideoTracks();
+ if (!videoTracks.length) {
+ logger.warn('No video tracks available in the video stream');
+ return '';
+ }
+ var lines = [
+ 'a=x-google-flag:conference',
+ 'a=ssrc-group:SIM 1 2 3',
+ 'a=ssrc:1 cname:localVideo',
+ 'a=ssrc:1 msid:' + videoStream.id + ' ' + videoTracks[0].id,
+ 'a=ssrc:1 mslabel:' + videoStream.id,
+ 'a=ssrc:1 label:' + videoTracks[0].id,
+ 'a=ssrc:2 cname:localVideo',
+ 'a=ssrc:2 msid:' + videoStream.id + ' ' + videoTracks[0].id,
+ 'a=ssrc:2 mslabel:' + videoStream.id,
+ 'a=ssrc:2 label:' + videoTracks[0].id,
+ 'a=ssrc:3 cname:localVideo',
+ 'a=ssrc:3 msid:' + videoStream.id + ' ' + videoTracks[0].id,
+ 'a=ssrc:3 mslabel:' + videoStream.id,
+ 'a=ssrc:3 label:' + videoTracks[0].id
+ ];
+ lines.push('');
+ return lines.join('\n');
+}
+function WebRtcPeer(mode, options, callback) {
+ if (!(this instanceof WebRtcPeer)) {
+ return new WebRtcPeer(mode, options, callback);
+ }
+ WebRtcPeer.super_.call(this);
+ if (options instanceof Function) {
+ callback = options;
+ options = undefined;
+ }
+ options = options || {};
+ callback = (callback || noop).bind(this);
+ var self = this;
+ var localVideo = options.localVideo;
+ var remoteVideo = options.remoteVideo;
+ var videoStream = options.videoStream;
+ var audioStream = options.audioStream;
+ var mediaConstraints = options.mediaConstraints;
+ var connectionConstraints = options.connectionConstraints;
+ var pc = options.peerConnection;
+ var sendSource = options.sendSource || 'webcam';
+ var dataChannelConfig = options.dataChannelConfig;
+ var useDataChannels = options.dataChannels || false;
+ var dataChannel;
+ var guid = uuid.v4();
+ var configuration = recursive({ iceServers: freeice() }, options.configuration);
+ var onicecandidate = options.onicecandidate;
+ if (onicecandidate)
+ this.on('icecandidate', onicecandidate);
+ var oncandidategatheringdone = options.oncandidategatheringdone;
+ if (oncandidategatheringdone) {
+ this.on('candidategatheringdone', oncandidategatheringdone);
+ }
+ var simulcast = options.simulcast;
+ var multistream = options.multistream;
+ var interop = new sdpTranslator.Interop();
+ var candidatesQueueOut = [];
+ var candidategatheringdone = false;
+ Object.defineProperties(this, {
+ 'peerConnection': {
+ get: function () {
+ return pc;
+ }
+ },
+ 'id': {
+ value: options.id || guid,
+ writable: false
+ },
+ 'remoteVideo': {
+ get: function () {
+ return remoteVideo;
+ }
+ },
+ 'localVideo': {
+ get: function () {
+ return localVideo;
+ }
+ },
+ 'dataChannel': {
+ get: function () {
+ return dataChannel;
+ }
+ },
+ 'currentFrame': {
+ get: function () {
+ if (!remoteVideo)
+ return;
+ if (remoteVideo.readyState < remoteVideo.HAVE_CURRENT_DATA)
+ throw new Error('No video stream data available');
+ var canvas = document.createElement('canvas');
+ canvas.width = remoteVideo.videoWidth;
+ canvas.height = remoteVideo.videoHeight;
+ canvas.getContext('2d').drawImage(remoteVideo, 0, 0);
+ return canvas;
+ }
+ }
+ });
+ if (!pc) {
+ pc = new RTCPeerConnection(configuration);
+ if (useDataChannels && !dataChannel) {
+ var dcId = 'WebRtcPeer-' + self.id;
+ var dcOptions = undefined;
+ if (dataChannelConfig) {
+ dcId = dataChannelConfig.id || dcId;
+ dcOptions = dataChannelConfig.options;
+ }
+ dataChannel = pc.createDataChannel(dcId, dcOptions);
+ if (dataChannelConfig) {
+ dataChannel.onopen = dataChannelConfig.onopen;
+ dataChannel.onclose = dataChannelConfig.onclose;
+ dataChannel.onmessage = dataChannelConfig.onmessage;
+ dataChannel.onbufferedamountlow = dataChannelConfig.onbufferedamountlow;
+ dataChannel.onerror = dataChannelConfig.onerror || noop;
+ }
+ }
+ }
+ pc.addEventListener('icecandidate', function (event) {
+ var candidate = event.candidate;
+ if (EventEmitter.listenerCount(self, 'icecandidate') || EventEmitter.listenerCount(self, 'candidategatheringdone')) {
+ if (candidate) {
+ var cand;
+ if (multistream && usePlanB) {
+ cand = interop.candidateToUnifiedPlan(candidate);
+ } else {
+ cand = candidate;
+ }
+ self.emit('icecandidate', cand);
+ candidategatheringdone = false;
+ } else if (!candidategatheringdone) {
+ self.emit('candidategatheringdone');
+ candidategatheringdone = true;
+ }
+ } else if (!candidategatheringdone) {
+ candidatesQueueOut.push(candidate);
+ if (!candidate)
+ candidategatheringdone = true;
+ }
+ });
+ pc.ontrack = options.onaddstream;
+ pc.onnegotiationneeded = options.onnegotiationneeded;
+ this.on('newListener', function (event, listener) {
+ if (event === 'icecandidate' || event === 'candidategatheringdone') {
+ while (candidatesQueueOut.length) {
+ var candidate = candidatesQueueOut.shift();
+ if (!candidate === (event === 'candidategatheringdone')) {
+ listener(candidate);
+ }
+ }
+ }
+ });
+ var addIceCandidate = bufferizeCandidates(pc);
+ this.addIceCandidate = function (iceCandidate, callback) {
+ var candidate;
+ if (multistream && usePlanB) {
+ candidate = interop.candidateToPlanB(iceCandidate);
+ } else {
+ candidate = new RTCIceCandidate(iceCandidate);
+ }
+ logger.debug('Remote ICE candidate received', iceCandidate);
+ callback = (callback || noop).bind(this);
+ addIceCandidate(candidate, callback);
+ };
+ this.generateOffer = function (callback) {
+ callback = callback.bind(this);
+ var offerAudio = true;
+ var offerVideo = true;
+ if (mediaConstraints) {
+ offerAudio = typeof mediaConstraints.audio === 'boolean' ? mediaConstraints.audio : true;
+ offerVideo = typeof mediaConstraints.video === 'boolean' ? mediaConstraints.video : true;
+ }
+ var browserDependantConstraints = {
+ offerToReceiveAudio: mode !== 'sendonly' && offerAudio,
+ offerToReceiveVideo: mode !== 'sendonly' && offerVideo
+ };
+ var constraints = browserDependantConstraints;
+ logger.debug('constraints: ' + JSON.stringify(constraints));
+ pc.createOffer(constraints).then(function (offer) {
+ logger.debug('Created SDP offer');
+ offer = mangleSdpToAddSimulcast(offer);
+ return pc.setLocalDescription(offer);
+ }).then(function () {
+ var localDescription = pc.localDescription;
+ logger.debug('Local description set', localDescription.sdp);
+ if (multistream && usePlanB) {
+ localDescription = interop.toUnifiedPlan(localDescription);
+ logger.debug('offer::origPlanB->UnifiedPlan', dumpSDP(localDescription));
+ }
+ callback(null, localDescription.sdp, self.processAnswer.bind(self));
+ }).catch(callback);
+ };
+ this.getLocalSessionDescriptor = function () {
+ return pc.localDescription;
+ };
+ this.getRemoteSessionDescriptor = function () {
+ return pc.remoteDescription;
+ };
+ function setRemoteVideo() {
+ if (remoteVideo) {
+ var stream = pc.getRemoteStreams()[0];
+ remoteVideo.pause();
+ remoteVideo.srcObject = stream;
+ remoteVideo.load();
+ logger.info('Remote URL:', remoteVideo.srcObject);
+ }
+ }
+ this.showLocalVideo = function () {
+ localVideo.srcObject = videoStream;
+ localVideo.muted = true;
+ };
+ this.send = function (data) {
+ if (dataChannel && dataChannel.readyState === 'open') {
+ dataChannel.send(data);
+ } else {
+ logger.warn('Trying to send data over a non-existing or closed data channel');
+ }
+ };
+ this.processAnswer = function (sdpAnswer, callback) {
+ callback = (callback || noop).bind(this);
+ var answer = new RTCSessionDescription({
+ type: 'answer',
+ sdp: sdpAnswer
+ });
+ if (multistream && usePlanB) {
+ var planBAnswer = interop.toPlanB(answer);
+ logger.debug('asnwer::planB', dumpSDP(planBAnswer));
+ answer = planBAnswer;
+ }
+ logger.debug('SDP answer received, setting remote description');
+ if (pc.signalingState === 'closed') {
+ return callback('PeerConnection is closed');
+ }
+ pc.setRemoteDescription(answer, function () {
+ setRemoteVideo();
+ callback();
+ }, callback);
+ };
+ this.processOffer = function (sdpOffer, callback) {
+ callback = callback.bind(this);
+ var offer = new RTCSessionDescription({
+ type: 'offer',
+ sdp: sdpOffer
+ });
+ if (multistream && usePlanB) {
+ var planBOffer = interop.toPlanB(offer);
+ logger.debug('offer::planB', dumpSDP(planBOffer));
+ offer = planBOffer;
+ }
+ logger.debug('SDP offer received, setting remote description');
+ if (pc.signalingState === 'closed') {
+ return callback('PeerConnection is closed');
+ }
+ pc.setRemoteDescription(offer).then(function () {
+ return setRemoteVideo();
+ }).then(function () {
+ return pc.createAnswer();
+ }).then(function (answer) {
+ answer = mangleSdpToAddSimulcast(answer);
+ logger.debug('Created SDP answer');
+ return pc.setLocalDescription(answer);
+ }).then(function () {
+ var localDescription = pc.localDescription;
+ if (multistream && usePlanB) {
+ localDescription = interop.toUnifiedPlan(localDescription);
+ logger.debug('answer::origPlanB->UnifiedPlan', dumpSDP(localDescription));
+ }
+ logger.debug('Local description set', localDescription.sdp);
+ callback(null, localDescription.sdp);
+ }).catch(callback);
+ };
+ function mangleSdpToAddSimulcast(answer) {
+ if (simulcast) {
+ if (browser.name === 'Chrome' || browser.name === 'Chromium') {
+ logger.debug('Adding multicast info');
+ answer = new RTCSessionDescription({
+ 'type': answer.type,
+ 'sdp': removeFIDFromOffer(answer.sdp) + getSimulcastInfo(videoStream)
+ });
+ } else {
+ logger.warn('Simulcast is only available in Chrome browser.');
+ }
+ }
+ return answer;
+ }
+ function start() {
+ if (pc.signalingState === 'closed') {
+ callback('The peer connection object is in "closed" state. This is most likely due to an invocation of the dispose method before accepting in the dialogue');
+ }
+ if (videoStream && localVideo) {
+ self.showLocalVideo();
+ }
+ if (videoStream) {
+ pc.addStream(videoStream);
+ }
+ if (audioStream) {
+ pc.addStream(audioStream);
+ }
+ var browser = parser.getBrowser();
+ if (mode === 'sendonly' && (browser.name === 'Chrome' || browser.name === 'Chromium') && browser.major === 39) {
+ mode = 'sendrecv';
+ }
+ callback();
+ }
+ if (mode !== 'recvonly' && !videoStream && !audioStream) {
+ function getMedia(constraints) {
+ if (constraints === undefined) {
+ constraints = MEDIA_CONSTRAINTS;
+ }
+ navigator.mediaDevices.getUserMedia(constraints).then(function (stream) {
+ videoStream = stream;
+ start();
+ }).catch(callback);
+ }
+ if (sendSource === 'webcam') {
+ getMedia(mediaConstraints);
+ } else {
+ getScreenConstraints(sendSource, function (error, constraints_) {
+ if (error)
+ return callback(error);
+ constraints = [mediaConstraints];
+ constraints.unshift(constraints_);
+ getMedia(recursive.apply(undefined, constraints));
+ }, guid);
+ }
+ } else {
+ setTimeout(start, 0);
+ }
+ this.on('_dispose', function () {
+ if (localVideo) {
+ localVideo.pause();
+ localVideo.src = '';
+ localVideo.load();
+ localVideo.muted = false;
+ }
+ if (remoteVideo) {
+ remoteVideo.pause();
+ remoteVideo.src = '';
+ remoteVideo.load();
+ }
+ self.removeAllListeners();
+ if (window.cancelChooseDesktopMedia !== undefined) {
+ window.cancelChooseDesktopMedia(guid);
+ }
+ });
+}
+inherits(WebRtcPeer, EventEmitter);
+function createEnableDescriptor(type) {
+ var method = 'get' + type + 'Tracks';
+ return {
+ enumerable: true,
+ get: function () {
+ if (!this.peerConnection)
+ return;
+ var streams = this.peerConnection.getLocalStreams();
+ if (!streams.length)
+ return;
+ for (var i = 0, stream; stream = streams[i]; i++) {
+ var tracks = stream[method]();
+ for (var j = 0, track; track = tracks[j]; j++)
+ if (!track.enabled)
+ return false;
+ }
+ return true;
+ },
+ set: function (value) {
+ function trackSetEnable(track) {
+ track.enabled = value;
+ }
+ this.peerConnection.getLocalStreams().forEach(function (stream) {
+ stream[method]().forEach(trackSetEnable);
+ });
+ }
+ };
+}
+Object.defineProperties(WebRtcPeer.prototype, {
+ 'enabled': {
+ enumerable: true,
+ get: function () {
+ return this.audioEnabled && this.videoEnabled;
+ },
+ set: function (value) {
+ this.audioEnabled = this.videoEnabled = value;
+ }
+ },
+ 'audioEnabled': createEnableDescriptor('Audio'),
+ 'videoEnabled': createEnableDescriptor('Video')
+});
+WebRtcPeer.prototype.getLocalStream = function (index) {
+ if (this.peerConnection) {
+ return this.peerConnection.getLocalStreams()[index || 0];
+ }
+};
+WebRtcPeer.prototype.getRemoteStream = function (index) {
+ if (this.peerConnection) {
+ return this.peerConnection.getRemoteStreams()[index || 0];
+ }
+};
+WebRtcPeer.prototype.dispose = function () {
+ logger.debug('Disposing WebRtcPeer');
+ var pc = this.peerConnection;
+ var dc = this.dataChannel;
+ try {
+ if (dc) {
+ if (dc.signalingState === 'closed')
+ return;
+ dc.close();
+ }
+ if (pc) {
+ if (pc.signalingState === 'closed')
+ return;
+ pc.getLocalStreams().forEach(streamStop);
+ pc.close();
+ }
+ } catch (err) {
+ logger.warn('Exception disposing webrtc peer ' + err);
+ }
+ this.emit('_dispose');
+};
+function WebRtcPeerRecvonly(options, callback) {
+ if (!(this instanceof WebRtcPeerRecvonly)) {
+ return new WebRtcPeerRecvonly(options, callback);
+ }
+ WebRtcPeerRecvonly.super_.call(this, 'recvonly', options, callback);
+}
+inherits(WebRtcPeerRecvonly, WebRtcPeer);
+function WebRtcPeerSendonly(options, callback) {
+ if (!(this instanceof WebRtcPeerSendonly)) {
+ return new WebRtcPeerSendonly(options, callback);
+ }
+ WebRtcPeerSendonly.super_.call(this, 'sendonly', options, callback);
+}
+inherits(WebRtcPeerSendonly, WebRtcPeer);
+function WebRtcPeerSendrecv(options, callback) {
+ if (!(this instanceof WebRtcPeerSendrecv)) {
+ return new WebRtcPeerSendrecv(options, callback);
+ }
+ WebRtcPeerSendrecv.super_.call(this, 'sendrecv', options, callback);
+}
+inherits(WebRtcPeerSendrecv, WebRtcPeer);
+function harkUtils(stream, options) {
+ return hark(stream, options);
+}
+exports.bufferizeCandidates = bufferizeCandidates;
+exports.WebRtcPeerRecvonly = WebRtcPeerRecvonly;
+exports.WebRtcPeerSendonly = WebRtcPeerSendonly;
+exports.WebRtcPeerSendrecv = WebRtcPeerSendrecv;
+exports.hark = harkUtils;
+},{"events":4,"freeice":5,"hark":8,"inherits":9,"kurento-browser-extensions":10,"merge":11,"sdp-translator":18,"ua-parser-js":21,"uuid":23}],2:[function(require,module,exports){
+if (window.addEventListener)
+ module.exports = require('./index');
+},{"./index":3}],3:[function(require,module,exports){
+var WebRtcPeer = require('./WebRtcPeer');
+exports.WebRtcPeer = WebRtcPeer;
+},{"./WebRtcPeer":1}],4:[function(require,module,exports){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+function EventEmitter() {
+ this._events = this._events || {};
+ this._maxListeners = this._maxListeners || undefined;
+}
+module.exports = EventEmitter;
+
+// Backwards-compat with node 0.10.x
+EventEmitter.EventEmitter = EventEmitter;
+
+EventEmitter.prototype._events = undefined;
+EventEmitter.prototype._maxListeners = undefined;
+
+// By default EventEmitters will print a warning if more than 10 listeners are
+// added to it. This is a useful default which helps finding memory leaks.
+EventEmitter.defaultMaxListeners = 10;
+
+// Obviously not all Emitters should be limited to 10. This function allows
+// that to be increased. Set to zero for unlimited.
+EventEmitter.prototype.setMaxListeners = function(n) {
+ if (!isNumber(n) || n < 0 || isNaN(n))
+ throw TypeError('n must be a positive number');
+ this._maxListeners = n;
+ return this;
+};
+
+EventEmitter.prototype.emit = function(type) {
+ var er, handler, len, args, i, listeners;
+
+ if (!this._events)
+ this._events = {};
+
+ // If there is no 'error' event listener then throw.
+ if (type === 'error') {
+ if (!this._events.error ||
+ (isObject(this._events.error) && !this._events.error.length)) {
+ er = arguments[1];
+ if (er instanceof Error) {
+ throw er; // Unhandled 'error' event
+ } else {
+ // At least give some kind of context to the user
+ var err = new Error('Uncaught, unspecified "error" event. (' + er + ')');
+ err.context = er;
+ throw err;
+ }
+ }
+ }
+
+ handler = this._events[type];
+
+ if (isUndefined(handler))
+ return false;
+
+ if (isFunction(handler)) {
+ switch (arguments.length) {
+ // fast cases
+ case 1:
+ handler.call(this);
+ break;
+ case 2:
+ handler.call(this, arguments[1]);
+ break;
+ case 3:
+ handler.call(this, arguments[1], arguments[2]);
+ break;
+ // slower
+ default:
+ args = Array.prototype.slice.call(arguments, 1);
+ handler.apply(this, args);
+ }
+ } else if (isObject(handler)) {
+ args = Array.prototype.slice.call(arguments, 1);
+ listeners = handler.slice();
+ len = listeners.length;
+ for (i = 0; i < len; i++)
+ listeners[i].apply(this, args);
+ }
+
+ return true;
+};
+
+EventEmitter.prototype.addListener = function(type, listener) {
+ var m;
+
+ if (!isFunction(listener))
+ throw TypeError('listener must be a function');
+
+ if (!this._events)
+ this._events = {};
+
+ // To avoid recursion in the case that type === "newListener"! Before
+ // adding it to the listeners, first emit "newListener".
+ if (this._events.newListener)
+ this.emit('newListener', type,
+ isFunction(listener.listener) ?
+ listener.listener : listener);
+
+ if (!this._events[type])
+ // Optimize the case of one listener. Don't need the extra array object.
+ this._events[type] = listener;
+ else if (isObject(this._events[type]))
+ // If we've already got an array, just append.
+ this._events[type].push(listener);
+ else
+ // Adding the second element, need to change to array.
+ this._events[type] = [this._events[type], listener];
+
+ // Check for listener leak
+ if (isObject(this._events[type]) && !this._events[type].warned) {
+ if (!isUndefined(this._maxListeners)) {
+ m = this._maxListeners;
+ } else {
+ m = EventEmitter.defaultMaxListeners;
+ }
+
+ if (m && m > 0 && this._events[type].length > m) {
+ this._events[type].warned = true;
+ console.error('(node) warning: possible EventEmitter memory ' +
+ 'leak detected. %d listeners added. ' +
+ 'Use emitter.setMaxListeners() to increase limit.',
+ this._events[type].length);
+ if (typeof console.trace === 'function') {
+ // not supported in IE 10
+ console.trace();
+ }
+ }
+ }
+
+ return this;
+};
+
+EventEmitter.prototype.on = EventEmitter.prototype.addListener;
+
+EventEmitter.prototype.once = function(type, listener) {
+ if (!isFunction(listener))
+ throw TypeError('listener must be a function');
+
+ var fired = false;
+
+ function g() {
+ this.removeListener(type, g);
+
+ if (!fired) {
+ fired = true;
+ listener.apply(this, arguments);
+ }
+ }
+
+ g.listener = listener;
+ this.on(type, g);
+
+ return this;
+};
+
+// emits a 'removeListener' event iff the listener was removed
+EventEmitter.prototype.removeListener = function(type, listener) {
+ var list, position, length, i;
+
+ if (!isFunction(listener))
+ throw TypeError('listener must be a function');
+
+ if (!this._events || !this._events[type])
+ return this;
+
+ list = this._events[type];
+ length = list.length;
+ position = -1;
+
+ if (list === listener ||
+ (isFunction(list.listener) && list.listener === listener)) {
+ delete this._events[type];
+ if (this._events.removeListener)
+ this.emit('removeListener', type, listener);
+
+ } else if (isObject(list)) {
+ for (i = length; i-- > 0;) {
+ if (list[i] === listener ||
+ (list[i].listener && list[i].listener === listener)) {
+ position = i;
+ break;
+ }
+ }
+
+ if (position < 0)
+ return this;
+
+ if (list.length === 1) {
+ list.length = 0;
+ delete this._events[type];
+ } else {
+ list.splice(position, 1);
+ }
+
+ if (this._events.removeListener)
+ this.emit('removeListener', type, listener);
+ }
+
+ return this;
+};
+
+EventEmitter.prototype.removeAllListeners = function(type) {
+ var key, listeners;
+
+ if (!this._events)
+ return this;
+
+ // not listening for removeListener, no need to emit
+ if (!this._events.removeListener) {
+ if (arguments.length === 0)
+ this._events = {};
+ else if (this._events[type])
+ delete this._events[type];
+ return this;
+ }
+
+ // emit removeListener for all listeners on all events
+ if (arguments.length === 0) {
+ for (key in this._events) {
+ if (key === 'removeListener') continue;
+ this.removeAllListeners(key);
+ }
+ this.removeAllListeners('removeListener');
+ this._events = {};
+ return this;
+ }
+
+ listeners = this._events[type];
+
+ if (isFunction(listeners)) {
+ this.removeListener(type, listeners);
+ } else if (listeners) {
+ // LIFO order
+ while (listeners.length)
+ this.removeListener(type, listeners[listeners.length - 1]);
+ }
+ delete this._events[type];
+
+ return this;
+};
+
+EventEmitter.prototype.listeners = function(type) {
+ var ret;
+ if (!this._events || !this._events[type])
+ ret = [];
+ else if (isFunction(this._events[type]))
+ ret = [this._events[type]];
+ else
+ ret = this._events[type].slice();
+ return ret;
+};
+
+EventEmitter.prototype.listenerCount = function(type) {
+ if (this._events) {
+ var evlistener = this._events[type];
+
+ if (isFunction(evlistener))
+ return 1;
+ else if (evlistener)
+ return evlistener.length;
+ }
+ return 0;
+};
+
+EventEmitter.listenerCount = function(emitter, type) {
+ return emitter.listenerCount(type);
+};
+
+function isFunction(arg) {
+ return typeof arg === 'function';
+}
+
+function isNumber(arg) {
+ return typeof arg === 'number';
+}
+
+function isObject(arg) {
+ return typeof arg === 'object' && arg !== null;
+}
+
+function isUndefined(arg) {
+ return arg === void 0;
+}
+
+},{}],5:[function(require,module,exports){
+/* jshint node: true */
+'use strict';
+
+var normalice = require('normalice');
+
+/**
+ # freeice
+
+ The `freeice` module is a simple way of getting random STUN or TURN server
+ for your WebRTC application. The list of servers (just STUN at this stage)
+ were sourced from this [gist](https://gist.github.com/zziuni/3741933).
+
+ ## Example Use
+
+ The following demonstrates how you can use `freeice` with
+ [rtc-quickconnect](https://github.com/rtc-io/rtc-quickconnect):
+
+ <<< examples/quickconnect.js
+
+ As the `freeice` module generates ice servers in a list compliant with the
+ WebRTC spec you will be able to use it with raw `RTCPeerConnection`
+ constructors and other WebRTC libraries.
+
+ ## Hey, don't use my STUN/TURN server!
+
+ If for some reason your free STUN or TURN server ends up in the
+ list of servers ([stun](https://github.com/DamonOehlman/freeice/blob/master/stun.json) or
+ [turn](https://github.com/DamonOehlman/freeice/blob/master/turn.json))
+ that is used in this module, you can feel
+ free to open an issue on this repository and those servers will be removed
+ within 24 hours (or sooner). This is the quickest and probably the most
+ polite way to have something removed (and provides us some visibility
+ if someone opens a pull request requesting that a server is added).
+
+ ## Please add my server!
+
+ If you have a server that you wish to add to the list, that's awesome! I'm
+ sure I speak on behalf of a whole pile of WebRTC developers who say thanks.
+ To get it into the list, feel free to either open a pull request or if you
+ find that process a bit daunting then just create an issue requesting
+ the addition of the server (make sure you provide all the details, and if
+ you have a Terms of Service then including that in the PR/issue would be
+ awesome).
+
+ ## I know of a free server, can I add it?
+
+ Sure, if you do your homework and make sure it is ok to use (I'm currently
+ in the process of reviewing the terms of those STUN servers included from
+ the original list). If it's ok to go, then please see the previous entry
+ for how to add it.
+
+ ## Current List of Servers
+
+ * current as at the time of last `README.md` file generation
+
+ ### STUN
+
+ <<< stun.json
+
+ ### TURN
+
+ <<< turn.json
+
+**/
+
+var freeice = module.exports = function(opts) {
+ // if a list of servers has been provided, then use it instead of defaults
+ var servers = {
+ stun: (opts || {}).stun || require('./stun.json'),
+ turn: (opts || {}).turn || require('./turn.json')
+ };
+
+ var stunCount = (opts || {}).stunCount || 2;
+ var turnCount = (opts || {}).turnCount || 0;
+ var selected;
+
+ function getServers(type, count) {
+ var out = [];
+ var input = [].concat(servers[type]);
+ var idx;
+
+ while (input.length && out.length < count) {
+ idx = (Math.random() * input.length) | 0;
+ out = out.concat(input.splice(idx, 1));
+ }
+
+ return out.map(function(url) {
+ //If it's a not a string, don't try to "normalice" it otherwise using type:url will screw it up
+ if ((typeof url !== 'string') && (! (url instanceof String))) {
+ return url;
+ } else {
+ return normalice(type + ':' + url);
+ }
+ });
+ }
+
+ // add stun servers
+ selected = [].concat(getServers('stun', stunCount));
+
+ if (turnCount) {
+ selected = selected.concat(getServers('turn', turnCount));
+ }
+
+ return selected;
+};
+
+},{"./stun.json":6,"./turn.json":7,"normalice":12}],6:[function(require,module,exports){
+module.exports=[
+ "stun.l.google.com:19302",
+ "stun1.l.google.com:19302",
+ "stun2.l.google.com:19302",
+ "stun3.l.google.com:19302",
+ "stun4.l.google.com:19302",
+ "stun.ekiga.net",
+ "stun.ideasip.com",
+ "stun.schlund.de",
+ "stun.stunprotocol.org:3478",
+ "stun.voiparound.com",
+ "stun.voipbuster.com",
+ "stun.voipstunt.com",
+ "stun.voxgratia.org",
+ "stun.services.mozilla.com"
+]
+
+},{}],7:[function(require,module,exports){
+module.exports=[]
+
+},{}],8:[function(require,module,exports){
+var WildEmitter = require('wildemitter');
+
+function getMaxVolume (analyser, fftBins) {
+ var maxVolume = -Infinity;
+ analyser.getFloatFrequencyData(fftBins);
+
+ for(var i=4, ii=fftBins.length; i < ii; i++) {
+ if (fftBins[i] > maxVolume && fftBins[i] < 0) {
+ maxVolume = fftBins[i];
+ }
+ };
+
+ return maxVolume;
+}
+
+
+var audioContextType = window.AudioContext || window.webkitAudioContext;
+// use a single audio context due to hardware limits
+var audioContext = null;
+module.exports = function(stream, options) {
+ var harker = new WildEmitter();
+
+
+ // make it not break in non-supported browsers
+ if (!audioContextType) return harker;
+
+ //Config
+ var options = options || {},
+ smoothing = (options.smoothing || 0.1),
+ interval = (options.interval || 50),
+ threshold = options.threshold,
+ play = options.play,
+ history = options.history || 10,
+ running = true;
+
+ //Setup Audio Context
+ if (!audioContext) {
+ audioContext = new audioContextType();
+ }
+ var sourceNode, fftBins, analyser;
+
+ analyser = audioContext.createAnalyser();
+ analyser.fftSize = 512;
+ analyser.smoothingTimeConstant = smoothing;
+ fftBins = new Float32Array(analyser.fftSize);
+
+ if (stream.jquery) stream = stream[0];
+ if (stream instanceof HTMLAudioElement || stream instanceof HTMLVideoElement) {
+ //Audio Tag
+ sourceNode = audioContext.createMediaElementSource(stream);
+ if (typeof play === 'undefined') play = true;
+ threshold = threshold || -50;
+ } else {
+ //WebRTC Stream
+ sourceNode = audioContext.createMediaStreamSource(stream);
+ threshold = threshold || -50;
+ }
+
+ sourceNode.connect(analyser);
+ if (play) analyser.connect(audioContext.destination);
+
+ harker.speaking = false;
+
+ harker.setThreshold = function(t) {
+ threshold = t;
+ };
+
+ harker.setInterval = function(i) {
+ interval = i;
+ };
+
+ harker.stop = function() {
+ running = false;
+ harker.emit('volume_change', -100, threshold);
+ if (harker.speaking) {
+ harker.speaking = false;
+ harker.emit('stopped_speaking');
+ }
+ };
+ harker.speakingHistory = [];
+ for (var i = 0; i < history; i++) {
+ harker.speakingHistory.push(0);
+ }
+
+ // Poll the analyser node to determine if speaking
+ // and emit events if changed
+ var looper = function() {
+ setTimeout(function() {
+
+ //check if stop has been called
+ if(!running) {
+ return;
+ }
+
+ var currentVolume = getMaxVolume(analyser, fftBins);
+
+ harker.emit('volume_change', currentVolume, threshold);
+
+ var history = 0;
+ if (currentVolume > threshold && !harker.speaking) {
+ // trigger quickly, short history
+ for (var i = harker.speakingHistory.length - 3; i < harker.speakingHistory.length; i++) {
+ history += harker.speakingHistory[i];
+ }
+ if (history >= 2) {
+ harker.speaking = true;
+ harker.emit('speaking');
+ }
+ } else if (currentVolume < threshold && harker.speaking) {
+ for (var i = 0; i < harker.speakingHistory.length; i++) {
+ history += harker.speakingHistory[i];
+ }
+ if (history == 0) {
+ harker.speaking = false;
+ harker.emit('stopped_speaking');
+ }
+ }
+ harker.speakingHistory.shift();
+ harker.speakingHistory.push(0 + (currentVolume > threshold));
+
+ looper();
+ }, interval);
+ };
+ looper();
+
+
+ return harker;
+}
+
+},{"wildemitter":24}],9:[function(require,module,exports){
+if (typeof Object.create === 'function') {
+ // implementation from standard node.js 'util' module
+ module.exports = function inherits(ctor, superCtor) {
+ ctor.super_ = superCtor
+ ctor.prototype = Object.create(superCtor.prototype, {
+ constructor: {
+ value: ctor,
+ enumerable: false,
+ writable: true,
+ configurable: true
+ }
+ });
+ };
+} else {
+ // old school shim for old browsers
+ module.exports = function inherits(ctor, superCtor) {
+ ctor.super_ = superCtor
+ var TempCtor = function () {}
+ TempCtor.prototype = superCtor.prototype
+ ctor.prototype = new TempCtor()
+ ctor.prototype.constructor = ctor
+ }
+}
+
+},{}],10:[function(require,module,exports){
+// Does nothing at all.
+
+},{}],11:[function(require,module,exports){
+/*!
+ * @name JavaScript/NodeJS Merge v1.2.0
+ * @author yeikos
+ * @repository https://github.com/yeikos/js.merge
+
+ * Copyright 2014 yeikos - MIT license
+ * https://raw.github.com/yeikos/js.merge/master/LICENSE
+ */
+
+;(function(isNode) {
+
+ /**
+ * Merge one or more objects
+ * @param bool? clone
+ * @param mixed,... arguments
+ * @return object
+ */
+
+ var Public = function(clone) {
+
+ return merge(clone === true, false, arguments);
+
+ }, publicName = 'merge';
+
+ /**
+ * Merge two or more objects recursively
+ * @param bool? clone
+ * @param mixed,... arguments
+ * @return object
+ */
+
+ Public.recursive = function(clone) {
+
+ return merge(clone === true, true, arguments);
+
+ };
+
+ /**
+ * Clone the input removing any reference
+ * @param mixed input
+ * @return mixed
+ */
+
+ Public.clone = function(input) {
+
+ var output = input,
+ type = typeOf(input),
+ index, size;
+
+ if (type === 'array') {
+
+ output = [];
+ size = input.length;
+
+ for (index=0;index<size;++index)
+
+ output[index] = Public.clone(input[index]);
+
+ } else if (type === 'object') {
+
+ output = {};
+
+ for (index in input)
+
+ output[index] = Public.clone(input[index]);
+
+ }
+
+ return output;
+
+ };
+
+ /**
+ * Merge two objects recursively
+ * @param mixed input
+ * @param mixed extend
+ * @return mixed
+ */
+
+ function merge_recursive(base, extend) {
+
+ if (typeOf(base) !== 'object')
+
+ return extend;
+
+ for (var key in extend) {
+
+ if (typeOf(base[key]) === 'object' && typeOf(extend[key]) === 'object') {
+
+ base[key] = merge_recursive(base[key], extend[key]);
+
+ } else {
+
+ base[key] = extend[key];
+
+ }
+
+ }
+
+ return base;
+
+ }
+
+ /**
+ * Merge two or more objects
+ * @param bool clone
+ * @param bool recursive
+ * @param array argv
+ * @return object
+ */
+
+ function merge(clone, recursive, argv) {
+
+ var result = argv[0],
+ size = argv.length;
+
+ if (clone || typeOf(result) !== 'object')
+
+ result = {};
+
+ for (var index=0;index<size;++index) {
+
+ var item = argv[index],
+
+ type = typeOf(item);
+
+ if (type !== 'object') continue;
+
+ for (var key in item) {
+
+ var sitem = clone ? Public.clone(item[key]) : item[key];
+
+ if (recursive) {
+
+ result[key] = merge_recursive(result[key], sitem);
+
+ } else {
+
+ result[key] = sitem;
+
+ }
+
+ }
+
+ }
+
+ return result;
+
+ }
+
+ /**
+ * Get type of variable
+ * @param mixed input
+ * @return string
+ *
+ * @see http://jsperf.com/typeofvar
+ */
+
+ function typeOf(input) {
+
+ return ({}).toString.call(input).slice(8, -1).toLowerCase();
+
+ }
+
+ if (isNode) {
+
+ module.exports = Public;
+
+ } else {
+
+ window[publicName] = Public;
+
+ }
+
+})(typeof module === 'object' && module && typeof module.exports === 'object' && module.exports);
+},{}],12:[function(require,module,exports){
+/**
+ # normalice
+
+ Normalize an ice server configuration object (or plain old string) into a format
+ that is usable in all browsers supporting WebRTC. Primarily this module is designed
+ to help with the transition of the `url` attribute of the configuration object to
+ the `urls` attribute.
+
+ ## Example Usage
+
+ <<< examples/simple.js
+
+**/
+
+var protocols = [
+ 'stun:',
+ 'turn:'
+];
+
+module.exports = function(input) {
+ var url = (input || {}).url || input;
+ var protocol;
+ var parts;
+ var output = {};
+
+ // if we don't have a string url, then allow the input to passthrough
+ if (typeof url != 'string' && (! (url instanceof String))) {
+ return input;
+ }
+
+ // trim the url string, and convert to an array
+ url = url.trim();
+
+ // if the protocol is not known, then passthrough
+ protocol = protocols[protocols.indexOf(url.slice(0, 5))];
+ if (! protocol) {
+ return input;
+ }
+
+ // now let's attack the remaining url parts
+ url = url.slice(5);
+ parts = url.split('@');
+
+ output.username = input.username;
+ output.credential = input.credential;
+ // if we have an authentication part, then set the credentials
+ if (parts.length > 1) {
+ url = parts[1];
+ parts = parts[0].split(':');
+
+ // add the output credential and username
+ output.username = parts[0];
+ output.credential = (input || {}).credential || parts[1] || '';
+ }
+
+ output.url = protocol + url;
+ output.urls = [ output.url ];
+
+ return output;
+};
+
+},{}],13:[function(require,module,exports){
+var grammar = module.exports = {
+ v: [{
+ name: 'version',
+ reg: /^(\d*)$/
+ }],
+ o: [{ //o=- 20518 0 IN IP4 203.0.113.1
+ // NB: sessionId will be a String in most cases because it is huge
+ name: 'origin',
+ reg: /^(\S*) (\d*) (\d*) (\S*) IP(\d) (\S*)/,
+ names: ['username', 'sessionId', 'sessionVersion', 'netType', 'ipVer', 'address'],
+ format: "%s %s %d %s IP%d %s"
+ }],
+ // default parsing of these only (though some of these feel outdated)
+ s: [{ name: 'name' }],
+ i: [{ name: 'description' }],
+ u: [{ name: 'uri' }],
+ e: [{ name: 'email' }],
+ p: [{ name: 'phone' }],
+ z: [{ name: 'timezones' }], // TODO: this one can actually be parsed properly..
+ r: [{ name: 'repeats' }], // TODO: this one can also be parsed properly
+ //k: [{}], // outdated thing ignored
+ t: [{ //t=0 0
+ name: 'timing',
+ reg: /^(\d*) (\d*)/,
+ names: ['start', 'stop'],
+ format: "%d %d"
+ }],
+ c: [{ //c=IN IP4 10.47.197.26
+ name: 'connection',
+ reg: /^IN IP(\d) (\S*)/,
+ names: ['version', 'ip'],
+ format: "IN IP%d %s"
+ }],
+ b: [{ //b=AS:4000
+ push: 'bandwidth',
+ reg: /^(TIAS|AS|CT|RR|RS):(\d*)/,
+ names: ['type', 'limit'],
+ format: "%s:%s"
+ }],
+ m: [{ //m=video 51744 RTP/AVP 126 97 98 34 31
+ // NB: special - pushes to session
+ // TODO: rtp/fmtp should be filtered by the payloads found here?
+ reg: /^(\w*) (\d*) ([\w\/]*)(?: (.*))?/,
+ names: ['type', 'port', 'protocol', 'payloads'],
+ format: "%s %d %s %s"
+ }],
+ a: [
+ { //a=rtpmap:110 opus/48000/2
+ push: 'rtp',
+ reg: /^rtpmap:(\d*) ([\w\-]*)(?:\s*\/(\d*)(?:\s*\/(\S*))?)?/,
+ names: ['payload', 'codec', 'rate', 'encoding'],
+ format: function (o) {
+ return (o.encoding) ?
+ "rtpmap:%d %s/%s/%s":
+ o.rate ?
+ "rtpmap:%d %s/%s":
+ "rtpmap:%d %s";
+ }
+ },
+ {
+ //a=fmtp:108 profile-level-id=24;object=23;bitrate=64000
+ //a=fmtp:111 minptime=10; useinbandfec=1
+ push: 'fmtp',
+ reg: /^fmtp:(\d*) ([\S| ]*)/,
+ names: ['payload', 'config'],
+ format: "fmtp:%d %s"
+ },
+ { //a=control:streamid=0
+ name: 'control',
+ reg: /^control:(.*)/,
+ format: "control:%s"
+ },
+ { //a=rtcp:65179 IN IP4 193.84.77.194
+ name: 'rtcp',
+ reg: /^rtcp:(\d*)(?: (\S*) IP(\d) (\S*))?/,
+ names: ['port', 'netType', 'ipVer', 'address'],
+ format: function (o) {
+ return (o.address != null) ?
+ "rtcp:%d %s IP%d %s":
+ "rtcp:%d";
+ }
+ },
+ { //a=rtcp-fb:98 trr-int 100
+ push: 'rtcpFbTrrInt',
+ reg: /^rtcp-fb:(\*|\d*) trr-int (\d*)/,
+ names: ['payload', 'value'],
+ format: "rtcp-fb:%d trr-int %d"
+ },
+ { //a=rtcp-fb:98 nack rpsi
+ push: 'rtcpFb',
+ reg: /^rtcp-fb:(\*|\d*) ([\w-_]*)(?: ([\w-_]*))?/,
+ names: ['payload', 'type', 'subtype'],
+ format: function (o) {
+ return (o.subtype != null) ?
+ "rtcp-fb:%s %s %s":
+ "rtcp-fb:%s %s";
+ }
+ },
+ { //a=extmap:2 urn:ietf:params:rtp-hdrext:toffset
+ //a=extmap:1/recvonly URI-gps-string
+ push: 'ext',
+ reg: /^extmap:([\w_\/]*) (\S*)(?: (\S*))?/,
+ names: ['value', 'uri', 'config'], // value may include "/direction" suffix
+ format: function (o) {
+ return (o.config != null) ?
+ "extmap:%s %s %s":
+ "extmap:%s %s";
+ }
+ },
+ {
+ //a=crypto:1 AES_CM_128_HMAC_SHA1_80 inline:PS1uQCVeeCFCanVmcjkpPywjNWhcYD0mXXtxaVBR|2^20|1:32
+ push: 'crypto',
+ reg: /^crypto:(\d*) ([\w_]*) (\S*)(?: (\S*))?/,
+ names: ['id', 'suite', 'config', 'sessionConfig'],
+ format: function (o) {
+ return (o.sessionConfig != null) ?
+ "crypto:%d %s %s %s":
+ "crypto:%d %s %s";
+ }
+ },
+ { //a=setup:actpass
+ name: 'setup',
+ reg: /^setup:(\w*)/,
+ format: "setup:%s"
+ },
+ { //a=mid:1
+ name: 'mid',
+ reg: /^mid:([^\s]*)/,
+ format: "mid:%s"
+ },
+ { //a=msid:0c8b064d-d807-43b4-b434-f92a889d8587 98178685-d409-46e0-8e16-7ef0db0db64a
+ name: 'msid',
+ reg: /^msid:(.*)/,
+ format: "msid:%s"
+ },
+ { //a=ptime:20
+ name: 'ptime',
+ reg: /^ptime:(\d*)/,
+ format: "ptime:%d"
+ },
+ { //a=maxptime:60
+ name: 'maxptime',
+ reg: /^maxptime:(\d*)/,
+ format: "maxptime:%d"
+ },
+ { //a=sendrecv
+ name: 'direction',
+ reg: /^(sendrecv|recvonly|sendonly|inactive)/
+ },
+ { //a=ice-lite
+ name: 'icelite',
+ reg: /^(ice-lite)/
+ },
+ { //a=ice-ufrag:F7gI
+ name: 'iceUfrag',
+ reg: /^ice-ufrag:(\S*)/,
+ format: "ice-ufrag:%s"
+ },
+ { //a=ice-pwd:x9cml/YzichV2+XlhiMu8g
+ name: 'icePwd',
+ reg: /^ice-pwd:(\S*)/,
+ format: "ice-pwd:%s"
+ },
+ { //a=fingerprint:SHA-1 00:11:22:33:44:55:66:77:88:99:AA:BB:CC:DD:EE:FF:00:11:22:33
+ name: 'fingerprint',
+ reg: /^fingerprint:(\S*) (\S*)/,
+ names: ['type', 'hash'],
+ format: "fingerprint:%s %s"
+ },
+ {
+ //a=candidate:0 1 UDP 2113667327 203.0.113.1 54400 typ host
+ //a=candidate:1162875081 1 udp 2113937151 192.168.34.75 60017 typ host generation 0
+ //a=candidate:3289912957 2 udp 1845501695 193.84.77.194 60017 typ srflx raddr 192.168.34.75 rport 60017 generation 0
+ //a=candidate:229815620 1 tcp 1518280447 192.168.150.19 60017 typ host tcptype active generation 0
+ //a=candidate:3289912957 2 tcp 1845501695 193.84.77.194 60017 typ srflx raddr 192.168.34.75 rport 60017 tcptype passive generation 0
+ push:'candidates',
+ reg: /^candidate:(\S*) (\d*) (\S*) (\d*) (\S*) (\d*) typ (\S*)(?: raddr (\S*) rport (\d*))?(?: tcptype (\S*))?(?: generation (\d*))?/,
+ names: ['foundation', 'component', 'transport', 'priority', 'ip', 'port', 'type', 'raddr', 'rport', 'tcptype', 'generation'],
+ format: function (o) {
+ var str = "candidate:%s %d %s %d %s %d typ %s";
+
+ str += (o.raddr != null) ? " raddr %s rport %d" : "%v%v";
+
+ // NB: candidate has three optional chunks, so %void middles one if it's missing
+ str += (o.tcptype != null) ? " tcptype %s" : "%v";
+
+ if (o.generation != null) {
+ str += " generation %d";
+ }
+ return str;
+ }
+ },
+ { //a=end-of-candidates (keep after the candidates line for readability)
+ name: 'endOfCandidates',
+ reg: /^(end-of-candidates)/
+ },
+ { //a=remote-candidates:1 203.0.113.1 54400 2 203.0.113.1 54401 ...
+ name: 'remoteCandidates',
+ reg: /^remote-candidates:(.*)/,
+ format: "remote-candidates:%s"
+ },
+ { //a=ice-options:google-ice
+ name: 'iceOptions',
+ reg: /^ice-options:(\S*)/,
+ format: "ice-options:%s"
+ },
+ { //a=ssrc:2566107569 cname:t9YU8M1UxTF8Y1A1
+ push: "ssrcs",
+ reg: /^ssrc:(\d*) ([\w_]*):(.*)/,
+ names: ['id', 'attribute', 'value'],
+ format: "ssrc:%d %s:%s"
+ },
+ { //a=ssrc-group:FEC 1 2
+ push: "ssrcGroups",
+ reg: /^ssrc-group:(\w*) (.*)/,
+ names: ['semantics', 'ssrcs'],
+ format: "ssrc-group:%s %s"
+ },
+ { //a=msid-semantic: WMS Jvlam5X3SX1OP6pn20zWogvaKJz5Hjf9OnlV
+ name: "msidSemantic",
+ reg: /^msid-semantic:\s?(\w*) (\S*)/,
+ names: ['semantic', 'token'],
+ format: "msid-semantic: %s %s" // space after ":" is not accidental
+ },
+ { //a=group:BUNDLE audio video
+ push: 'groups',
+ reg: /^group:(\w*) (.*)/,
+ names: ['type', 'mids'],
+ format: "group:%s %s"
+ },
+ { //a=rtcp-mux
+ name: 'rtcpMux',
+ reg: /^(rtcp-mux)/
+ },
+ { //a=rtcp-rsize
+ name: 'rtcpRsize',
+ reg: /^(rtcp-rsize)/
+ },
+ { // any a= that we don't understand is kepts verbatim on media.invalid
+ push: 'invalid',
+ names: ["value"]
+ }
+ ]
+};
+
+// set sensible defaults to avoid polluting the grammar with boring details
+Object.keys(grammar).forEach(function (key) {
+ var objs = grammar[key];
+ objs.forEach(function (obj) {
+ if (!obj.reg) {
+ obj.reg = /(.*)/;
+ }
+ if (!obj.format) {
+ obj.format = "%s";
+ }
+ });
+});
+
+},{}],14:[function(require,module,exports){
+var parser = require('./parser');
+var writer = require('./writer');
+
+exports.write = writer;
+exports.parse = parser.parse;
+exports.parseFmtpConfig = parser.parseFmtpConfig;
+exports.parsePayloads = parser.parsePayloads;
+exports.parseRemoteCandidates = parser.parseRemoteCandidates;
+
+},{"./parser":15,"./writer":16}],15:[function(require,module,exports){
+var toIntIfInt = function (v) {
+ return String(Number(v)) === v ? Number(v) : v;
+};
+
+var attachProperties = function (match, location, names, rawName) {
+ if (rawName && !names) {
+ location[rawName] = toIntIfInt(match[1]);
+ }
+ else {
+ for (var i = 0; i < names.length; i += 1) {
+ if (match[i+1] != null) {
+ location[names[i]] = toIntIfInt(match[i+1]);
+ }
+ }
+ }
+};
+
+var parseReg = function (obj, location, content) {
+ var needsBlank = obj.name && obj.names;
+ if (obj.push && !location[obj.push]) {
+ location[obj.push] = [];
+ }
+ else if (needsBlank && !location[obj.name]) {
+ location[obj.name] = {};
+ }
+ var keyLocation = obj.push ?
+ {} : // blank object that will be pushed
+ needsBlank ? location[obj.name] : location; // otherwise, named location or root
+
+ attachProperties(content.match(obj.reg), keyLocation, obj.names, obj.name);
+
+ if (obj.push) {
+ location[obj.push].push(keyLocation);
+ }
+};
+
+var grammar = require('./grammar');
+var validLine = RegExp.prototype.test.bind(/^([a-z])=(.*)/);
+
+exports.parse = function (sdp) {
+ var session = {}
+ , media = []
+ , location = session; // points at where properties go under (one of the above)
+
+ // parse lines we understand
+ sdp.split(/(\r\n|\r|\n)/).filter(validLine).forEach(function (l) {
+ var type = l[0];
+ var content = l.slice(2);
+ if (type === 'm') {
+ media.push({rtp: [], fmtp: []});
+ location = media[media.length-1]; // point at latest media line
+ }
+
+ for (var j = 0; j < (grammar[type] || []).length; j += 1) {
+ var obj = grammar[type][j];
+ if (obj.reg.test(content)) {
+ return parseReg(obj, location, content);
+ }
+ }
+ });
+
+ session.media = media; // link it up
+ return session;
+};
+
+var fmtpReducer = function (acc, expr) {
+ var s = expr.split('=');
+ if (s.length === 2) {
+ acc[s[0]] = toIntIfInt(s[1]);
+ }
+ return acc;
+};
+
+exports.parseFmtpConfig = function (str) {
+ return str.split(/\;\s?/).reduce(fmtpReducer, {});
+};
+
+exports.parsePayloads = function (str) {
+ return str.split(' ').map(Number);
+};
+
+exports.parseRemoteCandidates = function (str) {
+ var candidates = [];
+ var parts = str.split(' ').map(toIntIfInt);
+ for (var i = 0; i < parts.length; i += 3) {
+ candidates.push({
+ component: parts[i],
+ ip: parts[i + 1],
+ port: parts[i + 2]
+ });
+ }
+ return candidates;
+};
+
+},{"./grammar":13}],16:[function(require,module,exports){
+var grammar = require('./grammar');
+
+// customized util.format - discards excess arguments and can void middle ones
+var formatRegExp = /%[sdv%]/g;
+var format = function (formatStr) {
+ var i = 1;
+ var args = arguments;
+ var len = args.length;
+ return formatStr.replace(formatRegExp, function (x) {
+ if (i >= len) {
+ return x; // missing argument
+ }
+ var arg = args[i];
+ i += 1;
+ switch (x) {
+ case '%%':
+ return '%';
+ case '%s':
+ return String(arg);
+ case '%d':
+ return Number(arg);
+ case '%v':
+ return '';
+ }
+ });
+ // NB: we discard excess arguments - they are typically undefined from makeLine
+};
+
+var makeLine = function (type, obj, location) {
+ var str = obj.format instanceof Function ?
+ (obj.format(obj.push ? location : location[obj.name])) :
+ obj.format;
+
+ var args = [type + '=' + str];
+ if (obj.names) {
+ for (var i = 0; i < obj.names.length; i += 1) {
+ var n = obj.names[i];
+ if (obj.name) {
+ args.push(location[obj.name][n]);
+ }
+ else { // for mLine and push attributes
+ args.push(location[obj.names[i]]);
+ }
+ }
+ }
+ else {
+ args.push(location[obj.name]);
+ }
+ return format.apply(null, args);
+};
+
+// RFC specified order
+// TODO: extend this with all the rest
+var defaultOuterOrder = [
+ 'v', 'o', 's', 'i',
+ 'u', 'e', 'p', 'c',
+ 'b', 't', 'r', 'z', 'a'
+];
+var defaultInnerOrder = ['i', 'c', 'b', 'a'];
+
+
+module.exports = function (session, opts) {
+ opts = opts || {};
+ // ensure certain properties exist
+ if (session.version == null) {
+ session.version = 0; // "v=0" must be there (only defined version atm)
+ }
+ if (session.name == null) {
+ session.name = " "; // "s= " must be there if no meaningful name set
+ }
+ session.media.forEach(function (mLine) {
+ if (mLine.payloads == null) {
+ mLine.payloads = "";
+ }
+ });
+
+ var outerOrder = opts.outerOrder || defaultOuterOrder;
+ var innerOrder = opts.innerOrder || defaultInnerOrder;
+ var sdp = [];
+
+ // loop through outerOrder for matching properties on session
+ outerOrder.forEach(function (type) {
+ grammar[type].forEach(function (obj) {
+ if (obj.name in session && session[obj.name] != null) {
+ sdp.push(makeLine(type, obj, session));
+ }
+ else if (obj.push in session && session[obj.push] != null) {
+ session[obj.push].forEach(function (el) {
+ sdp.push(makeLine(type, obj, el));
+ });
+ }
+ });
+ });
+
+ // then for each media line, follow the innerOrder
+ session.media.forEach(function (mLine) {
+ sdp.push(makeLine('m', grammar.m[0], mLine));
+
+ innerOrder.forEach(function (type) {
+ grammar[type].forEach(function (obj) {
+ if (obj.name in mLine && mLine[obj.name] != null) {
+ sdp.push(makeLine(type, obj, mLine));
+ }
+ else if (obj.push in mLine && mLine[obj.push] != null) {
+ mLine[obj.push].forEach(function (el) {
+ sdp.push(makeLine(type, obj, el));
+ });
+ }
+ });
+ });
+ });
+
+ return sdp.join('\r\n') + '\r\n';
+};
+
+},{"./grammar":13}],17:[function(require,module,exports){
+/* Copyright @ 2015 Atlassian Pty Ltd
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+module.exports = function arrayEquals(array) {
+ // if the other array is a falsy value, return
+ if (!array)
+ return false;
+
+ // compare lengths - can save a lot of time
+ if (this.length != array.length)
+ return false;
+
+ for (var i = 0, l = this.length; i < l; i++) {
+ // Check if we have nested arrays
+ if (this[i] instanceof Array && array[i] instanceof Array) {
+ // recurse into the nested arrays
+ if (!arrayEquals.apply(this[i], [array[i]]))
+ return false;
+ } else if (this[i] != array[i]) {
+ // Warning - two different object instances will never be equal:
+ // {x:20} != {x:20}
+ return false;
+ }
+ }
+ return true;
+};
+
+
+},{}],18:[function(require,module,exports){
+/* Copyright @ 2015 Atlassian Pty Ltd
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+exports.Interop = require('./interop');
+
+},{"./interop":19}],19:[function(require,module,exports){
+/* Copyright @ 2015 Atlassian Pty Ltd
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/* global RTCSessionDescription */
+/* global RTCIceCandidate */
+/* jshint -W097 */
+"use strict";
+
+var transform = require('./transform');
+var arrayEquals = require('./array-equals');
+
+function Interop() {
+
+ /**
+ * This map holds the most recent Unified Plan offer/answer SDP that was
+ * converted to Plan B, with the SDP type ('offer' or 'answer') as keys and
+ * the SDP string as values.
+ *
+ * @type {{}}
+ */
+ this.cache = {
+ mlB2UMap : {},
+ mlU2BMap : {}
+ };
+}
+
+module.exports = Interop;
+
+/**
+ * Changes the candidate args to match with the related Unified Plan
+ */
+Interop.prototype.candidateToUnifiedPlan = function(candidate) {
+ var cand = new RTCIceCandidate(candidate);
+
+ cand.sdpMLineIndex = this.cache.mlB2UMap[cand.sdpMLineIndex];
+ /* TODO: change sdpMid to (audio|video)-SSRC */
+
+ return cand;
+};
+
+/**
+ * Changes the candidate args to match with the related Plan B
+ */
+Interop.prototype.candidateToPlanB = function(candidate) {
+ var cand = new RTCIceCandidate(candidate);
+
+ if (cand.sdpMid.indexOf('audio') === 0) {
+ cand.sdpMid = 'audio';
+ } else if (cand.sdpMid.indexOf('video') === 0) {
+ cand.sdpMid = 'video';
+ } else {
+ throw new Error('candidate with ' + cand.sdpMid + ' not allowed');
+ }
+
+ cand.sdpMLineIndex = this.cache.mlU2BMap[cand.sdpMLineIndex];
+
+ return cand;
+};
+
+/**
+ * Returns the index of the first m-line with the given media type and with a
+ * direction which allows sending, in the last Unified Plan description with
+ * type "answer" converted to Plan B. Returns {null} if there is no saved
+ * answer, or if none of its m-lines with the given type allow sending.
+ * @param type the media type ("audio" or "video").
+ * @returns {*}
+ */
+Interop.prototype.getFirstSendingIndexFromAnswer = function(type) {
+ if (!this.cache.answer) {
+ return null;
+ }
+
+ var session = transform.parse(this.cache.answer);
+ if (session && session.media && Array.isArray(session.media)){
+ for (var i = 0; i < session.media.length; i++) {
+ if (session.media[i].type == type &&
+ (!session.media[i].direction /* default to sendrecv */ ||
+ session.media[i].direction === 'sendrecv' ||
+ session.media[i].direction === 'sendonly')){
+ return i;
+ }
+ }
+ }
+
+ return null;
+};
+
+/**
+ * This method transforms a Unified Plan SDP to an equivalent Plan B SDP. A
+ * PeerConnection wrapper transforms the SDP to Plan B before passing it to the
+ * application.
+ *
+ * @param desc
+ * @returns {*}
+ */
+Interop.prototype.toPlanB = function(desc) {
+ var self = this;
+ //#region Preliminary input validation.
+
+ if (typeof desc !== 'object' || desc === null ||
+ typeof desc.sdp !== 'string') {
+ console.warn('An empty description was passed as an argument.');
+ return desc;
+ }
+
+ // Objectify the SDP for easier manipulation.
+ var session = transform.parse(desc.sdp);
+
+ // If the SDP contains no media, there's nothing to transform.
+ if (typeof session.media === 'undefined' ||
+ !Array.isArray(session.media) || session.media.length === 0) {
+ console.warn('The description has no media.');
+ return desc;
+ }
+
+ // Try some heuristics to "make sure" this is a Unified Plan SDP. Plan B
+ // SDP has a video, an audio and a data "channel" at most.
+ if (session.media.length <= 3 && session.media.every(function(m) {
+ return ['video', 'audio', 'data'].indexOf(m.mid) !== -1;
+ })) {
+ console.warn('This description does not look like Unified Plan.');
+ return desc;
+ }
+
+ //#endregion
+
+ // HACK https://bugzilla.mozilla.org/show_bug.cgi?id=1113443
+ var sdp = desc.sdp;
+ var rewrite = false;
+ for (var i = 0; i < session.media.length; i++) {
+ var uLine = session.media[i];
+ uLine.rtp.forEach(function(rtp) {
+ if (rtp.codec === 'NULL')
+ {
+ rewrite = true;
+ var offer = transform.parse(self.cache.offer);
+ rtp.codec = offer.media[i].rtp[0].codec;
+ }
+ });
+ }
+ if (rewrite) {
+ sdp = transform.write(session);
+ }
+
+ // Unified Plan SDP is our "precious". Cache it for later use in the Plan B
+ // -> Unified Plan transformation.
+ this.cache[desc.type] = sdp;
+
+ //#region Convert from Unified Plan to Plan B.
+
+ // We rebuild the session.media array.
+ var media = session.media;
+ session.media = [];
+
+ // Associative array that maps channel types to channel objects for fast
+ // access to channel objects by their type, e.g. type2bl['audio']->channel
+ // obj.
+ var type2bl = {};
+
+ // Used to build the group:BUNDLE value after the channels construction
+ // loop.
+ var types = [];
+
+ media.forEach(function(uLine) {
+ // rtcp-mux is required in the Plan B SDP.
+ if ((typeof uLine.rtcpMux !== 'string' ||
+ uLine.rtcpMux !== 'rtcp-mux') &&
+ uLine.direction !== 'inactive') {
+ throw new Error('Cannot convert to Plan B because m-lines ' +
+ 'without the rtcp-mux attribute were found.');
+ }
+
+ // If we don't have a channel for this uLine.type OR the selected is
+ // inactive, then select this uLine as the channel basis.
+ if (typeof type2bl[uLine.type] === 'undefined' ||
+ type2bl[uLine.type].direction === 'inactive') {
+ type2bl[uLine.type] = uLine;
+ }
+
+ if (uLine.protocol != type2bl[uLine.type].protocol) {
+ throw new Error('Cannot convert to Plan B because m-lines ' +
+ 'have different protocols and this library does not have ' +
+ 'support for that');
+ }
+
+ if (uLine.payloads != type2bl[uLine.type].payloads) {
+ throw new Error('Cannot convert to Plan B because m-lines ' +
+ 'have different payloads and this library does not have ' +
+ 'support for that');
+ }
+
+ });
+
+ // Implode the Unified Plan m-lines/tracks into Plan B channels.
+ media.forEach(function(uLine) {
+ if (uLine.type === 'application') {
+ session.media.push(uLine);
+ types.push(uLine.mid);
+ return;
+ }
+
+ // Add sources to the channel and handle a=msid.
+ if (typeof uLine.sources === 'object') {
+ Object.keys(uLine.sources).forEach(function(ssrc) {
+ if (typeof type2bl[uLine.type].sources !== 'object')
+ type2bl[uLine.type].sources = {};
+
+ // Assign the sources to the channel.
+ type2bl[uLine.type].sources[ssrc] =
+ uLine.sources[ssrc];
+
+ if (typeof uLine.msid !== 'undefined') {
+ // In Plan B the msid is an SSRC attribute. Also, we don't
+ // care about the obsolete label and mslabel attributes.
+ //
+ // Note that it is not guaranteed that the uLine will
+ // have an msid. recvonly channels in particular don't have
+ // one.
+ type2bl[uLine.type].sources[ssrc].msid =
+ uLine.msid;
+ }
+ // NOTE ssrcs in ssrc groups will share msids, as
+ // draft-uberti-rtcweb-plan-00 mandates.
+ });
+ }
+
+ // Add ssrc groups to the channel.
+ if (typeof uLine.ssrcGroups !== 'undefined' &&
+ Array.isArray(uLine.ssrcGroups)) {
+
+ // Create the ssrcGroups array, if it's not defined.
+ if (typeof type2bl[uLine.type].ssrcGroups === 'undefined' ||
+ !Array.isArray(type2bl[uLine.type].ssrcGroups)) {
+ type2bl[uLine.type].ssrcGroups = [];
+ }
+
+ type2bl[uLine.type].ssrcGroups =
+ type2bl[uLine.type].ssrcGroups.concat(
+ uLine.ssrcGroups);
+ }
+
+ if (type2bl[uLine.type] === uLine) {
+ // Plan B mids are in ['audio', 'video', 'data']
+ uLine.mid = uLine.type;
+
+ // Plan B doesn't support/need the bundle-only attribute.
+ delete uLine.bundleOnly;
+
+ // In Plan B the msid is an SSRC attribute.
+ delete uLine.msid;
+
+ if (uLine.type == media[0].type) {
+ types.unshift(uLine.type);
+ // Add the channel to the new media array.
+ session.media.unshift(uLine);
+ } else {
+ types.push(uLine.type);
+ // Add the channel to the new media array.
+ session.media.push(uLine);
+ }
+ }
+ });
+
+ if (typeof session.groups !== 'undefined') {
+ // We regenerate the BUNDLE group with the new mids.
+ session.groups.some(function(group) {
+ if (group.type === 'BUNDLE') {
+ group.mids = types.join(' ');
+ return true;
+ }
+ });
+ }
+
+ // msid semantic
+ session.msidSemantic = {
+ semantic: 'WMS',
+ token: '*'
+ };
+
+ var resStr = transform.write(session);
+
+ return new RTCSessionDescription({
+ type: desc.type,
+ sdp: resStr
+ });
+
+ //#endregion
+};
+
+/* follow rules defined in RFC4145 */
+function addSetupAttr(uLine) {
+ if (typeof uLine.setup === 'undefined') {
+ return;
+ }
+
+ if (uLine.setup === "active") {
+ uLine.setup = "passive";
+ } else if (uLine.setup === "passive") {
+ uLine.setup = "active";
+ }
+}
+
+/**
+ * This method transforms a Plan B SDP to an equivalent Unified Plan SDP. A
+ * PeerConnection wrapper transforms the SDP to Unified Plan before passing it
+ * to FF.
+ *
+ * @param desc
+ * @returns {*}
+ */
+Interop.prototype.toUnifiedPlan = function(desc) {
+ var self = this;
+ //#region Preliminary input validation.
+
+ if (typeof desc !== 'object' || desc === null ||
+ typeof desc.sdp !== 'string') {
+ console.warn('An empty description was passed as an argument.');
+ return desc;
+ }
+
+ var session = transform.parse(desc.sdp);
+
+ // If the SDP contains no media, there's nothing to transform.
+ if (typeof session.media === 'undefined' ||
+ !Array.isArray(session.media) || session.media.length === 0) {
+ console.warn('The description has no media.');
+ return desc;
+ }
+
+ // Try some heuristics to "make sure" this is a Plan B SDP. Plan B SDP has
+ // a video, an audio and a data "channel" at most.
+ if (session.media.length > 3 || !session.media.every(function(m) {
+ return ['video', 'audio', 'data'].indexOf(m.mid) !== -1;
+ })) {
+ console.warn('This description does not look like Plan B.');
+ return desc;
+ }
+
+ // Make sure this Plan B SDP can be converted to a Unified Plan SDP.
+ var mids = [];
+ session.media.forEach(function(m) {
+ mids.push(m.mid);
+ });
+
+ var hasBundle = false;
+ if (typeof session.groups !== 'undefined' &&
+ Array.isArray(session.groups)) {
+ hasBundle = session.groups.every(function(g) {
+ return g.type !== 'BUNDLE' ||
+ arrayEquals.apply(g.mids.sort(), [mids.sort()]);
+ });
+ }
+
+ if (!hasBundle) {
+ var mustBeBundle = false;
+
+ session.media.forEach(function(m) {
+ if (m.direction !== 'inactive') {
+ mustBeBundle = true;
+ }
+ });
+
+ if (mustBeBundle) {
+ throw new Error("Cannot convert to Unified Plan because m-lines that" +
+ " are not bundled were found.");
+ }
+ }
+
+ //#endregion
+
+
+ //#region Convert from Plan B to Unified Plan.
+
+ // Unfortunately, a Plan B offer/answer doesn't have enough information to
+ // rebuild an equivalent Unified Plan offer/answer.
+ //
+ // For example, if this is a local answer (in Unified Plan style) that we
+ // convert to Plan B prior to handing it over to the application (the
+ // PeerConnection wrapper called us, for instance, after a successful
+ // createAnswer), we want to remember the m-line at which we've seen the
+ // (local) SSRC. That's because when the application wants to do call the
+ // SLD method, forcing us to do the inverse transformation (from Plan B to
+ // Unified Plan), we need to know to which m-line to assign the (local)
+ // SSRC. We also need to know all the other m-lines that the original
+ // answer had and include them in the transformed answer as well.
+ //
+ // Another example is if this is a remote offer that we convert to Plan B
+ // prior to giving it to the application, we want to remember the mid at
+ // which we've seen the (remote) SSRC.
+ //
+ // In the iteration that follows, we use the cached Unified Plan (if it
+ // exists) to assign mids to ssrcs.
+
+ var type;
+ if (desc.type === 'answer') {
+ type = 'offer';
+ } else if (desc.type === 'offer') {
+ type = 'answer';
+ } else {
+ throw new Error("Type '" + desc.type + "' not supported.");
+ }
+
+ var cached;
+ if (typeof this.cache[type] !== 'undefined') {
+ cached = transform.parse(this.cache[type]);
+ }
+
+ var recvonlySsrcs = {
+ audio: {},
+ video: {}
+ };
+
+ // A helper map that sends mids to m-line objects. We use it later to
+ // rebuild the Unified Plan style session.media array.
+ var mid2ul = {};
+ var bIdx = 0;
+ var uIdx = 0;
+
+ var sources2ul = {};
+
+ var candidates;
+ var iceUfrag;
+ var icePwd;
+ var fingerprint;
+ var payloads = {};
+ var rtcpFb = {};
+ var rtp = {};
+
+ session.media.forEach(function(bLine) {
+ if ((typeof bLine.rtcpMux !== 'string' ||
+ bLine.rtcpMux !== 'rtcp-mux') &&
+ bLine.direction !== 'inactive') {
+ throw new Error("Cannot convert to Unified Plan because m-lines " +
+ "without the rtcp-mux attribute were found.");
+ }
+
+ if (bLine.type === 'application') {
+ mid2ul[bLine.mid] = bLine;
+ return;
+ }
+
+ // With rtcp-mux and bundle all the channels should have the same ICE
+ // stuff.
+ var sources = bLine.sources;
+ var ssrcGroups = bLine.ssrcGroups;
+ var port = bLine.port;
+
+ /* Chrome adds different candidates even using bundle, so we concat the candidates list */
+ if (typeof bLine.candidates != 'undefined') {
+ if (typeof candidates != 'undefined') {
+ candidates = candidates.concat(bLine.candidates);
+ } else {
+ candidates = bLine.candidates;
+ }
+ }
+
+ if ((typeof iceUfrag != 'undefined') && (typeof bLine.iceUfrag != 'undefined') && (iceUfrag != bLine.iceUfrag)) {
+ throw new Error("Only BUNDLE supported, iceUfrag must be the same for all m-lines.\n" +
+ "\tLast iceUfrag: " + iceUfrag + "\n" +
+ "\tNew iceUfrag: " + bLine.iceUfrag
+ );
+ }
+
+ if (typeof bLine.iceUfrag != 'undefined') {
+ iceUfrag = bLine.iceUfrag;
+ }
+
+ if ((typeof icePwd != 'undefined') && (typeof bLine.icePwd != 'undefined') && (icePwd != bLine.icePwd)) {
+ throw new Error("Only BUNDLE supported, icePwd must be the same for all m-lines.\n" +
+ "\tLast icePwd: " + icePwd + "\n" +
+ "\tNew icePwd: " + bLine.icePwd
+ );
+ }
+
+ if (typeof bLine.icePwd != 'undefined') {
+ icePwd = bLine.icePwd;
+ }
+
+ if ((typeof fingerprint != 'undefined') && (typeof bLine.fingerprint != 'undefined') &&
+ (fingerprint.type != bLine.fingerprint.type || fingerprint.hash != bLine.fingerprint.hash)) {
+ throw new Error("Only BUNDLE supported, fingerprint must be the same for all m-lines.\n" +
+ "\tLast fingerprint: " + JSON.stringify(fingerprint) + "\n" +
+ "\tNew fingerprint: " + JSON.stringify(bLine.fingerprint)
+ );
+ }
+
+ if (typeof bLine.fingerprint != 'undefined') {
+ fingerprint = bLine.fingerprint;
+ }
+
+ payloads[bLine.type] = bLine.payloads;
+ rtcpFb[bLine.type] = bLine.rtcpFb;
+ rtp[bLine.type] = bLine.rtp;
+
+ // inverted ssrc group map
+ var ssrc2group = {};
+ if (typeof ssrcGroups !== 'undefined' && Array.isArray(ssrcGroups)) {
+ ssrcGroups.forEach(function (ssrcGroup) {
+ // XXX This might brake if an SSRC is in more than one group
+ // for some reason.
+ if (typeof ssrcGroup.ssrcs !== 'undefined' &&
+ Array.isArray(ssrcGroup.ssrcs)) {
+ ssrcGroup.ssrcs.forEach(function (ssrc) {
+ if (typeof ssrc2group[ssrc] === 'undefined') {
+ ssrc2group[ssrc] = [];
+ }
+
+ ssrc2group[ssrc].push(ssrcGroup);
+ });
+ }
+ });
+ }
+
+ // ssrc to m-line index.
+ var ssrc2ml = {};
+
+ if (typeof sources === 'object') {
+
+ // We'll use the "bLine" object as a prototype for each new "mLine"
+ // that we create, but first we need to clean it up a bit.
+ delete bLine.sources;
+ delete bLine.ssrcGroups;
+ delete bLine.candidates;
+ delete bLine.iceUfrag;
+ delete bLine.icePwd;
+ delete bLine.fingerprint;
+ delete bLine.port;
+ delete bLine.mid;
+
+ // Explode the Plan B channel sources with one m-line per source.
+ Object.keys(sources).forEach(function(ssrc) {
+
+ // The (unified) m-line for this SSRC. We either create it from
+ // scratch or, if it's a grouped SSRC, we re-use a related
+ // mline. In other words, if the source is grouped with another
+ // source, put the two together in the same m-line.
+ var uLine;
+
+ // We assume here that we are the answerer in the O/A, so any
+ // offers which we translate come from the remote side, while
+ // answers are local. So the check below is to make that we
+ // handle receive-only SSRCs in a special way only if they come
+ // from the remote side.
+ if (desc.type==='offer') {
+ // We want to detect SSRCs which are used by a remote peer
+ // in an m-line with direction=recvonly (i.e. they are
+ // being used for RTCP only).
+ // This information would have gotten lost if the remote
+ // peer used Unified Plan and their local description was
+ // translated to Plan B. So we use the lack of an MSID
+ // attribute to deduce a "receive only" SSRC.
+ if (!sources[ssrc].msid) {
+ recvonlySsrcs[bLine.type][ssrc] = sources[ssrc];
+ // Receive-only SSRCs must not create new m-lines. We
+ // will assign them to an existing m-line later.
+ return;
+ }
+ }
+
+ if (typeof ssrc2group[ssrc] !== 'undefined' &&
+ Array.isArray(ssrc2group[ssrc])) {
+ ssrc2group[ssrc].some(function (ssrcGroup) {
+ // ssrcGroup.ssrcs *is* an Array, no need to check
+ // again here.
+ return ssrcGroup.ssrcs.some(function (related) {
+ if (typeof ssrc2ml[related] === 'object') {
+ uLine = ssrc2ml[related];
+ return true;
+ }
+ });
+ });
+ }
+
+ if (typeof uLine === 'object') {
+ // the m-line already exists. Just add the source.
+ uLine.sources[ssrc] = sources[ssrc];
+ delete sources[ssrc].msid;
+ } else {
+ // Use the "bLine" as a prototype for the "uLine".
+ uLine = Object.create(bLine);
+ ssrc2ml[ssrc] = uLine;
+
+ if (typeof sources[ssrc].msid !== 'undefined') {
+ // Assign the msid of the source to the m-line. Note
+ // that it is not guaranteed that the source will have
+ // msid. In particular "recvonly" sources don't have an
+ // msid. Note that "recvonly" is a term only defined
+ // for m-lines.
+ uLine.msid = sources[ssrc].msid;
+ delete sources[ssrc].msid;
+ }
+
+ // We assign one SSRC per media line.
+ uLine.sources = {};
+ uLine.sources[ssrc] = sources[ssrc];
+ uLine.ssrcGroups = ssrc2group[ssrc];
+
+ // Use the cached Unified Plan SDP (if it exists) to assign
+ // SSRCs to mids.
+ if (typeof cached !== 'undefined' &&
+ typeof cached.media !== 'undefined' &&
+ Array.isArray(cached.media)) {
+
+ cached.media.forEach(function (m) {
+ if (typeof m.sources === 'object') {
+ Object.keys(m.sources).forEach(function (s) {
+ if (s === ssrc) {
+ uLine.mid = m.mid;
+ }
+ });
+ }
+ });
+ }
+
+ if (typeof uLine.mid === 'undefined') {
+
+ // If this is an SSRC that we see for the first time
+ // assign it a new mid. This is typically the case when
+ // this method is called to transform a remote
+ // description for the first time or when there is a
+ // new SSRC in the remote description because a new
+ // peer has joined the conference. Local SSRCs should
+ // have already been added to the map in the toPlanB
+ // method.
+ //
+ // Because FF generates answers in Unified Plan style,
+ // we MUST already have a cached answer with all the
+ // local SSRCs mapped to some m-line/mid.
+
+ uLine.mid = [bLine.type, '-', ssrc].join('');
+ }
+
+ // Include the candidates in the 1st media line.
+ uLine.candidates = candidates;
+ uLine.iceUfrag = iceUfrag;
+ uLine.icePwd = icePwd;
+ uLine.fingerprint = fingerprint;
+ uLine.port = port;
+
+ mid2ul[uLine.mid] = uLine;
+ sources2ul[uIdx] = uLine.sources;
+
+ self.cache.mlU2BMap[uIdx] = bIdx;
+ if (typeof self.cache.mlB2UMap[bIdx] === 'undefined') {
+ self.cache.mlB2UMap[bIdx] = uIdx;
+ }
+ uIdx++;
+ }
+ });
+ } else {
+ var uLine = bLine;
+
+ uLine.candidates = candidates;
+ uLine.iceUfrag = iceUfrag;
+ uLine.icePwd = icePwd;
+ uLine.fingerprint = fingerprint;
+ uLine.port = port;
+
+ mid2ul[uLine.mid] = uLine;
+
+ self.cache.mlU2BMap[uIdx] = bIdx;
+ if (typeof self.cache.mlB2UMap[bIdx] === 'undefined') {
+ self.cache.mlB2UMap[bIdx] = uIdx;
+ }
+ }
+
+ bIdx++;
+ });
+
+ // Rebuild the media array in the right order and add the missing mLines
+ // (missing from the Plan B SDP).
+ session.media = [];
+ mids = []; // reuse
+
+ if (desc.type === 'answer') {
+
+ // The media lines in the answer must match the media lines in the
+ // offer. The order is important too. Here we assume that Firefox is
+ // the answerer, so we merely have to use the reconstructed (unified)
+ // answer to update the cached (unified) answer accordingly.
+ //
+ // In the general case, one would have to use the cached (unified)
+ // offer to find the m-lines that are missing from the reconstructed
+ // answer, potentially grabbing them from the cached (unified) answer.
+ // One has to be careful with this approach because inactive m-lines do
+ // not always have an mid, making it tricky (impossible?) to find where
+ // exactly and which m-lines are missing from the reconstructed answer.
+
+ for (var i = 0; i < cached.media.length; i++) {
+ var uLine = cached.media[i];
+
+ delete uLine.msid;
+ delete uLine.sources;
+ delete uLine.ssrcGroups;
+
+ if (typeof sources2ul[i] === 'undefined') {
+ if (!uLine.direction
+ || uLine.direction === 'sendrecv')
+ uLine.direction = 'recvonly';
+ else if (uLine.direction === 'sendonly')
+ uLine.direction = 'inactive';
+ } else {
+ if (!uLine.direction
+ || uLine.direction === 'sendrecv')
+ uLine.direction = 'sendrecv';
+ else if (uLine.direction === 'recvonly')
+ uLine.direction = 'sendonly';
+ }
+
+ uLine.sources = sources2ul[i];
+ uLine.candidates = candidates;
+ uLine.iceUfrag = iceUfrag;
+ uLine.icePwd = icePwd;
+ uLine.fingerprint = fingerprint;
+
+ uLine.rtp = rtp[uLine.type];
+ uLine.payloads = payloads[uLine.type];
+ uLine.rtcpFb = rtcpFb[uLine.type];
+
+ session.media.push(uLine);
+
+ if (typeof uLine.mid === 'string') {
+ // inactive lines don't/may not have an mid.
+ mids.push(uLine.mid);
+ }
+ }
+ } else {
+
+ // SDP offer/answer (and the JSEP spec) forbids removing an m-section
+ // under any circumstances. If we are no longer interested in sending a
+ // track, we just remove the msid and ssrc attributes and set it to
+ // either a=recvonly (as the reofferer, we must use recvonly if the
+ // other side was previously sending on the m-section, but we can also
+ // leave the possibility open if it wasn't previously in use), or
+ // a=inactive.
+
+ if (typeof cached !== 'undefined' &&
+ typeof cached.media !== 'undefined' &&
+ Array.isArray(cached.media)) {
+ cached.media.forEach(function(uLine) {
+ mids.push(uLine.mid);
+ if (typeof mid2ul[uLine.mid] !== 'undefined') {
+ session.media.push(mid2ul[uLine.mid]);
+ } else {
+ delete uLine.msid;
+ delete uLine.sources;
+ delete uLine.ssrcGroups;
+
+ if (!uLine.direction
+ || uLine.direction === 'sendrecv') {
+ uLine.direction = 'sendonly';
+ }
+ if (!uLine.direction
+ || uLine.direction === 'recvonly') {
+ uLine.direction = 'inactive';
+ }
+
+ addSetupAttr (uLine);
+ session.media.push(uLine);
+ }
+ });
+ }
+
+ // Add all the remaining (new) m-lines of the transformed SDP.
+ Object.keys(mid2ul).forEach(function(mid) {
+ if (mids.indexOf(mid) === -1) {
+ mids.push(mid);
+ if (mid2ul[mid].direction === 'recvonly') {
+ // This is a remote recvonly channel. Add its SSRC to the
+ // appropriate sendrecv or sendonly channel.
+ // TODO(gp) what if we don't have sendrecv/sendonly
+ // channel?
+
+ var done = false;
+
+ session.media.some(function (uLine) {
+ if ((uLine.direction === 'sendrecv' ||
+ uLine.direction === 'sendonly') &&
+ uLine.type === mid2ul[mid].type) {
+ // mid2ul[mid] shouldn't have any ssrc-groups
+ Object.keys(mid2ul[mid].sources).forEach(
+ function (ssrc) {
+ uLine.sources[ssrc] =
+ mid2ul[mid].sources[ssrc];
+ });
+
+ done = true;
+ return true;
+ }
+ });
+
+ if (!done) {
+ session.media.push(mid2ul[mid]);
+ }
+ } else {
+ session.media.push(mid2ul[mid]);
+ }
+ }
+ });
+ }
+
+ // After we have constructed the Plan Unified m-lines we can figure out
+ // where (in which m-line) to place the 'recvonly SSRCs'.
+ // Note: we assume here that we are the answerer in the O/A, so any offers
+ // which we translate come from the remote side, while answers are local
+ // (and so our last local description is cached as an 'answer').
+ ["audio", "video"].forEach(function (type) {
+ if (!session || !session.media || !Array.isArray(session.media))
+ return;
+
+ var idx = null;
+ if (Object.keys(recvonlySsrcs[type]).length > 0) {
+ idx = self.getFirstSendingIndexFromAnswer(type);
+ if (idx === null){
+ // If this is the first offer we receive, we don't have a
+ // cached answer. Assume that we will be sending media using
+ // the first m-line for each media type.
+
+ for (var i = 0; i < session.media.length; i++) {
+ if (session.media[i].type === type) {
+ idx = i;
+ break;
+ }
+ }
+ }
+ }
+
+ if (idx && session.media.length > idx) {
+ var mLine = session.media[idx];
+ Object.keys(recvonlySsrcs[type]).forEach(function(ssrc) {
+ if (mLine.sources && mLine.sources[ssrc]) {
+ console.warn("Replacing an existing SSRC.");
+ }
+ if (!mLine.sources) {
+ mLine.sources = {};
+ }
+
+ mLine.sources[ssrc] = recvonlySsrcs[type][ssrc];
+ });
+ }
+ });
+
+ if (typeof session.groups !== 'undefined') {
+ // We regenerate the BUNDLE group (since we regenerated the mids)
+ session.groups.some(function(group) {
+ if (group.type === 'BUNDLE') {
+ group.mids = mids.join(' ');
+ return true;
+ }
+ });
+ }
+
+ // msid semantic
+ session.msidSemantic = {
+ semantic: 'WMS',
+ token: '*'
+ };
+
+ var resStr = transform.write(session);
+
+ // Cache the transformed SDP (Unified Plan) for later re-use in this
+ // function.
+ this.cache[desc.type] = resStr;
+
+ return new RTCSessionDescription({
+ type: desc.type,
+ sdp: resStr
+ });
+
+ //#endregion
+};
+
+},{"./array-equals":17,"./transform":20}],20:[function(require,module,exports){
+/* Copyright @ 2015 Atlassian Pty Ltd
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+var transform = require('sdp-transform');
+
+exports.write = function(session, opts) {
+
+ if (typeof session !== 'undefined' &&
+ typeof session.media !== 'undefined' &&
+ Array.isArray(session.media)) {
+
+ session.media.forEach(function (mLine) {
+ // expand sources to ssrcs
+ if (typeof mLine.sources !== 'undefined' &&
+ Object.keys(mLine.sources).length !== 0) {
+ mLine.ssrcs = [];
+ Object.keys(mLine.sources).forEach(function (ssrc) {
+ var source = mLine.sources[ssrc];
+ Object.keys(source).forEach(function (attribute) {
+ mLine.ssrcs.push({
+ id: ssrc,
+ attribute: attribute,
+ value: source[attribute]
+ });
+ });
+ });
+ delete mLine.sources;
+ }
+
+ // join ssrcs in ssrc groups
+ if (typeof mLine.ssrcGroups !== 'undefined' &&
+ Array.isArray(mLine.ssrcGroups)) {
+ mLine.ssrcGroups.forEach(function (ssrcGroup) {
+ if (typeof ssrcGroup.ssrcs !== 'undefined' &&
+ Array.isArray(ssrcGroup.ssrcs)) {
+ ssrcGroup.ssrcs = ssrcGroup.ssrcs.join(' ');
+ }
+ });
+ }
+ });
+ }
+
+ // join group mids
+ if (typeof session !== 'undefined' &&
+ typeof session.groups !== 'undefined' && Array.isArray(session.groups)) {
+
+ session.groups.forEach(function (g) {
+ if (typeof g.mids !== 'undefined' && Array.isArray(g.mids)) {
+ g.mids = g.mids.join(' ');
+ }
+ });
+ }
+
+ return transform.write(session, opts);
+};
+
+exports.parse = function(sdp) {
+ var session = transform.parse(sdp);
+
+ if (typeof session !== 'undefined' && typeof session.media !== 'undefined' &&
+ Array.isArray(session.media)) {
+
+ session.media.forEach(function (mLine) {
+ // group sources attributes by ssrc
+ if (typeof mLine.ssrcs !== 'undefined' && Array.isArray(mLine.ssrcs)) {
+ mLine.sources = {};
+ mLine.ssrcs.forEach(function (ssrc) {
+ if (!mLine.sources[ssrc.id])
+ mLine.sources[ssrc.id] = {};
+ mLine.sources[ssrc.id][ssrc.attribute] = ssrc.value;
+ });
+
+ delete mLine.ssrcs;
+ }
+
+ // split ssrcs in ssrc groups
+ if (typeof mLine.ssrcGroups !== 'undefined' &&
+ Array.isArray(mLine.ssrcGroups)) {
+ mLine.ssrcGroups.forEach(function (ssrcGroup) {
+ if (typeof ssrcGroup.ssrcs === 'string') {
+ ssrcGroup.ssrcs = ssrcGroup.ssrcs.split(' ');
+ }
+ });
+ }
+ });
+ }
+ // split group mids
+ if (typeof session !== 'undefined' &&
+ typeof session.groups !== 'undefined' && Array.isArray(session.groups)) {
+
+ session.groups.forEach(function (g) {
+ if (typeof g.mids === 'string') {
+ g.mids = g.mids.split(' ');
+ }
+ });
+ }
+
+ return session;
+};
+
+
+},{"sdp-transform":14}],21:[function(require,module,exports){
+/**
+ * UAParser.js v0.7.17
+ * Lightweight JavaScript-based User-Agent string parser
+ * https://github.com/faisalman/ua-parser-js
+ *
+ * Copyright © 2012-2016 Faisal Salman <fyzlman@gmail.com>
+ * Dual licensed under GPLv2 & MIT
+ */
+
+(function (window, undefined) {
+
+ 'use strict';
+
+ //////////////
+ // Constants
+ /////////////
+
+
+ var LIBVERSION = '0.7.17',
+ EMPTY = '',
+ UNKNOWN = '?',
+ FUNC_TYPE = 'function',
+ UNDEF_TYPE = 'undefined',
+ OBJ_TYPE = 'object',
+ STR_TYPE = 'string',
+ MAJOR = 'major', // deprecated
+ MODEL = 'model',
+ NAME = 'name',
+ TYPE = 'type',
+ VENDOR = 'vendor',
+ VERSION = 'version',
+ ARCHITECTURE= 'architecture',
+ CONSOLE = 'console',
+ MOBILE = 'mobile',
+ TABLET = 'tablet',
+ SMARTTV = 'smarttv',
+ WEARABLE = 'wearable',
+ EMBEDDED = 'embedded';
+
+
+ ///////////
+ // Helper
+ //////////
+
+
+ var util = {
+ extend : function (regexes, extensions) {
+ var margedRegexes = {};
+ for (var i in regexes) {
+ if (extensions[i] && extensions[i].length % 2 === 0) {
+ margedRegexes[i] = extensions[i].concat(regexes[i]);
+ } else {
+ margedRegexes[i] = regexes[i];
+ }
+ }
+ return margedRegexes;
+ },
+ has : function (str1, str2) {
+ if (typeof str1 === "string") {
+ return str2.toLowerCase().indexOf(str1.toLowerCase()) !== -1;
+ } else {
+ return false;
+ }
+ },
+ lowerize : function (str) {
+ return str.toLowerCase();
+ },
+ major : function (version) {
+ return typeof(version) === STR_TYPE ? version.replace(/[^\d\.]/g,'').split(".")[0] : undefined;
+ },
+ trim : function (str) {
+ return str.replace(/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, '');
+ }
+ };
+
+
+ ///////////////
+ // Map helper
+ //////////////
+
+
+ var mapper = {
+
+ rgx : function (ua, arrays) {
+
+ //var result = {},
+ var i = 0, j, k, p, q, matches, match;//, args = arguments;
+
+ /*// construct object barebones
+ for (p = 0; p < args[1].length; p++) {
+ q = args[1][p];
+ result[typeof q === OBJ_TYPE ? q[0] : q] = undefined;
+ }*/
+
+ // loop through all regexes maps
+ while (i < arrays.length && !matches) {
+
+ var regex = arrays[i], // even sequence (0,2,4,..)
+ props = arrays[i + 1]; // odd sequence (1,3,5,..)
+ j = k = 0;
+
+ // try matching uastring with regexes
+ while (j < regex.length && !matches) {
+
+ matches = regex[j++].exec(ua);
+
+ if (!!matches) {
+ for (p = 0; p < props.length; p++) {
+ match = matches[++k];
+ q = props[p];
+ // check if given property is actually array
+ if (typeof q === OBJ_TYPE && q.length > 0) {
+ if (q.length == 2) {
+ if (typeof q[1] == FUNC_TYPE) {
+ // assign modified match
+ this[q[0]] = q[1].call(this, match);
+ } else {
+ // assign given value, ignore regex match
+ this[q[0]] = q[1];
+ }
+ } else if (q.length == 3) {
+ // check whether function or regex
+ if (typeof q[1] === FUNC_TYPE && !(q[1].exec && q[1].test)) {
+ // call function (usually string mapper)
+ this[q[0]] = match ? q[1].call(this, match, q[2]) : undefined;
+ } else {
+ // sanitize match using given regex
+ this[q[0]] = match ? match.replace(q[1], q[2]) : undefined;
+ }
+ } else if (q.length == 4) {
+ this[q[0]] = match ? q[3].call(this, match.replace(q[1], q[2])) : undefined;
+ }
+ } else {
+ this[q] = match ? match : undefined;
+ }
+ }
+ }
+ }
+ i += 2;
+ }
+ // console.log(this);
+ //return this;
+ },
+
+ str : function (str, map) {
+
+ for (var i in map) {
+ // check if array
+ if (typeof map[i] === OBJ_TYPE && map[i].length > 0) {
+ for (var j = 0; j < map[i].length; j++) {
+ if (util.has(map[i][j], str)) {
+ return (i === UNKNOWN) ? undefined : i;
+ }
+ }
+ } else if (util.has(map[i], str)) {
+ return (i === UNKNOWN) ? undefined : i;
+ }
+ }
+ return str;
+ }
+ };
+
+
+ ///////////////
+ // String map
+ //////////////
+
+
+ var maps = {
+
+ browser : {
+ oldsafari : {
+ version : {
+ '1.0' : '/8',
+ '1.2' : '/1',
+ '1.3' : '/3',
+ '2.0' : '/412',
+ '2.0.2' : '/416',
+ '2.0.3' : '/417',
+ '2.0.4' : '/419',
+ '?' : '/'
+ }
+ }
+ },
+
+ device : {
+ amazon : {
+ model : {
+ 'Fire Phone' : ['SD', 'KF']
+ }
+ },
+ sprint : {
+ model : {
+ 'Evo Shift 4G' : '7373KT'
+ },
+ vendor : {
+ 'HTC' : 'APA',
+ 'Sprint' : 'Sprint'
+ }
+ }
+ },
+
+ os : {
+ windows : {
+ version : {
+ 'ME' : '4.90',
+ 'NT 3.11' : 'NT3.51',
+ 'NT 4.0' : 'NT4.0',
+ '2000' : 'NT 5.0',
+ 'XP' : ['NT 5.1', 'NT 5.2'],
+ 'Vista' : 'NT 6.0',
+ '7' : 'NT 6.1',
+ '8' : 'NT 6.2',
+ '8.1' : 'NT 6.3',
+ '10' : ['NT 6.4', 'NT 10.0'],
+ 'RT' : 'ARM'
+ }
+ }
+ }
+ };
+
+
+ //////////////
+ // Regex map
+ /////////////
+
+
+ var regexes = {
+
+ browser : [[
+
+ // Presto based
+ /(opera\smini)\/([\w\.-]+)/i, // Opera Mini
+ /(opera\s[mobiletab]+).+version\/([\w\.-]+)/i, // Opera Mobi/Tablet
+ /(opera).+version\/([\w\.]+)/i, // Opera > 9.80
+ /(opera)[\/\s]+([\w\.]+)/i // Opera < 9.80
+ ], [NAME, VERSION], [
+
+ /(opios)[\/\s]+([\w\.]+)/i // Opera mini on iphone >= 8.0
+ ], [[NAME, 'Opera Mini'], VERSION], [
+
+ /\s(opr)\/([\w\.]+)/i // Opera Webkit
+ ], [[NAME, 'Opera'], VERSION], [
+
+ // Mixed
+ /(kindle)\/([\w\.]+)/i, // Kindle
+ /(lunascape|maxthon|netfront|jasmine|blazer)[\/\s]?([\w\.]+)*/i,
+ // Lunascape/Maxthon/Netfront/Jasmine/Blazer
+
+ // Trident based
+ /(avant\s|iemobile|slim|baidu)(?:browser)?[\/\s]?([\w\.]*)/i,
+ // Avant/IEMobile/SlimBrowser/Baidu
+ /(?:ms|\()(ie)\s([\w\.]+)/i, // Internet Explorer
+
+ // Webkit/KHTML based
+ /(rekonq)\/([\w\.]+)*/i, // Rekonq
+ /(chromium|flock|rockmelt|midori|epiphany|silk|skyfire|ovibrowser|bolt|iron|vivaldi|iridium|phantomjs|bowser)\/([\w\.-]+)/i
+ // Chromium/Flock/RockMelt/Midori/Epiphany/Silk/Skyfire/Bolt/Iron/Iridium/PhantomJS/Bowser
+ ], [NAME, VERSION], [
+
+ /(trident).+rv[:\s]([\w\.]+).+like\sgecko/i // IE11
+ ], [[NAME, 'IE'], VERSION], [
+
+ /(edge)\/((\d+)?[\w\.]+)/i // Microsoft Edge
+ ], [NAME, VERSION], [
+
+ /(yabrowser)\/([\w\.]+)/i // Yandex
+ ], [[NAME, 'Yandex'], VERSION], [
+
+ /(puffin)\/([\w\.]+)/i // Puffin
+ ], [[NAME, 'Puffin'], VERSION], [
+
+ /((?:[\s\/])uc?\s?browser|(?:juc.+)ucweb)[\/\s]?([\w\.]+)/i
+ // UCBrowser
+ ], [[NAME, 'UCBrowser'], VERSION], [
+
+ /(comodo_dragon)\/([\w\.]+)/i // Comodo Dragon
+ ], [[NAME, /_/g, ' '], VERSION], [
+
+ /(micromessenger)\/([\w\.]+)/i // WeChat
+ ], [[NAME, 'WeChat'], VERSION], [
+
+ /(QQ)\/([\d\.]+)/i // QQ, aka ShouQ
+ ], [NAME, VERSION], [
+
+ /m?(qqbrowser)[\/\s]?([\w\.]+)/i // QQBrowser
+ ], [NAME, VERSION], [
+
+ /xiaomi\/miuibrowser\/([\w\.]+)/i // MIUI Browser
+ ], [VERSION, [NAME, 'MIUI Browser']], [
+
+ /;fbav\/([\w\.]+);/i // Facebook App for iOS & Android
+ ], [VERSION, [NAME, 'Facebook']], [
+
+ /headlesschrome(?:\/([\w\.]+)|\s)/i // Chrome Headless
+ ], [VERSION, [NAME, 'Chrome Headless']], [
+
+ /\swv\).+(chrome)\/([\w\.]+)/i // Chrome WebView
+ ], [[NAME, /(.+)/, '$1 WebView'], VERSION], [
+
+ /((?:oculus|samsung)browser)\/([\w\.]+)/i
+ ], [[NAME, /(.+(?:g|us))(.+)/, '$1 $2'], VERSION], [ // Oculus / Samsung Browser
+
+ /android.+version\/([\w\.]+)\s+(?:mobile\s?safari|safari)*/i // Android Browser
+ ], [VERSION, [NAME, 'Android Browser']], [
+
+ /(chrome|omniweb|arora|[tizenoka]{5}\s?browser)\/v?([\w\.]+)/i
+ // Chrome/OmniWeb/Arora/Tizen/Nokia
+ ], [NAME, VERSION], [
+
+ /(dolfin)\/([\w\.]+)/i // Dolphin
+ ], [[NAME, 'Dolphin'], VERSION], [
+
+ /((?:android.+)crmo|crios)\/([\w\.]+)/i // Chrome for Android/iOS
+ ], [[NAME, 'Chrome'], VERSION], [
+
+ /(coast)\/([\w\.]+)/i // Opera Coast
+ ], [[NAME, 'Opera Coast'], VERSION], [
+
+ /fxios\/([\w\.-]+)/i // Firefox for iOS
+ ], [VERSION, [NAME, 'Firefox']], [
+
+ /version\/([\w\.]+).+?mobile\/\w+\s(safari)/i // Mobile Safari
+ ], [VERSION, [NAME, 'Mobile Safari']], [
+
+ /version\/([\w\.]+).+?(mobile\s?safari|safari)/i // Safari & Safari Mobile
+ ], [VERSION, NAME], [
+
+ /webkit.+?(gsa)\/([\w\.]+).+?(mobile\s?safari|safari)(\/[\w\.]+)/i // Google Search Appliance on iOS
+ ], [[NAME, 'GSA'], VERSION], [
+
+ /webkit.+?(mobile\s?safari|safari)(\/[\w\.]+)/i // Safari < 3.0
+ ], [NAME, [VERSION, mapper.str, maps.browser.oldsafari.version]], [
+
+ /(konqueror)\/([\w\.]+)/i, // Konqueror
+ /(webkit|khtml)\/([\w\.]+)/i
+ ], [NAME, VERSION], [
+
+ // Gecko based
+ /(navigator|netscape)\/([\w\.-]+)/i // Netscape
+ ], [[NAME, 'Netscape'], VERSION], [
+ /(swiftfox)/i, // Swiftfox
+ /(icedragon|iceweasel|camino|chimera|fennec|maemo\sbrowser|minimo|conkeror)[\/\s]?([\w\.\+]+)/i,
+ // IceDragon/Iceweasel/Camino/Chimera/Fennec/Maemo/Minimo/Conkeror
+ /(firefox|seamonkey|k-meleon|icecat|iceape|firebird|phoenix)\/([\w\.-]+)/i,
+ // Firefox/SeaMonkey/K-Meleon/IceCat/IceApe/Firebird/Phoenix
+ /(mozilla)\/([\w\.]+).+rv\:.+gecko\/\d+/i, // Mozilla
+
+ // Other
+ /(polaris|lynx|dillo|icab|doris|amaya|w3m|netsurf|sleipnir)[\/\s]?([\w\.]+)/i,
+ // Polaris/Lynx/Dillo/iCab/Doris/Amaya/w3m/NetSurf/Sleipnir
+ /(links)\s\(([\w\.]+)/i, // Links
+ /(gobrowser)\/?([\w\.]+)*/i, // GoBrowser
+ /(ice\s?browser)\/v?([\w\._]+)/i, // ICE Browser
+ /(mosaic)[\/\s]([\w\.]+)/i // Mosaic
+ ], [NAME, VERSION]
+
+ /* /////////////////////
+ // Media players BEGIN
+ ////////////////////////
+
+ , [
+
+ /(apple(?:coremedia|))\/((\d+)[\w\._]+)/i, // Generic Apple CoreMedia
+ /(coremedia) v((\d+)[\w\._]+)/i
+ ], [NAME, VERSION], [
+
+ /(aqualung|lyssna|bsplayer)\/((\d+)?[\w\.-]+)/i // Aqualung/Lyssna/BSPlayer
+ ], [NAME, VERSION], [
+
+ /(ares|ossproxy)\s((\d+)[\w\.-]+)/i // Ares/OSSProxy
+ ], [NAME, VERSION], [
+
+ /(audacious|audimusicstream|amarok|bass|core|dalvik|gnomemplayer|music on console|nsplayer|psp-internetradioplayer|videos)\/((\d+)[\w\.-]+)/i,
+ // Audacious/AudiMusicStream/Amarok/BASS/OpenCORE/Dalvik/GnomeMplayer/MoC
+ // NSPlayer/PSP-InternetRadioPlayer/Videos
+ /(clementine|music player daemon)\s((\d+)[\w\.-]+)/i, // Clementine/MPD
+ /(lg player|nexplayer)\s((\d+)[\d\.]+)/i,
+ /player\/(nexplayer|lg player)\s((\d+)[\w\.-]+)/i // NexPlayer/LG Player
+ ], [NAME, VERSION], [
+ /(nexplayer)\s((\d+)[\w\.-]+)/i // Nexplayer
+ ], [NAME, VERSION], [
+
+ /(flrp)\/((\d+)[\w\.-]+)/i // Flip Player
+ ], [[NAME, 'Flip Player'], VERSION], [
+
+ /(fstream|nativehost|queryseekspider|ia-archiver|facebookexternalhit)/i
+ // FStream/NativeHost/QuerySeekSpider/IA Archiver/facebookexternalhit
+ ], [NAME], [
+
+ /(gstreamer) souphttpsrc (?:\([^\)]+\)){0,1} libsoup\/((\d+)[\w\.-]+)/i
+ // Gstreamer
+ ], [NAME, VERSION], [
+
+ /(htc streaming player)\s[\w_]+\s\/\s((\d+)[\d\.]+)/i, // HTC Streaming Player
+ /(java|python-urllib|python-requests|wget|libcurl)\/((\d+)[\w\.-_]+)/i,
+ // Java/urllib/requests/wget/cURL
+ /(lavf)((\d+)[\d\.]+)/i // Lavf (FFMPEG)
+ ], [NAME, VERSION], [
+
+ /(htc_one_s)\/((\d+)[\d\.]+)/i // HTC One S
+ ], [[NAME, /_/g, ' '], VERSION], [
+
+ /(mplayer)(?:\s|\/)(?:(?:sherpya-){0,1}svn)(?:-|\s)(r\d+(?:-\d+[\w\.-]+){0,1})/i
+ // MPlayer SVN
+ ], [NAME, VERSION], [
+
+ /(mplayer)(?:\s|\/|[unkow-]+)((\d+)[\w\.-]+)/i // MPlayer
+ ], [NAME, VERSION], [
+
+ /(mplayer)/i, // MPlayer (no other info)
+ /(yourmuze)/i, // YourMuze
+ /(media player classic|nero showtime)/i // Media Player Classic/Nero ShowTime
+ ], [NAME], [
+
+ /(nero (?:home|scout))\/((\d+)[\w\.-]+)/i // Nero Home/Nero Scout
+ ], [NAME, VERSION], [
+
+ /(nokia\d+)\/((\d+)[\w\.-]+)/i // Nokia
+ ], [NAME, VERSION], [
+
+ /\s(songbird)\/((\d+)[\w\.-]+)/i // Songbird/Philips-Songbird
+ ], [NAME, VERSION], [
+
+ /(winamp)3 version ((\d+)[\w\.-]+)/i, // Winamp
+ /(winamp)\s((\d+)[\w\.-]+)/i,
+ /(winamp)mpeg\/((\d+)[\w\.-]+)/i
+ ], [NAME, VERSION], [
+
+ /(ocms-bot|tapinradio|tunein radio|unknown|winamp|inlight radio)/i // OCMS-bot/tap in radio/tunein/unknown/winamp (no other info)
+ // inlight radio
+ ], [NAME], [
+
+ /(quicktime|rma|radioapp|radioclientapplication|soundtap|totem|stagefright|streamium)\/((\d+)[\w\.-]+)/i
+ // QuickTime/RealMedia/RadioApp/RadioClientApplication/
+ // SoundTap/Totem/Stagefright/Streamium
+ ], [NAME, VERSION], [
+
+ /(smp)((\d+)[\d\.]+)/i // SMP
+ ], [NAME, VERSION], [
+
+ /(vlc) media player - version ((\d+)[\w\.]+)/i, // VLC Videolan
+ /(vlc)\/((\d+)[\w\.-]+)/i,
+ /(xbmc|gvfs|xine|xmms|irapp)\/((\d+)[\w\.-]+)/i, // XBMC/gvfs/Xine/XMMS/irapp
+ /(foobar2000)\/((\d+)[\d\.]+)/i, // Foobar2000
+ /(itunes)\/((\d+)[\d\.]+)/i // iTunes
+ ], [NAME, VERSION], [
+
+ /(wmplayer)\/((\d+)[\w\.-]+)/i, // Windows Media Player
+ /(windows-media-player)\/((\d+)[\w\.-]+)/i
+ ], [[NAME, /-/g, ' '], VERSION], [
+
+ /windows\/((\d+)[\w\.-]+) upnp\/[\d\.]+ dlnadoc\/[\d\.]+ (home media server)/i
+ // Windows Media Server
+ ], [VERSION, [NAME, 'Windows']], [
+
+ /(com\.riseupradioalarm)\/((\d+)[\d\.]*)/i // RiseUP Radio Alarm
+ ], [NAME, VERSION], [
+
+ /(rad.io)\s((\d+)[\d\.]+)/i, // Rad.io
+ /(radio.(?:de|at|fr))\s((\d+)[\d\.]+)/i
+ ], [[NAME, 'rad.io'], VERSION]
+
+ //////////////////////
+ // Media players END
+ ////////////////////*/
+
+ ],
+
+ cpu : [[
+
+ /(?:(amd|x(?:(?:86|64)[_-])?|wow|win)64)[;\)]/i // AMD64
+ ], [[ARCHITECTURE, 'amd64']], [
+
+ /(ia32(?=;))/i // IA32 (quicktime)
+ ], [[ARCHITECTURE, util.lowerize]], [
+
+ /((?:i[346]|x)86)[;\)]/i // IA32
+ ], [[ARCHITECTURE, 'ia32']], [
+
+ // PocketPC mistakenly identified as PowerPC
+ /windows\s(ce|mobile);\sppc;/i
+ ], [[ARCHITECTURE, 'arm']], [
+
+ /((?:ppc|powerpc)(?:64)?)(?:\smac|;|\))/i // PowerPC
+ ], [[ARCHITECTURE, /ower/, '', util.lowerize]], [
+
+ /(sun4\w)[;\)]/i // SPARC
+ ], [[ARCHITECTURE, 'sparc']], [
+
+ /((?:avr32|ia64(?=;))|68k(?=\))|arm(?:64|(?=v\d+;))|(?=atmel\s)avr|(?:irix|mips|sparc)(?:64)?(?=;)|pa-risc)/i
+ // IA64, 68K, ARM/64, AVR/32, IRIX/64, MIPS/64, SPARC/64, PA-RISC
+ ], [[ARCHITECTURE, util.lowerize]]
+ ],
+
+ device : [[
+
+ /\((ipad|playbook);[\w\s\);-]+(rim|apple)/i // iPad/PlayBook
+ ], [MODEL, VENDOR, [TYPE, TABLET]], [
+
+ /applecoremedia\/[\w\.]+ \((ipad)/ // iPad
+ ], [MODEL, [VENDOR, 'Apple'], [TYPE, TABLET]], [
+
+ /(apple\s{0,1}tv)/i // Apple TV
+ ], [[MODEL, 'Apple TV'], [VENDOR, 'Apple']], [
+
+ /(archos)\s(gamepad2?)/i, // Archos
+ /(hp).+(touchpad)/i, // HP TouchPad
+ /(hp).+(tablet)/i, // HP Tablet
+ /(kindle)\/([\w\.]+)/i, // Kindle
+ /\s(nook)[\w\s]+build\/(\w+)/i, // Nook
+ /(dell)\s(strea[kpr\s\d]*[\dko])/i // Dell Streak
+ ], [VENDOR, MODEL, [TYPE, TABLET]], [
+
+ /(kf[A-z]+)\sbuild\/[\w\.]+.*silk\//i // Kindle Fire HD
+ ], [MODEL, [VENDOR, 'Amazon'], [TYPE, TABLET]], [
+ /(sd|kf)[0349hijorstuw]+\sbuild\/[\w\.]+.*silk\//i // Fire Phone
+ ], [[MODEL, mapper.str, maps.device.amazon.model], [VENDOR, 'Amazon'], [TYPE, MOBILE]], [
+
+ /\((ip[honed|\s\w*]+);.+(apple)/i // iPod/iPhone
+ ], [MODEL, VENDOR, [TYPE, MOBILE]], [
+ /\((ip[honed|\s\w*]+);/i // iPod/iPhone
+ ], [MODEL, [VENDOR, 'Apple'], [TYPE, MOBILE]], [
+
+ /(blackberry)[\s-]?(\w+)/i, // BlackBerry
+ /(blackberry|benq|palm(?=\-)|sonyericsson|acer|asus|dell|meizu|motorola|polytron)[\s_-]?([\w-]+)*/i,
+ // BenQ/Palm/Sony-Ericsson/Acer/Asus/Dell/Meizu/Motorola/Polytron
+ /(hp)\s([\w\s]+\w)/i, // HP iPAQ
+ /(asus)-?(\w+)/i // Asus
+ ], [VENDOR, MODEL, [TYPE, MOBILE]], [
+ /\(bb10;\s(\w+)/i // BlackBerry 10
+ ], [MODEL, [VENDOR, 'BlackBerry'], [TYPE, MOBILE]], [
+ // Asus Tablets
+ /android.+(transfo[prime\s]{4,10}\s\w+|eeepc|slider\s\w+|nexus 7|padfone)/i
+ ], [MODEL, [VENDOR, 'Asus'], [TYPE, TABLET]], [
+
+ /(sony)\s(tablet\s[ps])\sbuild\//i, // Sony
+ /(sony)?(?:sgp.+)\sbuild\//i
+ ], [[VENDOR, 'Sony'], [MODEL, 'Xperia Tablet'], [TYPE, TABLET]], [
+ /android.+\s([c-g]\d{4}|so[-l]\w+)\sbuild\//i
+ ], [MODEL, [VENDOR, 'Sony'], [TYPE, MOBILE]], [
+
+ /\s(ouya)\s/i, // Ouya
+ /(nintendo)\s([wids3u]+)/i // Nintendo
+ ], [VENDOR, MODEL, [TYPE, CONSOLE]], [
+
+ /android.+;\s(shield)\sbuild/i // Nvidia
+ ], [MODEL, [VENDOR, 'Nvidia'], [TYPE, CONSOLE]], [
+
+ /(playstation\s[34portablevi]+)/i // Playstation
+ ], [MODEL, [VENDOR, 'Sony'], [TYPE, CONSOLE]], [
+
+ /(sprint\s(\w+))/i // Sprint Phones
+ ], [[VENDOR, mapper.str, maps.device.sprint.vendor], [MODEL, mapper.str, maps.device.sprint.model], [TYPE, MOBILE]], [
+
+ /(lenovo)\s?(S(?:5000|6000)+(?:[-][\w+]))/i // Lenovo tablets
+ ], [VENDOR, MODEL, [TYPE, TABLET]], [
+
+ /(htc)[;_\s-]+([\w\s]+(?=\))|\w+)*/i, // HTC
+ /(zte)-(\w+)*/i, // ZTE
+ /(alcatel|geeksphone|lenovo|nexian|panasonic|(?=;\s)sony)[_\s-]?([\w-]+)*/i
+ // Alcatel/GeeksPhone/Lenovo/Nexian/Panasonic/Sony
+ ], [VENDOR, [MODEL, /_/g, ' '], [TYPE, MOBILE]], [
+
+ /(nexus\s9)/i // HTC Nexus 9
+ ], [MODEL, [VENDOR, 'HTC'], [TYPE, TABLET]], [
+
+ /d\/huawei([\w\s-]+)[;\)]/i,
+ /(nexus\s6p)/i // Huawei
+ ], [MODEL, [VENDOR, 'Huawei'], [TYPE, MOBILE]], [
+
+ /(microsoft);\s(lumia[\s\w]+)/i // Microsoft Lumia
+ ], [VENDOR, MODEL, [TYPE, MOBILE]], [
+
+ /[\s\(;](xbox(?:\sone)?)[\s\);]/i // Microsoft Xbox
+ ], [MODEL, [VENDOR, 'Microsoft'], [TYPE, CONSOLE]], [
+ /(kin\.[onetw]{3})/i // Microsoft Kin
+ ], [[MODEL, /\./g, ' '], [VENDOR, 'Microsoft'], [TYPE, MOBILE]], [
+
+ // Motorola
+ /\s(milestone|droid(?:[2-4x]|\s(?:bionic|x2|pro|razr))?(:?\s4g)?)[\w\s]+build\//i,
+ /mot[\s-]?(\w+)*/i,
+ /(XT\d{3,4}) build\//i,
+ /(nexus\s6)/i
+ ], [MODEL, [VENDOR, 'Motorola'], [TYPE, MOBILE]], [
+ /android.+\s(mz60\d|xoom[\s2]{0,2})\sbuild\//i
+ ], [MODEL, [VENDOR, 'Motorola'], [TYPE, TABLET]], [
+
+ /hbbtv\/\d+\.\d+\.\d+\s+\([\w\s]*;\s*(\w[^;]*);([^;]*)/i // HbbTV devices
+ ], [[VENDOR, util.trim], [MODEL, util.trim], [TYPE, SMARTTV]], [
+
+ /hbbtv.+maple;(\d+)/i
+ ], [[MODEL, /^/, 'SmartTV'], [VENDOR, 'Samsung'], [TYPE, SMARTTV]], [
+
+ /\(dtv[\);].+(aquos)/i // Sharp
+ ], [MODEL, [VENDOR, 'Sharp'], [TYPE, SMARTTV]], [
+
+ /android.+((sch-i[89]0\d|shw-m380s|gt-p\d{4}|gt-n\d+|sgh-t8[56]9|nexus 10))/i,
+ /((SM-T\w+))/i
+ ], [[VENDOR, 'Samsung'], MODEL, [TYPE, TABLET]], [ // Samsung
+ /smart-tv.+(samsung)/i
+ ], [VENDOR, [TYPE, SMARTTV], MODEL], [
+ /((s[cgp]h-\w+|gt-\w+|galaxy\snexus|sm-\w[\w\d]+))/i,
+ /(sam[sung]*)[\s-]*(\w+-?[\w-]*)*/i,
+ /sec-((sgh\w+))/i
+ ], [[VENDOR, 'Samsung'], MODEL, [TYPE, MOBILE]], [
+
+ /sie-(\w+)*/i // Siemens
+ ], [MODEL, [VENDOR, 'Siemens'], [TYPE, MOBILE]], [
+
+ /(maemo|nokia).*(n900|lumia\s\d+)/i, // Nokia
+ /(nokia)[\s_-]?([\w-]+)*/i
+ ], [[VENDOR, 'Nokia'], MODEL, [TYPE, MOBILE]], [
+
+ /android\s3\.[\s\w;-]{10}(a\d{3})/i // Acer
+ ], [MODEL, [VENDOR, 'Acer'], [TYPE, TABLET]], [
+
+ /android.+([vl]k\-?\d{3})\s+build/i // LG Tablet
+ ], [MODEL, [VENDOR, 'LG'], [TYPE, TABLET]], [
+ /android\s3\.[\s\w;-]{10}(lg?)-([06cv9]{3,4})/i // LG Tablet
+ ], [[VENDOR, 'LG'], MODEL, [TYPE, TABLET]], [
+ /(lg) netcast\.tv/i // LG SmartTV
+ ], [VENDOR, MODEL, [TYPE, SMARTTV]], [
+ /(nexus\s[45])/i, // LG
+ /lg[e;\s\/-]+(\w+)*/i,
+ /android.+lg(\-?[\d\w]+)\s+build/i
+ ], [MODEL, [VENDOR, 'LG'], [TYPE, MOBILE]], [
+
+ /android.+(ideatab[a-z0-9\-\s]+)/i // Lenovo
+ ], [MODEL, [VENDOR, 'Lenovo'], [TYPE, TABLET]], [
+
+ /linux;.+((jolla));/i // Jolla
+ ], [VENDOR, MODEL, [TYPE, MOBILE]], [
+
+ /((pebble))app\/[\d\.]+\s/i // Pebble
+ ], [VENDOR, MODEL, [TYPE, WEARABLE]], [
+
+ /android.+;\s(oppo)\s?([\w\s]+)\sbuild/i // OPPO
+ ], [VENDOR, MODEL, [TYPE, MOBILE]], [
+
+ /crkey/i // Google Chromecast
+ ], [[MODEL, 'Chromecast'], [VENDOR, 'Google']], [
+
+ /android.+;\s(glass)\s\d/i // Google Glass
+ ], [MODEL, [VENDOR, 'Google'], [TYPE, WEARABLE]], [
+
+ /android.+;\s(pixel c)\s/i // Google Pixel C
+ ], [MODEL, [VENDOR, 'Google'], [TYPE, TABLET]], [
+
+ /android.+;\s(pixel xl|pixel)\s/i // Google Pixel
+ ], [MODEL, [VENDOR, 'Google'], [TYPE, MOBILE]], [
+
+ /android.+(\w+)\s+build\/hm\1/i, // Xiaomi Hongmi 'numeric' models
+ /android.+(hm[\s\-_]*note?[\s_]*(?:\d\w)?)\s+build/i, // Xiaomi Hongmi
+ /android.+(mi[\s\-_]*(?:one|one[\s_]plus|note lte)?[\s_]*(?:\d\w)?)\s+build/i, // Xiaomi Mi
+ /android.+(redmi[\s\-_]*(?:note)?(?:[\s_]*[\w\s]+)?)\s+build/i // Redmi Phones
+ ], [[MODEL, /_/g, ' '], [VENDOR, 'Xiaomi'], [TYPE, MOBILE]], [
+ /android.+(mi[\s\-_]*(?:pad)?(?:[\s_]*[\w\s]+)?)\s+build/i // Mi Pad tablets
+ ],[[MODEL, /_/g, ' '], [VENDOR, 'Xiaomi'], [TYPE, TABLET]], [
+ /android.+;\s(m[1-5]\snote)\sbuild/i // Meizu Tablet
+ ], [MODEL, [VENDOR, 'Meizu'], [TYPE, TABLET]], [
+
+ /android.+a000(1)\s+build/i // OnePlus
+ ], [MODEL, [VENDOR, 'OnePlus'], [TYPE, MOBILE]], [
+
+ /android.+[;\/]\s*(RCT[\d\w]+)\s+build/i // RCA Tablets
+ ], [MODEL, [VENDOR, 'RCA'], [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*(Venue[\d\s]*)\s+build/i // Dell Venue Tablets
+ ], [MODEL, [VENDOR, 'Dell'], [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*(Q[T|M][\d\w]+)\s+build/i // Verizon Tablet
+ ], [MODEL, [VENDOR, 'Verizon'], [TYPE, TABLET]], [
+
+ /android.+[;\/]\s+(Barnes[&\s]+Noble\s+|BN[RT])(V?.*)\s+build/i // Barnes & Noble Tablet
+ ], [[VENDOR, 'Barnes & Noble'], MODEL, [TYPE, TABLET]], [
+
+ /android.+[;\/]\s+(TM\d{3}.*\b)\s+build/i // Barnes & Noble Tablet
+ ], [MODEL, [VENDOR, 'NuVision'], [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*(zte)?.+(k\d{2})\s+build/i // ZTE K Series Tablet
+ ], [[VENDOR, 'ZTE'], MODEL, [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*(gen\d{3})\s+build.*49h/i // Swiss GEN Mobile
+ ], [MODEL, [VENDOR, 'Swiss'], [TYPE, MOBILE]], [
+
+ /android.+[;\/]\s*(zur\d{3})\s+build/i // Swiss ZUR Tablet
+ ], [MODEL, [VENDOR, 'Swiss'], [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*((Zeki)?TB.*\b)\s+build/i // Zeki Tablets
+ ], [MODEL, [VENDOR, 'Zeki'], [TYPE, TABLET]], [
+
+ /(android).+[;\/]\s+([YR]\d{2}x?.*)\s+build/i,
+ /android.+[;\/]\s+(Dragon[\-\s]+Touch\s+|DT)(.+)\s+build/i // Dragon Touch Tablet
+ ], [[VENDOR, 'Dragon Touch'], MODEL, [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*(NS-?.+)\s+build/i // Insignia Tablets
+ ], [MODEL, [VENDOR, 'Insignia'], [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*((NX|Next)-?.+)\s+build/i // NextBook Tablets
+ ], [MODEL, [VENDOR, 'NextBook'], [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*(Xtreme\_?)?(V(1[045]|2[015]|30|40|60|7[05]|90))\s+build/i
+ ], [[VENDOR, 'Voice'], MODEL, [TYPE, MOBILE]], [ // Voice Xtreme Phones
+
+ /android.+[;\/]\s*(LVTEL\-?)?(V1[12])\s+build/i // LvTel Phones
+ ], [[VENDOR, 'LvTel'], MODEL, [TYPE, MOBILE]], [
+
+ /android.+[;\/]\s*(V(100MD|700NA|7011|917G).*\b)\s+build/i // Envizen Tablets
+ ], [MODEL, [VENDOR, 'Envizen'], [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*(Le[\s\-]+Pan)[\s\-]+(.*\b)\s+build/i // Le Pan Tablets
+ ], [VENDOR, MODEL, [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*(Trio[\s\-]*.*)\s+build/i // MachSpeed Tablets
+ ], [MODEL, [VENDOR, 'MachSpeed'], [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*(Trinity)[\-\s]*(T\d{3})\s+build/i // Trinity Tablets
+ ], [VENDOR, MODEL, [TYPE, TABLET]], [
+
+ /android.+[;\/]\s*TU_(1491)\s+build/i // Rotor Tablets
+ ], [MODEL, [VENDOR, 'Rotor'], [TYPE, TABLET]], [
+
+ /android.+(KS(.+))\s+build/i // Amazon Kindle Tablets
+ ], [MODEL, [VENDOR, 'Amazon'], [TYPE, TABLET]], [
+
+ /android.+(Gigaset)[\s\-]+(Q.+)\s+build/i // Gigaset Tablets
+ ], [VENDOR, MODEL, [TYPE, TABLET]], [
+
+ /\s(tablet|tab)[;\/]/i, // Unidentifiable Tablet
+ /\s(mobile)(?:[;\/]|\ssafari)/i // Unidentifiable Mobile
+ ], [[TYPE, util.lowerize], VENDOR, MODEL], [
+
+ /(android.+)[;\/].+build/i // Generic Android Device
+ ], [MODEL, [VENDOR, 'Generic']]
+
+
+ /*//////////////////////////
+ // TODO: move to string map
+ ////////////////////////////
+
+ /(C6603)/i // Sony Xperia Z C6603
+ ], [[MODEL, 'Xperia Z C6603'], [VENDOR, 'Sony'], [TYPE, MOBILE]], [
+ /(C6903)/i // Sony Xperia Z 1
+ ], [[MODEL, 'Xperia Z 1'], [VENDOR, 'Sony'], [TYPE, MOBILE]], [
+
+ /(SM-G900[F|H])/i // Samsung Galaxy S5
+ ], [[MODEL, 'Galaxy S5'], [VENDOR, 'Samsung'], [TYPE, MOBILE]], [
+ /(SM-G7102)/i // Samsung Galaxy Grand 2
+ ], [[MODEL, 'Galaxy Grand 2'], [VENDOR, 'Samsung'], [TYPE, MOBILE]], [
+ /(SM-G530H)/i // Samsung Galaxy Grand Prime
+ ], [[MODEL, 'Galaxy Grand Prime'], [VENDOR, 'Samsung'], [TYPE, MOBILE]], [
+ /(SM-G313HZ)/i // Samsung Galaxy V
+ ], [[MODEL, 'Galaxy V'], [VENDOR, 'Samsung'], [TYPE, MOBILE]], [
+ /(SM-T805)/i // Samsung Galaxy Tab S 10.5
+ ], [[MODEL, 'Galaxy Tab S 10.5'], [VENDOR, 'Samsung'], [TYPE, TABLET]], [
+ /(SM-G800F)/i // Samsung Galaxy S5 Mini
+ ], [[MODEL, 'Galaxy S5 Mini'], [VENDOR, 'Samsung'], [TYPE, MOBILE]], [
+ /(SM-T311)/i // Samsung Galaxy Tab 3 8.0
+ ], [[MODEL, 'Galaxy Tab 3 8.0'], [VENDOR, 'Samsung'], [TYPE, TABLET]], [
+
+ /(T3C)/i // Advan Vandroid T3C
+ ], [MODEL, [VENDOR, 'Advan'], [TYPE, TABLET]], [
+ /(ADVAN T1J\+)/i // Advan Vandroid T1J+
+ ], [[MODEL, 'Vandroid T1J+'], [VENDOR, 'Advan'], [TYPE, TABLET]], [
+ /(ADVAN S4A)/i // Advan Vandroid S4A
+ ], [[MODEL, 'Vandroid S4A'], [VENDOR, 'Advan'], [TYPE, MOBILE]], [
+
+ /(V972M)/i // ZTE V972M
+ ], [MODEL, [VENDOR, 'ZTE'], [TYPE, MOBILE]], [
+
+ /(i-mobile)\s(IQ\s[\d\.]+)/i // i-mobile IQ
+ ], [VENDOR, MODEL, [TYPE, MOBILE]], [
+ /(IQ6.3)/i // i-mobile IQ IQ 6.3
+ ], [[MODEL, 'IQ 6.3'], [VENDOR, 'i-mobile'], [TYPE, MOBILE]], [
+ /(i-mobile)\s(i-style\s[\d\.]+)/i // i-mobile i-STYLE
+ ], [VENDOR, MODEL, [TYPE, MOBILE]], [
+ /(i-STYLE2.1)/i // i-mobile i-STYLE 2.1
+ ], [[MODEL, 'i-STYLE 2.1'], [VENDOR, 'i-mobile'], [TYPE, MOBILE]], [
+
+ /(mobiistar touch LAI 512)/i // mobiistar touch LAI 512
+ ], [[MODEL, 'Touch LAI 512'], [VENDOR, 'mobiistar'], [TYPE, MOBILE]], [
+
+ /////////////
+ // END TODO
+ ///////////*/
+
+ ],
+
+ engine : [[
+
+ /windows.+\sedge\/([\w\.]+)/i // EdgeHTML
+ ], [VERSION, [NAME, 'EdgeHTML']], [
+
+ /(presto)\/([\w\.]+)/i, // Presto
+ /(webkit|trident|netfront|netsurf|amaya|lynx|w3m)\/([\w\.]+)/i, // WebKit/Trident/NetFront/NetSurf/Amaya/Lynx/w3m
+ /(khtml|tasman|links)[\/\s]\(?([\w\.]+)/i, // KHTML/Tasman/Links
+ /(icab)[\/\s]([23]\.[\d\.]+)/i // iCab
+ ], [NAME, VERSION], [
+
+ /rv\:([\w\.]+).*(gecko)/i // Gecko
+ ], [VERSION, NAME]
+ ],
+
+ os : [[
+
+ // Windows based
+ /microsoft\s(windows)\s(vista|xp)/i // Windows (iTunes)
+ ], [NAME, VERSION], [
+ /(windows)\snt\s6\.2;\s(arm)/i, // Windows RT
+ /(windows\sphone(?:\sos)*)[\s\/]?([\d\.\s]+\w)*/i, // Windows Phone
+ /(windows\smobile|windows)[\s\/]?([ntce\d\.\s]+\w)/i
+ ], [NAME, [VERSION, mapper.str, maps.os.windows.version]], [
+ /(win(?=3|9|n)|win\s9x\s)([nt\d\.]+)/i
+ ], [[NAME, 'Windows'], [VERSION, mapper.str, maps.os.windows.version]], [
+
+ // Mobile/Embedded OS
+ /\((bb)(10);/i // BlackBerry 10
+ ], [[NAME, 'BlackBerry'], VERSION], [
+ /(blackberry)\w*\/?([\w\.]+)*/i, // Blackberry
+ /(tizen)[\/\s]([\w\.]+)/i, // Tizen
+ /(android|webos|palm\sos|qnx|bada|rim\stablet\sos|meego|contiki)[\/\s-]?([\w\.]+)*/i,
+ // Android/WebOS/Palm/QNX/Bada/RIM/MeeGo/Contiki
+ /linux;.+(sailfish);/i // Sailfish OS
+ ], [NAME, VERSION], [
+ /(symbian\s?os|symbos|s60(?=;))[\/\s-]?([\w\.]+)*/i // Symbian
+ ], [[NAME, 'Symbian'], VERSION], [
+ /\((series40);/i // Series 40
+ ], [NAME], [
+ /mozilla.+\(mobile;.+gecko.+firefox/i // Firefox OS
+ ], [[NAME, 'Firefox OS'], VERSION], [
+
+ // Console
+ /(nintendo|playstation)\s([wids34portablevu]+)/i, // Nintendo/Playstation
+
+ // GNU/Linux based
+ /(mint)[\/\s\(]?(\w+)*/i, // Mint
+ /(mageia|vectorlinux)[;\s]/i, // Mageia/VectorLinux
+ /(joli|[kxln]?ubuntu|debian|[open]*suse|gentoo|(?=\s)arch|slackware|fedora|mandriva|centos|pclinuxos|redhat|zenwalk|linpus)[\/\s-]?(?!chrom)([\w\.-]+)*/i,
+ // Joli/Ubuntu/Debian/SUSE/Gentoo/Arch/Slackware
+ // Fedora/Mandriva/CentOS/PCLinuxOS/RedHat/Zenwalk/Linpus
+ /(hurd|linux)\s?([\w\.]+)*/i, // Hurd/Linux
+ /(gnu)\s?([\w\.]+)*/i // GNU
+ ], [NAME, VERSION], [
+
+ /(cros)\s[\w]+\s([\w\.]+\w)/i // Chromium OS
+ ], [[NAME, 'Chromium OS'], VERSION],[
+
+ // Solaris
+ /(sunos)\s?([\w\.]+\d)*/i // Solaris
+ ], [[NAME, 'Solaris'], VERSION], [
+
+ // BSD based
+ /\s([frentopc-]{0,4}bsd|dragonfly)\s?([\w\.]+)*/i // FreeBSD/NetBSD/OpenBSD/PC-BSD/DragonFly
+ ], [NAME, VERSION],[
+
+ /(haiku)\s(\w+)/i // Haiku
+ ], [NAME, VERSION],[
+
+ /cfnetwork\/.+darwin/i,
+ /ip[honead]+(?:.*os\s([\w]+)\slike\smac|;\sopera)/i // iOS
+ ], [[VERSION, /_/g, '.'], [NAME, 'iOS']], [
+
+ /(mac\sos\sx)\s?([\w\s\.]+\w)*/i,
+ /(macintosh|mac(?=_powerpc)\s)/i // Mac OS
+ ], [[NAME, 'Mac OS'], [VERSION, /_/g, '.']], [
+
+ // Other
+ /((?:open)?solaris)[\/\s-]?([\w\.]+)*/i, // Solaris
+ /(aix)\s((\d)(?=\.|\)|\s)[\w\.]*)*/i, // AIX
+ /(plan\s9|minix|beos|os\/2|amigaos|morphos|risc\sos|openvms)/i,
+ // Plan9/Minix/BeOS/OS2/AmigaOS/MorphOS/RISCOS/OpenVMS
+ /(unix)\s?([\w\.]+)*/i // UNIX
+ ], [NAME, VERSION]
+ ]
+ };
+
+
+ /////////////////
+ // Constructor
+ ////////////////
+ /*
+ var Browser = function (name, version) {
+ this[NAME] = name;
+ this[VERSION] = version;
+ };
+ var CPU = function (arch) {
+ this[ARCHITECTURE] = arch;
+ };
+ var Device = function (vendor, model, type) {
+ this[VENDOR] = vendor;
+ this[MODEL] = model;
+ this[TYPE] = type;
+ };
+ var Engine = Browser;
+ var OS = Browser;
+ */
+ var UAParser = function (uastring, extensions) {
+
+ if (typeof uastring === 'object') {
+ extensions = uastring;
+ uastring = undefined;
+ }
+
+ if (!(this instanceof UAParser)) {
+ return new UAParser(uastring, extensions).getResult();
+ }
+
+ var ua = uastring || ((window && window.navigator && window.navigator.userAgent) ? window.navigator.userAgent : EMPTY);
+ var rgxmap = extensions ? util.extend(regexes, extensions) : regexes;
+ //var browser = new Browser();
+ //var cpu = new CPU();
+ //var device = new Device();
+ //var engine = new Engine();
+ //var os = new OS();
+
+ this.getBrowser = function () {
+ var browser = { name: undefined, version: undefined };
+ mapper.rgx.call(browser, ua, rgxmap.browser);
+ browser.major = util.major(browser.version); // deprecated
+ return browser;
+ };
+ this.getCPU = function () {
+ var cpu = { architecture: undefined };
+ mapper.rgx.call(cpu, ua, rgxmap.cpu);
+ return cpu;
+ };
+ this.getDevice = function () {
+ var device = { vendor: undefined, model: undefined, type: undefined };
+ mapper.rgx.call(device, ua, rgxmap.device);
+ return device;
+ };
+ this.getEngine = function () {
+ var engine = { name: undefined, version: undefined };
+ mapper.rgx.call(engine, ua, rgxmap.engine);
+ return engine;
+ };
+ this.getOS = function () {
+ var os = { name: undefined, version: undefined };
+ mapper.rgx.call(os, ua, rgxmap.os);
+ return os;
+ };
+ this.getResult = function () {
+ return {
+ ua : this.getUA(),
+ browser : this.getBrowser(),
+ engine : this.getEngine(),
+ os : this.getOS(),
+ device : this.getDevice(),
+ cpu : this.getCPU()
+ };
+ };
+ this.getUA = function () {
+ return ua;
+ };
+ this.setUA = function (uastring) {
+ ua = uastring;
+ //browser = new Browser();
+ //cpu = new CPU();
+ //device = new Device();
+ //engine = new Engine();
+ //os = new OS();
+ return this;
+ };
+ return this;
+ };
+
+ UAParser.VERSION = LIBVERSION;
+ UAParser.BROWSER = {
+ NAME : NAME,
+ MAJOR : MAJOR, // deprecated
+ VERSION : VERSION
+ };
+ UAParser.CPU = {
+ ARCHITECTURE : ARCHITECTURE
+ };
+ UAParser.DEVICE = {
+ MODEL : MODEL,
+ VENDOR : VENDOR,
+ TYPE : TYPE,
+ CONSOLE : CONSOLE,
+ MOBILE : MOBILE,
+ SMARTTV : SMARTTV,
+ TABLET : TABLET,
+ WEARABLE: WEARABLE,
+ EMBEDDED: EMBEDDED
+ };
+ UAParser.ENGINE = {
+ NAME : NAME,
+ VERSION : VERSION
+ };
+ UAParser.OS = {
+ NAME : NAME,
+ VERSION : VERSION
+ };
+ //UAParser.Utils = util;
+
+ ///////////
+ // Export
+ //////////
+
+
+ // check js environment
+ if (typeof(exports) !== UNDEF_TYPE) {
+ // nodejs env
+ if (typeof module !== UNDEF_TYPE && module.exports) {
+ exports = module.exports = UAParser;
+ }
+ // TODO: test!!!!!!!!
+ /*
+ if (require && require.main === module && process) {
+ // cli
+ var jsonize = function (arr) {
+ var res = [];
+ for (var i in arr) {
+ res.push(new UAParser(arr[i]).getResult());
+ }
+ process.stdout.write(JSON.stringify(res, null, 2) + '\n');
+ };
+ if (process.stdin.isTTY) {
+ // via args
+ jsonize(process.argv.slice(2));
+ } else {
+ // via pipe
+ var str = '';
+ process.stdin.on('readable', function() {
+ var read = process.stdin.read();
+ if (read !== null) {
+ str += read;
+ }
+ });
+ process.stdin.on('end', function () {
+ jsonize(str.replace(/\n$/, '').split('\n'));
+ });
+ }
+ }
+ */
+ exports.UAParser = UAParser;
+ } else {
+ // requirejs env (optional)
+ if (typeof(define) === FUNC_TYPE && define.amd) {
+ define(function () {
+ return UAParser;
+ });
+ } else if (window) {
+ // browser env
+ window.UAParser = UAParser;
+ }
+ }
+
+ // jQuery/Zepto specific (optional)
+ // Note:
+ // In AMD env the global scope should be kept clean, but jQuery is an exception.
+ // jQuery always exports to global scope, unless jQuery.noConflict(true) is used,
+ // and we should catch that.
+ var $ = window && (window.jQuery || window.Zepto);
+ if (typeof $ !== UNDEF_TYPE) {
+ var parser = new UAParser();
+ $.ua = parser.getResult();
+ $.ua.get = function () {
+ return parser.getUA();
+ };
+ $.ua.set = function (uastring) {
+ parser.setUA(uastring);
+ var result = parser.getResult();
+ for (var prop in result) {
+ $.ua[prop] = result[prop];
+ }
+ };
+ }
+
+})(typeof window === 'object' ? window : this);
+
+},{}],22:[function(require,module,exports){
+(function (global){
+
+var rng;
+
+var crypto = global.crypto || global.msCrypto; // for IE 11
+if (crypto && crypto.getRandomValues) {
+ // WHATWG crypto-based RNG - http://wiki.whatwg.org/wiki/Crypto
+ // Moderately fast, high quality
+ var _rnds8 = new Uint8Array(16);
+ rng = function whatwgRNG() {
+ crypto.getRandomValues(_rnds8);
+ return _rnds8;
+ };
+}
+
+if (!rng) {
+ // Math.random()-based (RNG)
+ //
+ // If all else fails, use Math.random(). It's fast, but is of unspecified
+ // quality.
+ var _rnds = new Array(16);
+ rng = function() {
+ for (var i = 0, r; i < 16; i++) {
+ if ((i & 0x03) === 0) r = Math.random() * 0x100000000;
+ _rnds[i] = r >>> ((i & 0x03) << 3) & 0xff;
+ }
+
+ return _rnds;
+ };
+}
+
+module.exports = rng;
+
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{}],23:[function(require,module,exports){
+// uuid.js
+//
+// Copyright (c) 2010-2012 Robert Kieffer
+// MIT License - http://opensource.org/licenses/mit-license.php
+
+// Unique ID creation requires a high quality random # generator. We feature
+// detect to determine the best RNG source, normalizing to a function that
+// returns 128-bits of randomness, since that's what's usually required
+var _rng = require('./rng');
+
+// Maps for number <-> hex string conversion
+var _byteToHex = [];
+var _hexToByte = {};
+for (var i = 0; i < 256; i++) {
+ _byteToHex[i] = (i + 0x100).toString(16).substr(1);
+ _hexToByte[_byteToHex[i]] = i;
+}
+
+// **`parse()` - Parse a UUID into it's component bytes**
+function parse(s, buf, offset) {
+ var i = (buf && offset) || 0, ii = 0;
+
+ buf = buf || [];
+ s.toLowerCase().replace(/[0-9a-f]{2}/g, function(oct) {
+ if (ii < 16) { // Don't overflow!
+ buf[i + ii++] = _hexToByte[oct];
+ }
+ });
+
+ // Zero out remaining bytes if string was short
+ while (ii < 16) {
+ buf[i + ii++] = 0;
+ }
+
+ return buf;
+}
+
+// **`unparse()` - Convert UUID byte array (ala parse()) into a string**
+function unparse(buf, offset) {
+ var i = offset || 0, bth = _byteToHex;
+ return bth[buf[i++]] + bth[buf[i++]] +
+ bth[buf[i++]] + bth[buf[i++]] + '-' +
+ bth[buf[i++]] + bth[buf[i++]] + '-' +
+ bth[buf[i++]] + bth[buf[i++]] + '-' +
+ bth[buf[i++]] + bth[buf[i++]] + '-' +
+ bth[buf[i++]] + bth[buf[i++]] +
+ bth[buf[i++]] + bth[buf[i++]] +
+ bth[buf[i++]] + bth[buf[i++]];
+}
+
+// **`v1()` - Generate time-based UUID**
+//
+// Inspired by https://github.com/LiosK/UUID.js
+// and http://docs.python.org/library/uuid.html
+
+// random #'s we need to init node and clockseq
+var _seedBytes = _rng();
+
+// Per 4.5, create and 48-bit node id, (47 random bits + multicast bit = 1)
+var _nodeId = [
+ _seedBytes[0] | 0x01,
+ _seedBytes[1], _seedBytes[2], _seedBytes[3], _seedBytes[4], _seedBytes[5]
+];
+
+// Per 4.2.2, randomize (14 bit) clockseq
+var _clockseq = (_seedBytes[6] << 8 | _seedBytes[7]) & 0x3fff;
+
+// Previous uuid creation time
+var _lastMSecs = 0, _lastNSecs = 0;
+
+// See https://github.com/broofa/node-uuid for API details
+function v1(options, buf, offset) {
+ var i = buf && offset || 0;
+ var b = buf || [];
+
+ options = options || {};
+
+ var clockseq = options.clockseq !== undefined ? options.clockseq : _clockseq;
+
+ // UUID timestamps are 100 nano-second units since the Gregorian epoch,
+ // (1582-10-15 00:00). JSNumbers aren't precise enough for this, so
+ // time is handled internally as 'msecs' (integer milliseconds) and 'nsecs'
+ // (100-nanoseconds offset from msecs) since unix epoch, 1970-01-01 00:00.
+ var msecs = options.msecs !== undefined ? options.msecs : new Date().getTime();
+
+ // Per 4.2.1.2, use count of uuid's generated during the current clock
+ // cycle to simulate higher resolution clock
+ var nsecs = options.nsecs !== undefined ? options.nsecs : _lastNSecs + 1;
+
+ // Time since last uuid creation (in msecs)
+ var dt = (msecs - _lastMSecs) + (nsecs - _lastNSecs)/10000;
+
+ // Per 4.2.1.2, Bump clockseq on clock regression
+ if (dt < 0 && options.clockseq === undefined) {
+ clockseq = clockseq + 1 & 0x3fff;
+ }
+
+ // Reset nsecs if clock regresses (new clockseq) or we've moved onto a new
+ // time interval
+ if ((dt < 0 || msecs > _lastMSecs) && options.nsecs === undefined) {
+ nsecs = 0;
+ }
+
+ // Per 4.2.1.2 Throw error if too many uuids are requested
+ if (nsecs >= 10000) {
+ throw new Error('uuid.v1(): Can\'t create more than 10M uuids/sec');
+ }
+
+ _lastMSecs = msecs;
+ _lastNSecs = nsecs;
+ _clockseq = clockseq;
+
+ // Per 4.1.4 - Convert from unix epoch to Gregorian epoch
+ msecs += 12219292800000;
+
+ // `time_low`
+ var tl = ((msecs & 0xfffffff) * 10000 + nsecs) % 0x100000000;
+ b[i++] = tl >>> 24 & 0xff;
+ b[i++] = tl >>> 16 & 0xff;
+ b[i++] = tl >>> 8 & 0xff;
+ b[i++] = tl & 0xff;
+
+ // `time_mid`
+ var tmh = (msecs / 0x100000000 * 10000) & 0xfffffff;
+ b[i++] = tmh >>> 8 & 0xff;
+ b[i++] = tmh & 0xff;
+
+ // `time_high_and_version`
+ b[i++] = tmh >>> 24 & 0xf | 0x10; // include version
+ b[i++] = tmh >>> 16 & 0xff;
+
+ // `clock_seq_hi_and_reserved` (Per 4.2.2 - include variant)
+ b[i++] = clockseq >>> 8 | 0x80;
+
+ // `clock_seq_low`
+ b[i++] = clockseq & 0xff;
+
+ // `node`
+ var node = options.node || _nodeId;
+ for (var n = 0; n < 6; n++) {
+ b[i + n] = node[n];
+ }
+
+ return buf ? buf : unparse(b);
+}
+
+// **`v4()` - Generate random UUID**
+
+// See https://github.com/broofa/node-uuid for API details
+function v4(options, buf, offset) {
+ // Deprecated - 'format' argument, as supported in v1.2
+ var i = buf && offset || 0;
+
+ if (typeof(options) == 'string') {
+ buf = options == 'binary' ? new Array(16) : null;
+ options = null;
+ }
+ options = options || {};
+
+ var rnds = options.random || (options.rng || _rng)();
+
+ // Per 4.4, set bits for version and `clock_seq_hi_and_reserved`
+ rnds[6] = (rnds[6] & 0x0f) | 0x40;
+ rnds[8] = (rnds[8] & 0x3f) | 0x80;
+
+ // Copy bytes to buffer, if provided
+ if (buf) {
+ for (var ii = 0; ii < 16; ii++) {
+ buf[i + ii] = rnds[ii];
+ }
+ }
+
+ return buf || unparse(rnds);
+}
+
+// Export public API
+var uuid = v4;
+uuid.v1 = v1;
+uuid.v4 = v4;
+uuid.parse = parse;
+uuid.unparse = unparse;
+
+module.exports = uuid;
+
+},{"./rng":22}],24:[function(require,module,exports){
+/*
+WildEmitter.js is a slim little event emitter by @henrikjoreteg largely based
+on @visionmedia's Emitter from UI Kit.
+
+Why? I wanted it standalone.
+
+I also wanted support for wildcard emitters like this:
+
+emitter.on('*', function (eventName, other, event, payloads) {
+
+});
+
+emitter.on('somenamespace*', function (eventName, payloads) {
+
+});
+
+Please note that callbacks triggered by wildcard registered events also get
+the event name as the first argument.
+*/
+
+module.exports = WildEmitter;
+
+function WildEmitter() { }
+
+WildEmitter.mixin = function (constructor) {
+ var prototype = constructor.prototype || constructor;
+
+ prototype.isWildEmitter= true;
+
+ // Listen on the given `event` with `fn`. Store a group name if present.
+ prototype.on = function (event, groupName, fn) {
+ this.callbacks = this.callbacks || {};
+ var hasGroup = (arguments.length === 3),
+ group = hasGroup ? arguments[1] : undefined,
+ func = hasGroup ? arguments[2] : arguments[1];
+ func._groupName = group;
+ (this.callbacks[event] = this.callbacks[event] || []).push(func);
+ return this;
+ };
+
+ // Adds an `event` listener that will be invoked a single
+ // time then automatically removed.
+ prototype.once = function (event, groupName, fn) {
+ var self = this,
+ hasGroup = (arguments.length === 3),
+ group = hasGroup ? arguments[1] : undefined,
+ func = hasGroup ? arguments[2] : arguments[1];
+ function on() {
+ self.off(event, on);
+ func.apply(this, arguments);
+ }
+ this.on(event, group, on);
+ return this;
+ };
+
+ // Unbinds an entire group
+ prototype.releaseGroup = function (groupName) {
+ this.callbacks = this.callbacks || {};
+ var item, i, len, handlers;
+ for (item in this.callbacks) {
+ handlers = this.callbacks[item];
+ for (i = 0, len = handlers.length; i < len; i++) {
+ if (handlers[i]._groupName === groupName) {
+ //console.log('removing');
+ // remove it and shorten the array we're looping through
+ handlers.splice(i, 1);
+ i--;
+ len--;
+ }
+ }
+ }
+ return this;
+ };
+
+ // Remove the given callback for `event` or all
+ // registered callbacks.
+ prototype.off = function (event, fn) {
+ this.callbacks = this.callbacks || {};
+ var callbacks = this.callbacks[event],
+ i;
+
+ if (!callbacks) return this;
+
+ // remove all handlers
+ if (arguments.length === 1) {
+ delete this.callbacks[event];
+ return this;
+ }
+
+ // remove specific handler
+ i = callbacks.indexOf(fn);
+ callbacks.splice(i, 1);
+ if (callbacks.length === 0) {
+ delete this.callbacks[event];
+ }
+ return this;
+ };
+
+ /// Emit `event` with the given args.
+ // also calls any `*` handlers
+ prototype.emit = function (event) {
+ this.callbacks = this.callbacks || {};
+ var args = [].slice.call(arguments, 1),
+ callbacks = this.callbacks[event],
+ specialCallbacks = this.getWildcardCallbacks(event),
+ i,
+ len,
+ item,
+ listeners;
+
+ if (callbacks) {
+ listeners = callbacks.slice();
+ for (i = 0, len = listeners.length; i < len; ++i) {
+ if (!listeners[i]) {
+ break;
+ }
+ listeners[i].apply(this, args);
+ }
+ }
+
+ if (specialCallbacks) {
+ len = specialCallbacks.length;
+ listeners = specialCallbacks.slice();
+ for (i = 0, len = listeners.length; i < len; ++i) {
+ if (!listeners[i]) {
+ break;
+ }
+ listeners[i].apply(this, [event].concat(args));
+ }
+ }
+
+ return this;
+ };
+
+ // Helper for for finding special wildcard event handlers that match the event
+ prototype.getWildcardCallbacks = function (eventName) {
+ this.callbacks = this.callbacks || {};
+ var item,
+ split,
+ result = [];
+
+ for (item in this.callbacks) {
+ split = item.split('*');
+ if (item === '*' || (split.length === 2 && eventName.slice(0, split[0].length) === split[0])) {
+ result = result.concat(this.callbacks[item]);
+ }
+ }
+ return result;
+ };
+
+};
+
+WildEmitter.mixin(WildEmitter);
+
+},{}]},{},[2])(2)
+});
\ No newline at end of file
diff --git a/bigbluebutton-client/resources/prod/lib/kurento-utils.min.js b/bigbluebutton-client/resources/prod/lib/kurento-utils.min.js
deleted file mode 100644
index 4e88a14cb52432fe068dd62adf6ec94350103ae2..0000000000000000000000000000000000000000
--- a/bigbluebutton-client/resources/prod/lib/kurento-utils.min.js
+++ /dev/null
@@ -1,56 +0,0 @@
-(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.kurentoUtils = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(require,module,exports){
-function noop(e){e&&logger.error(e)}function trackStop(e){e.stop&&e.stop()}function streamStop(e){e.getTracks().forEach(trackStop)}function bufferizeCandidates(e,n){var t=[];return e.addEventListener("signalingstatechange",function(){if("stable"===this.signalingState)for(;t.length;){var e=t.shift();this.addIceCandidate(e.candidate,e.callback,e.callback)}}),function(r,i){switch(i=i||n,e.signalingState){case"closed":i(new Error("PeerConnection object is closed"));break;case"stable":if(e.remoteDescription){e.addIceCandidate(r,i,i);break}default:t.push({candidate:r,callback:i})}}}function removeFIDFromOffer(e){var n=e.indexOf("a=ssrc-group:FID");return n>0?e.slice(0,n):e}function getSimulcastInfo(e){var n=e.getVideoTracks();if(!n.length)return logger.warn("No video tracks available in the video stream"),"";var t=["a=x-google-flag:conference","a=ssrc-group:SIM 1 2 3","a=ssrc:1 cname:localVideo","a=ssrc:1 msid:"+e.id+" "+n[0].id,"a=ssrc:1 mslabel:"+e.id,"a=ssrc:1 label:"+n[0].id,"a=ssrc:2 cname:localVideo","a=ssrc:2 msid:"+e.id+" "+n[0].id,"a=ssrc:2 mslabel:"+e.id,"a=ssrc:2 label:"+n[0].id,"a=ssrc:3 cname:localVideo","a=ssrc:3 msid:"+e.id+" "+n[0].id,"a=ssrc:3 mslabel:"+e.id,"a=ssrc:3 label:"+n[0].id];return t.push(""),t.join("\n")}function WebRtcPeer(e,n,t){function r(){if(l){var e=p.getRemoteStreams()[0],n=e?URL.createObjectURL(e):"";l.pause(),l.src=n,l.load(),logger.info("Remote URL:",n)}}function i(e){return w&&("Chrome"===browser.name||"Chromium"===browser.name?(logger.info("Adding multicast info"),e=new RTCSessionDescription({type:e.type,sdp:removeFIDFromOffer(e.sdp)+getSimulcastInfo(u)})):logger.warn("Simulcast is only available in Chrome browser.")),e}function o(){"closed"===p.signalingState&&t('The peer connection object is in "closed" state. This is most likely due to an invocation of the dispose method before accepting in the dialogue'),u&&d&&c.showLocalVideo(),u&&p.addStream(u),f&&p.addStream(f);var n=parser.getBrowser();"sendonly"!==e||"Chrome"!==n.name&&"Chromium"!==n.name||39!==n.major||(e="sendrecv"),t()}function a(e){void 0===e&&(e=MEDIA_CONSTRAINTS),navigator.mediaDevices.getUserMedia(e).then(function(e){u=e,o()}).catch(t)}if(!(this instanceof WebRtcPeer))return new WebRtcPeer(e,n,t);WebRtcPeer.super_.call(this),n instanceof Function&&(t=n,n=void 0),n=n||{},t=(t||noop).bind(this);var s,c=this,d=n.localVideo,l=n.remoteVideo,u=n.videoStream,f=n.audioStream,g=n.mediaConstraints,p=(n.connectionConstraints,n.peerConnection),h=n.sendSource||"webcam",m=n.dataChannelConfig,v=n.dataChannels||!1,b=uuid.v4(),P=recursive({iceServers:freeice()},n.configuration),S=n.onicecandidate;S&&this.on("icecandidate",S);var R=n.oncandidategatheringdone;R&&this.on("candidategatheringdone",R);var w=n.simulcast,C=n.multistream,y=new sdpTranslator.Interop,D=[],W=!1;if(Object.defineProperties(this,{peerConnection:{get:function(){return p}},id:{value:n.id||b,writable:!1},remoteVideo:{get:function(){return l}},localVideo:{get:function(){return d}},dataChannel:{get:function(){return s}},currentFrame:{get:function(){if(l){if(l.readyState<l.HAVE_CURRENT_DATA)throw new Error("No video stream data available");var e=document.createElement("canvas");return e.width=l.videoWidth,e.height=l.videoHeight,e.getContext("2d").drawImage(l,0,0),e}}}}),!p&&(p=new RTCPeerConnection(P),v&&!s)){var E="WebRtcPeer-"+c.id,T=void 0;m&&(E=m.id||E,T=m.options),s=p.createDataChannel(E,T),m&&(s.onopen=m.onopen,s.onclose=m.onclose,s.onmessage=m.onmessage,s.onbufferedamountlow=m.onbufferedamountlow,s.onerror=m.onerror||noop)}p.addEventListener("icecandidate",function(e){var n=e.candidate;if(EventEmitter.listenerCount(c,"icecandidate")||EventEmitter.listenerCount(c,"candidategatheringdone"))if(n){var t;t=C&&usePlanB?y.candidateToUnifiedPlan(n):n,c.emit("icecandidate",t),W=!1}else W||(c.emit("candidategatheringdone"),W=!0);else W||(D.push(n),n||(W=!0))}),p.ontrack=n.onaddstream,p.onnegotiationneeded=n.onnegotiationneeded,this.on("newListener",function(e,n){if("icecandidate"===e||"candidategatheringdone"===e)for(;D.length;){var t=D.shift();!t==("candidategatheringdone"===e)&&n(t)}});var k=bufferizeCandidates(p);this.addIceCandidate=function(e,n){var t;t=C&&usePlanB?y.candidateToPlanB(e):new RTCIceCandidate(e),logger.debug("Remote ICE candidate received",e),n=(n||noop).bind(this),k(t,n)},this.generateOffer=function(n){n=n.bind(this);var t=!0,r=!0;g&&(t="boolean"!=typeof g.audio||g.audio,r="boolean"!=typeof g.video||g.video);var o={offerToReceiveAudio:"sendonly"!==e&&t,offerToReceiveVideo:"sendonly"!==e&&r},a=o;logger.info("constraints: "+JSON.stringify(a)),p.createOffer(a).then(function(e){return logger.info("Created SDP offer"),e=i(e),p.setLocalDescription(e)}).then(function(){var e=p.localDescription;logger.info("Local description set",e.sdp),C&&usePlanB&&(e=y.toUnifiedPlan(e),logger.info("offer::origPlanB->UnifiedPlan",dumpSDP(e))),n(null,e.sdp,c.processAnswer.bind(c))}).catch(n)},this.getLocalSessionDescriptor=function(){return p.localDescription},this.getRemoteSessionDescriptor=function(){return p.remoteDescription},this.showLocalVideo=function(){d.src=URL.createObjectURL(u),d.muted=!0},this.send=function(e){s&&"open"===s.readyState?s.send(e):logger.warn("Trying to send data over a non-existing or closed data channel")},this.processAnswer=function(e,n){n=(n||noop).bind(this);var t=new RTCSessionDescription({type:"answer",sdp:e});if(C&&usePlanB){var i=y.toPlanB(t);logger.info("asnwer::planB",dumpSDP(i)),t=i}if(logger.info("SDP answer received, setting remote description"),"closed"===p.signalingState)return n("PeerConnection is closed");p.setRemoteDescription(t,function(){r(),n()},n)},this.processOffer=function(e,n){n=n.bind(this);var t=new RTCSessionDescription({type:"offer",sdp:e});if(C&&usePlanB){var o=y.toPlanB(t);logger.info("offer::planB",dumpSDP(o)),t=o}if(logger.info("SDP offer received, setting remote description"),"closed"===p.signalingState)return n("PeerConnection is closed");p.setRemoteDescription(t).then(function(){return r()}).then(function(){return p.createAnswer()}).then(function(e){return e=i(e),logger.info("Created SDP answer"),p.setLocalDescription(e)}).then(function(){var e=p.localDescription;C&&usePlanB&&(e=y.toUnifiedPlan(e),logger.info("answer::origPlanB->UnifiedPlan",dumpSDP(e))),logger.info("Local description set",e.sdp),n(null,e.sdp)}).catch(n)},"recvonly"===e||u||f?setTimeout(o,0):"webcam"===h?a(g):getScreenConstraints(h,function(e,n){if(e)return t(e);constraints=[g],constraints.unshift(n),a(recursive.apply(void 0,constraints))},b),this.on("_dispose",function(){d&&(d.pause(),d.src="",d.load(),d.muted=!1),l&&(l.pause(),l.src="",l.load()),c.removeAllListeners(),void 0!==window.cancelChooseDesktopMedia&&window.cancelChooseDesktopMedia(b)})}function createEnableDescriptor(e){var n="get"+e+"Tracks";return{enumerable:!0,get:function(){if(this.peerConnection){var e=this.peerConnection.getLocalStreams();if(e.length){for(var t,r=0;t=e[r];r++)for(var i,o=t[n](),a=0;i=o[a];a++)if(!i.enabled)return!1;return!0}}},set:function(e){function t(n){n.enabled=e}this.peerConnection.getLocalStreams().forEach(function(e){e[n]().forEach(t)})}}}function WebRtcPeerRecvonly(e,n){if(!(this instanceof WebRtcPeerRecvonly))return new WebRtcPeerRecvonly(e,n);WebRtcPeerRecvonly.super_.call(this,"recvonly",e,n)}function WebRtcPeerSendonly(e,n){if(!(this instanceof WebRtcPeerSendonly))return new WebRtcPeerSendonly(e,n);WebRtcPeerSendonly.super_.call(this,"sendonly",e,n)}function WebRtcPeerSendrecv(e,n){if(!(this instanceof WebRtcPeerSendrecv))return new WebRtcPeerSendrecv(e,n);WebRtcPeerSendrecv.super_.call(this,"sendrecv",e,n)}function harkUtils(e,n){return hark(e,n)}var freeice=require("freeice"),inherits=require("inherits"),UAParser=require("ua-parser-js"),uuid=require("uuid"),hark=require("hark"),EventEmitter=require("events").EventEmitter,recursive=require("merge").recursive.bind(void 0,!0),sdpTranslator=require("sdp-translator"),logger=window.Logger||console;try{require("kurento-browser-extensions")}catch(e){"undefined"==typeof getScreenConstraints&&(logger.warn("screen sharing is not available"),getScreenConstraints=function(e,n){n(new Error("This library is not enabled for screen sharing"))})}var MEDIA_CONSTRAINTS={audio:!0,video:{width:640,framerate:15}},ua=window&&window.navigator?window.navigator.userAgent:"",parser=new UAParser(ua),browser=parser.getBrowser(),usePlanB=!1;"Chrome"!==browser.name&&"Chromium"!==browser.name||(logger.info(browser.name+": using SDP PlanB"),usePlanB=!0);var dumpSDP=function(e){return void 0===e||null===e?"":"type: "+e.type+"\r\n"+e.sdp};inherits(WebRtcPeer,EventEmitter),Object.defineProperties(WebRtcPeer.prototype,{enabled:{enumerable:!0,get:function(){return this.audioEnabled&&this.videoEnabled},set:function(e){this.audioEnabled=this.videoEnabled=e}},audioEnabled:createEnableDescriptor("Audio"),videoEnabled:createEnableDescriptor("Video")}),WebRtcPeer.prototype.getLocalStream=function(e){if(this.peerConnection)return this.peerConnection.getLocalStreams()[e||0]},WebRtcPeer.prototype.getRemoteStream=function(e){if(this.peerConnection)return this.peerConnection.getRemoteStreams()[e||0]},WebRtcPeer.prototype.dispose=function(){logger.info("Disposing WebRtcPeer");var e=this.peerConnection,n=this.dataChannel;try{if(n){if("closed"===n.signalingState)return;n.close()}if(e){if("closed"===e.signalingState)return;e.getLocalStreams().forEach(streamStop),e.close()}}catch(e){logger.warn("Exception disposing webrtc peer "+e)}this.emit("_dispose")},inherits(WebRtcPeerRecvonly,WebRtcPeer),inherits(WebRtcPeerSendonly,WebRtcPeer),inherits(WebRtcPeerSendrecv,WebRtcPeer),exports.bufferizeCandidates=bufferizeCandidates,exports.WebRtcPeerRecvonly=WebRtcPeerRecvonly,exports.WebRtcPeerSendonly=WebRtcPeerSendonly,exports.WebRtcPeerSendrecv=WebRtcPeerSendrecv,exports.hark=harkUtils;
-},{"events":4,"freeice":5,"hark":8,"inherits":9,"kurento-browser-extensions":10,"merge":11,"sdp-translator":18,"ua-parser-js":21,"uuid":23}],2:[function(require,module,exports){
-window.addEventListener&&(module.exports=require("./index"));
-},{"./index":3}],3:[function(require,module,exports){
-var WebRtcPeer=require("./WebRtcPeer");exports.WebRtcPeer=WebRtcPeer;
-},{"./WebRtcPeer":1}],4:[function(require,module,exports){
-function EventEmitter(){this._events=this._events||{},this._maxListeners=this._maxListeners||void 0}function isFunction(e){return"function"==typeof e}function isNumber(e){return"number"==typeof e}function isObject(e){return"object"==typeof e&&null!==e}function isUndefined(e){return void 0===e}module.exports=EventEmitter,EventEmitter.EventEmitter=EventEmitter,EventEmitter.prototype._events=void 0,EventEmitter.prototype._maxListeners=void 0,EventEmitter.defaultMaxListeners=10,EventEmitter.prototype.setMaxListeners=function(e){if(!isNumber(e)||e<0||isNaN(e))throw TypeError("n must be a positive number");return this._maxListeners=e,this},EventEmitter.prototype.emit=function(e){var t,i,n,s,r,o;if(this._events||(this._events={}),"error"===e&&(!this._events.error||isObject(this._events.error)&&!this._events.error.length)){if((t=arguments[1])instanceof Error)throw t;var h=new Error('Uncaught, unspecified "error" event. ('+t+")");throw h.context=t,h}if(i=this._events[e],isUndefined(i))return!1;if(isFunction(i))switch(arguments.length){case 1:i.call(this);break;case 2:i.call(this,arguments[1]);break;case 3:i.call(this,arguments[1],arguments[2]);break;default:s=Array.prototype.slice.call(arguments,1),i.apply(this,s)}else if(isObject(i))for(s=Array.prototype.slice.call(arguments,1),o=i.slice(),n=o.length,r=0;r<n;r++)o[r].apply(this,s);return!0},EventEmitter.prototype.addListener=function(e,t){var i;if(!isFunction(t))throw TypeError("listener must be a function");return this._events||(this._events={}),this._events.newListener&&this.emit("newListener",e,isFunction(t.listener)?t.listener:t),this._events[e]?isObject(this._events[e])?this._events[e].push(t):this._events[e]=[this._events[e],t]:this._events[e]=t,isObject(this._events[e])&&!this._events[e].warned&&(i=isUndefined(this._maxListeners)?EventEmitter.defaultMaxListeners:this._maxListeners)&&i>0&&this._events[e].length>i&&(this._events[e].warned=!0,console.error("(node) warning: possible EventEmitter memory leak detected. %d listeners added. Use emitter.setMaxListeners() to increase limit.",this._events[e].length),"function"==typeof console.trace&&console.trace()),this},EventEmitter.prototype.on=EventEmitter.prototype.addListener,EventEmitter.prototype.once=function(e,t){function i(){this.removeListener(e,i),n||(n=!0,t.apply(this,arguments))}if(!isFunction(t))throw TypeError("listener must be a function");var n=!1;return i.listener=t,this.on(e,i),this},EventEmitter.prototype.removeListener=function(e,t){var i,n,s,r;if(!isFunction(t))throw TypeError("listener must be a function");if(!this._events||!this._events[e])return this;if(i=this._events[e],s=i.length,n=-1,i===t||isFunction(i.listener)&&i.listener===t)delete this._events[e],this._events.removeListener&&this.emit("removeListener",e,t);else if(isObject(i)){for(r=s;r-- >0;)if(i[r]===t||i[r].listener&&i[r].listener===t){n=r;break}if(n<0)return this;1===i.length?(i.length=0,delete this._events[e]):i.splice(n,1),this._events.removeListener&&this.emit("removeListener",e,t)}return this},EventEmitter.prototype.removeAllListeners=function(e){var t,i;if(!this._events)return this;if(!this._events.removeListener)return 0===arguments.length?this._events={}:this._events[e]&&delete this._events[e],this;if(0===arguments.length){for(t in this._events)"removeListener"!==t&&this.removeAllListeners(t);return this.removeAllListeners("removeListener"),this._events={},this}if(i=this._events[e],isFunction(i))this.removeListener(e,i);else if(i)for(;i.length;)this.removeListener(e,i[i.length-1]);return delete this._events[e],this},EventEmitter.prototype.listeners=function(e){return this._events&&this._events[e]?isFunction(this._events[e])?[this._events[e]]:this._events[e].slice():[]},EventEmitter.prototype.listenerCount=function(e){if(this._events){var t=this._events[e];if(isFunction(t))return 1;if(t)return t.length}return 0},EventEmitter.listenerCount=function(e,t){return e.listenerCount(t)};
-},{}],5:[function(require,module,exports){
-"use strict";var normalice=require("normalice"),freeice=module.exports=function(n){function t(n,t){for(var r,u=[],o=[].concat(e[n]);o.length&&u.length<t;)r=Math.random()*o.length|0,u=u.concat(o.splice(r,1));return u.map(function(t){return"string"==typeof t||t instanceof String?normalice(n+":"+t):t})}var r,e={stun:(n||{}).stun||require("./stun.json"),turn:(n||{}).turn||require("./turn.json")},u=(n||{}).stunCount||2,o=(n||{}).turnCount||0;return r=[].concat(t("stun",u)),o&&(r=r.concat(t("turn",o))),r};
-},{"./stun.json":6,"./turn.json":7,"normalice":12}],6:[function(require,module,exports){
-module.exports=["stun.l.google.com:19302","stun1.l.google.com:19302","stun2.l.google.com:19302","stun3.l.google.com:19302","stun4.l.google.com:19302","stun.ekiga.net","stun.ideasip.com","stun.schlund.de","stun.stunprotocol.org:3478","stun.voiparound.com","stun.voipbuster.com","stun.voipstunt.com","stun.voxgratia.org","stun.services.mozilla.com"]
-},{}],7:[function(require,module,exports){
-module.exports=[]
-},{}],8:[function(require,module,exports){
-function getMaxVolume(e,t){var i=-1/0;e.getFloatFrequencyData(t);for(var n=4,o=t.length;n<o;n++)t[n]>i&&t[n]<0&&(i=t[n]);return i}var WildEmitter=require("wildemitter"),audioContextType=window.AudioContext||window.webkitAudioContext,audioContext=null;module.exports=function(e,t){var i=new WildEmitter;if(!audioContextType)return i;var t=t||{},n=t.smoothing||.1,o=t.interval||50,a=t.threshold,r=t.play,s=t.history||10,u=!0;audioContext||(audioContext=new audioContextType);var p,g,d;d=audioContext.createAnalyser(),d.fftSize=512,d.smoothingTimeConstant=n,g=new Float32Array(d.fftSize),e.jquery&&(e=e[0]),e instanceof HTMLAudioElement||e instanceof HTMLVideoElement?(p=audioContext.createMediaElementSource(e),void 0===r&&(r=!0),a=a||-50):(p=audioContext.createMediaStreamSource(e),a=a||-50),p.connect(d),r&&d.connect(audioContext.destination),i.speaking=!1,i.setThreshold=function(e){a=e},i.setInterval=function(e){o=e},i.stop=function(){u=!1,i.emit("volume_change",-100,a),i.speaking&&(i.speaking=!1,i.emit("stopped_speaking"))},i.speakingHistory=[];for(var l=0;l<s;l++)i.speakingHistory.push(0);var f=function(){setTimeout(function(){if(u){var e=getMaxVolume(d,g);i.emit("volume_change",e,a);var t=0;if(e>a&&!i.speaking){for(var n=i.speakingHistory.length-3;n<i.speakingHistory.length;n++)t+=i.speakingHistory[n];t>=2&&(i.speaking=!0,i.emit("speaking"))}else if(e<a&&i.speaking){for(var n=0;n<i.speakingHistory.length;n++)t+=i.speakingHistory[n];0==t&&(i.speaking=!1,i.emit("stopped_speaking"))}i.speakingHistory.shift(),i.speakingHistory.push(0+(e>a)),f()}},o)};return f(),i};
-},{"wildemitter":24}],9:[function(require,module,exports){
-"function"==typeof Object.create?module.exports=function(t,e){t.super_=e,t.prototype=Object.create(e.prototype,{constructor:{value:t,enumerable:!1,writable:!0,configurable:!0}})}:module.exports=function(t,e){t.super_=e;var o=function(){};o.prototype=e.prototype,t.prototype=new o,t.prototype.constructor=t};
-},{}],10:[function(require,module,exports){
-
-},{}],11:[function(require,module,exports){
-!function(e){function o(e,r){if("object"!==n(e))return r;for(var t in r)"object"===n(e[t])&&"object"===n(r[t])?e[t]=o(e[t],r[t]):e[t]=r[t];return e}function r(e,r,c){var u=c[0],f=c.length;(e||"object"!==n(u))&&(u={});for(var i=0;i<f;++i){var l=c[i];if("object"===n(l))for(var a in l){var v=e?t.clone(l[a]):l[a];u[a]=r?o(u[a],v):v}}return u}function n(e){return{}.toString.call(e).slice(8,-1).toLowerCase()}var t=function(e){return r(!0===e,!1,arguments)};t.recursive=function(e){return r(!0===e,!0,arguments)},t.clone=function(e){var o,r,c=e,u=n(e);if("array"===u)for(c=[],r=e.length,o=0;o<r;++o)c[o]=t.clone(e[o]);else if("object"===u){c={};for(o in e)c[o]=t.clone(e[o])}return c},e?module.exports=t:window.merge=t}("object"==typeof module&&module&&"object"==typeof module.exports&&module.exports);
-},{}],12:[function(require,module,exports){
-var protocols=["stun:","turn:"];module.exports=function(e){var r,t,n=(e||{}).url||e,l={};return"string"==typeof n||n instanceof String?(n=n.trim(),(r=protocols[protocols.indexOf(n.slice(0,5))])?(n=n.slice(5),t=n.split("@"),l.username=e.username,l.credential=e.credential,t.length>1&&(n=t[1],t=t[0].split(":"),l.username=t[0],l.credential=(e||{}).credential||t[1]||""),l.url=r+n,l.urls=[l.url],l):e):e};
-},{}],13:[function(require,module,exports){
-var grammar=module.exports={v:[{name:"version",reg:/^(\d*)$/}],o:[{name:"origin",reg:/^(\S*) (\d*) (\d*) (\S*) IP(\d) (\S*)/,names:["username","sessionId","sessionVersion","netType","ipVer","address"],format:"%s %s %d %s IP%d %s"}],s:[{name:"name"}],i:[{name:"description"}],u:[{name:"uri"}],e:[{name:"email"}],p:[{name:"phone"}],z:[{name:"timezones"}],r:[{name:"repeats"}],t:[{name:"timing",reg:/^(\d*) (\d*)/,names:["start","stop"],format:"%d %d"}],c:[{name:"connection",reg:/^IN IP(\d) (\S*)/,names:["version","ip"],format:"IN IP%d %s"}],b:[{push:"bandwidth",reg:/^(TIAS|AS|CT|RR|RS):(\d*)/,names:["type","limit"],format:"%s:%s"}],m:[{reg:/^(\w*) (\d*) ([\w\/]*)(?: (.*))?/,names:["type","port","protocol","payloads"],format:"%s %d %s %s"}],a:[{push:"rtp",reg:/^rtpmap:(\d*) ([\w\-]*)(?:\s*\/(\d*)(?:\s*\/(\S*))?)?/,names:["payload","codec","rate","encoding"],format:function(e){return e.encoding?"rtpmap:%d %s/%s/%s":e.rate?"rtpmap:%d %s/%s":"rtpmap:%d %s"}},{push:"fmtp",reg:/^fmtp:(\d*) ([\S| ]*)/,names:["payload","config"],format:"fmtp:%d %s"},{name:"control",reg:/^control:(.*)/,format:"control:%s"},{name:"rtcp",reg:/^rtcp:(\d*)(?: (\S*) IP(\d) (\S*))?/,names:["port","netType","ipVer","address"],format:function(e){return null!=e.address?"rtcp:%d %s IP%d %s":"rtcp:%d"}},{push:"rtcpFbTrrInt",reg:/^rtcp-fb:(\*|\d*) trr-int (\d*)/,names:["payload","value"],format:"rtcp-fb:%d trr-int %d"},{push:"rtcpFb",reg:/^rtcp-fb:(\*|\d*) ([\w-_]*)(?: ([\w-_]*))?/,names:["payload","type","subtype"],format:function(e){return null!=e.subtype?"rtcp-fb:%s %s %s":"rtcp-fb:%s %s"}},{push:"ext",reg:/^extmap:([\w_\/]*) (\S*)(?: (\S*))?/,names:["value","uri","config"],format:function(e){return null!=e.config?"extmap:%s %s %s":"extmap:%s %s"}},{push:"crypto",reg:/^crypto:(\d*) ([\w_]*) (\S*)(?: (\S*))?/,names:["id","suite","config","sessionConfig"],format:function(e){return null!=e.sessionConfig?"crypto:%d %s %s %s":"crypto:%d %s %s"}},{name:"setup",reg:/^setup:(\w*)/,format:"setup:%s"},{name:"mid",reg:/^mid:([^\s]*)/,format:"mid:%s"},{name:"msid",reg:/^msid:(.*)/,format:"msid:%s"},{name:"ptime",reg:/^ptime:(\d*)/,format:"ptime:%d"},{name:"maxptime",reg:/^maxptime:(\d*)/,format:"maxptime:%d"},{name:"direction",reg:/^(sendrecv|recvonly|sendonly|inactive)/},{name:"icelite",reg:/^(ice-lite)/},{name:"iceUfrag",reg:/^ice-ufrag:(\S*)/,format:"ice-ufrag:%s"},{name:"icePwd",reg:/^ice-pwd:(\S*)/,format:"ice-pwd:%s"},{name:"fingerprint",reg:/^fingerprint:(\S*) (\S*)/,names:["type","hash"],format:"fingerprint:%s %s"},{push:"candidates",reg:/^candidate:(\S*) (\d*) (\S*) (\d*) (\S*) (\d*) typ (\S*)(?: raddr (\S*) rport (\d*))?(?: tcptype (\S*))?(?: generation (\d*))?/,names:["foundation","component","transport","priority","ip","port","type","raddr","rport","tcptype","generation"],format:function(e){var r="candidate:%s %d %s %d %s %d typ %s";return r+=null!=e.raddr?" raddr %s rport %d":"%v%v",r+=null!=e.tcptype?" tcptype %s":"%v",null!=e.generation&&(r+=" generation %d"),r}},{name:"endOfCandidates",reg:/^(end-of-candidates)/},{name:"remoteCandidates",reg:/^remote-candidates:(.*)/,format:"remote-candidates:%s"},{name:"iceOptions",reg:/^ice-options:(\S*)/,format:"ice-options:%s"},{push:"ssrcs",reg:/^ssrc:(\d*) ([\w_]*):(.*)/,names:["id","attribute","value"],format:"ssrc:%d %s:%s"},{push:"ssrcGroups",reg:/^ssrc-group:(\w*) (.*)/,names:["semantics","ssrcs"],format:"ssrc-group:%s %s"},{name:"msidSemantic",reg:/^msid-semantic:\s?(\w*) (\S*)/,names:["semantic","token"],format:"msid-semantic: %s %s"},{push:"groups",reg:/^group:(\w*) (.*)/,names:["type","mids"],format:"group:%s %s"},{name:"rtcpMux",reg:/^(rtcp-mux)/},{name:"rtcpRsize",reg:/^(rtcp-rsize)/},{push:"invalid",names:["value"]}]};Object.keys(grammar).forEach(function(e){grammar[e].forEach(function(e){e.reg||(e.reg=/(.*)/),e.format||(e.format="%s")})});
-},{}],14:[function(require,module,exports){
-var parser=require("./parser"),writer=require("./writer");exports.write=writer,exports.parse=parser.parse,exports.parseFmtpConfig=parser.parseFmtpConfig,exports.parsePayloads=parser.parsePayloads,exports.parseRemoteCandidates=parser.parseRemoteCandidates;
-},{"./parser":15,"./writer":16}],15:[function(require,module,exports){
-var toIntIfInt=function(t){return String(Number(t))===t?Number(t):t},attachProperties=function(t,r,e,n){if(n&&!e)r[n]=toIntIfInt(t[1]);else for(var a=0;a<e.length;a+=1)null!=t[a+1]&&(r[e[a]]=toIntIfInt(t[a+1]))},parseReg=function(t,r,e){var n=t.name&&t.names;t.push&&!r[t.push]?r[t.push]=[]:n&&!r[t.name]&&(r[t.name]={});var a=t.push?{}:n?r[t.name]:r;attachProperties(e.match(t.reg),a,t.names,t.name),t.push&&r[t.push].push(a)},grammar=require("./grammar"),validLine=RegExp.prototype.test.bind(/^([a-z])=(.*)/);exports.parse=function(t){var r={},e=[],n=r;return t.split(/(\r\n|\r|\n)/).filter(validLine).forEach(function(t){var r=t[0],a=t.slice(2);"m"===r&&(e.push({rtp:[],fmtp:[]}),n=e[e.length-1]);for(var p=0;p<(grammar[r]||[]).length;p+=1){var s=grammar[r][p];if(s.reg.test(a))return parseReg(s,n,a)}}),r.media=e,r};var fmtpReducer=function(t,r){var e=r.split("=");return 2===e.length&&(t[e[0]]=toIntIfInt(e[1])),t};exports.parseFmtpConfig=function(t){return t.split(/\;\s?/).reduce(fmtpReducer,{})},exports.parsePayloads=function(t){return t.split(" ").map(Number)},exports.parseRemoteCandidates=function(t){for(var r=[],e=t.split(" ").map(toIntIfInt),n=0;n<e.length;n+=3)r.push({component:e[n],ip:e[n+1],port:e[n+2]});return r};
-},{"./grammar":13}],16:[function(require,module,exports){
-var grammar=require("./grammar"),formatRegExp=/%[sdv%]/g,format=function(n){var r=1,e=arguments,a=e.length;return n.replace(formatRegExp,function(n){if(r>=a)return n;var u=e[r];switch(r+=1,n){case"%%":return"%";case"%s":return String(u);case"%d":return Number(u);case"%v":return""}})},makeLine=function(n,r,e){var a=r.format instanceof Function?r.format(r.push?e:e[r.name]):r.format,u=[n+"="+a];if(r.names)for(var m=0;m<r.names.length;m+=1){var t=r.names[m];r.name?u.push(e[r.name][t]):u.push(e[r.names[m]])}else u.push(e[r.name]);return format.apply(null,u)},defaultOuterOrder=["v","o","s","i","u","e","p","c","b","t","r","z","a"],defaultInnerOrder=["i","c","b","a"];module.exports=function(n,r){r=r||{},null==n.version&&(n.version=0),null==n.name&&(n.name=" "),n.media.forEach(function(n){null==n.payloads&&(n.payloads="")});var e=r.outerOrder||defaultOuterOrder,a=r.innerOrder||defaultInnerOrder,u=[];return e.forEach(function(r){grammar[r].forEach(function(e){e.name in n&&null!=n[e.name]?u.push(makeLine(r,e,n)):e.push in n&&null!=n[e.push]&&n[e.push].forEach(function(n){u.push(makeLine(r,e,n))})})}),n.media.forEach(function(n){u.push(makeLine("m",grammar.m[0],n)),a.forEach(function(r){grammar[r].forEach(function(e){e.name in n&&null!=n[e.name]?u.push(makeLine(r,e,n)):e.push in n&&null!=n[e.push]&&n[e.push].forEach(function(n){u.push(makeLine(r,e,n))})})})}),u.join("\r\n")+"\r\n"};
-},{"./grammar":13}],17:[function(require,module,exports){
-module.exports=function r(t){if(!t)return!1;if(this.length!=t.length)return!1;for(var e=0,n=this.length;e<n;e++)if(this[e]instanceof Array&&t[e]instanceof Array){if(!r.apply(this[e],[t[e]]))return!1}else if(this[e]!=t[e])return!1;return!0};
-},{}],18:[function(require,module,exports){
-exports.Interop=require("./interop");
-},{"./interop":19}],19:[function(require,module,exports){
-"use strict";function Interop(){this.cache={mlB2UMap:{},mlU2BMap:{}}}function addSetupAttr(e){void 0!==e.setup&&("active"===e.setup?e.setup="passive":"passive"===e.setup&&(e.setup="active"))}var transform=require("./transform"),arrayEquals=require("./array-equals");module.exports=Interop,Interop.prototype.candidateToUnifiedPlan=function(e){var r=new RTCIceCandidate(e);return r.sdpMLineIndex=this.cache.mlB2UMap[r.sdpMLineIndex],r},Interop.prototype.candidateToPlanB=function(e){var r=new RTCIceCandidate(e);if(0===r.sdpMid.indexOf("audio"))r.sdpMid="audio";else{if(0!==r.sdpMid.indexOf("video"))throw new Error("candidate with "+r.sdpMid+" not allowed");r.sdpMid="video"}return r.sdpMLineIndex=this.cache.mlU2BMap[r.sdpMLineIndex],r},Interop.prototype.getFirstSendingIndexFromAnswer=function(e){if(!this.cache.answer)return null;var r=transform.parse(this.cache.answer);if(r&&r.media&&Array.isArray(r.media))for(var i=0;i<r.media.length;i++)if(r.media[i].type==e&&(!r.media[i].direction||"sendrecv"===r.media[i].direction||"sendonly"===r.media[i].direction))return i;return null},Interop.prototype.toPlanB=function(e){var r=this;if("object"!=typeof e||null===e||"string"!=typeof e.sdp)return console.warn("An empty description was passed as an argument."),e;var i=transform.parse(e.sdp);if(void 0===i.media||!Array.isArray(i.media)||0===i.media.length)return console.warn("The description has no media."),e;if(i.media.length<=3&&i.media.every(function(e){return-1!==["video","audio","data"].indexOf(e.mid)}))return console.warn("This description does not look like Unified Plan."),e;for(var t=e.sdp,o=!1,n=0;n<i.media.length;n++){i.media[n].rtp.forEach(function(e){if("NULL"===e.codec){o=!0;var i=transform.parse(r.cache.offer);e.codec=i.media[n].rtp[0].codec}})}o&&(t=transform.write(i)),this.cache[e.type]=t;var s=i.media;i.media=[];var a={},d=[];s.forEach(function(e){if(("string"!=typeof e.rtcpMux||"rtcp-mux"!==e.rtcpMux)&&"inactive"!==e.direction)throw new Error("Cannot convert to Plan B because m-lines without the rtcp-mux attribute were found.");if(void 0!==a[e.type]&&"inactive"!==a[e.type].direction||(a[e.type]=e),e.protocol!=a[e.type].protocol)throw new Error("Cannot convert to Plan B because m-lines have different protocols and this library does not have support for that");if(e.payloads!=a[e.type].payloads)throw new Error("Cannot convert to Plan B because m-lines have different payloads and this library does not have support for that")}),s.forEach(function(e){if("application"===e.type)return i.media.push(e),void d.push(e.mid);"object"==typeof e.sources&&Object.keys(e.sources).forEach(function(r){"object"!=typeof a[e.type].sources&&(a[e.type].sources={}),a[e.type].sources[r]=e.sources[r],void 0!==e.msid&&(a[e.type].sources[r].msid=e.msid)}),void 0!==e.ssrcGroups&&Array.isArray(e.ssrcGroups)&&(void 0!==a[e.type].ssrcGroups&&Array.isArray(a[e.type].ssrcGroups)||(a[e.type].ssrcGroups=[]),a[e.type].ssrcGroups=a[e.type].ssrcGroups.concat(e.ssrcGroups)),a[e.type]===e&&(e.mid=e.type,delete e.bundleOnly,delete e.msid,e.type==s[0].type?(d.unshift(e.type),i.media.unshift(e)):(d.push(e.type),i.media.push(e)))}),void 0!==i.groups&&i.groups.some(function(e){if("BUNDLE"===e.type)return e.mids=d.join(" "),!0}),i.msidSemantic={semantic:"WMS",token:"*"};var c=transform.write(i);return new RTCSessionDescription({type:e.type,sdp:c})},Interop.prototype.toUnifiedPlan=function(e){var r=this;if("object"!=typeof e||null===e||"string"!=typeof e.sdp)return console.warn("An empty description was passed as an argument."),e;var i=transform.parse(e.sdp);if(void 0===i.media||!Array.isArray(i.media)||0===i.media.length)return console.warn("The description has no media."),e;if(i.media.length>3||!i.media.every(function(e){return-1!==["video","audio","data"].indexOf(e.mid)}))return console.warn("This description does not look like Plan B."),e;var t=[];i.media.forEach(function(e){t.push(e.mid)});var o=!1;if(void 0!==i.groups&&Array.isArray(i.groups)&&(o=i.groups.every(function(e){return"BUNDLE"!==e.type||arrayEquals.apply(e.mids.sort(),[t.sort()])})),!o){var n=!1;if(i.media.forEach(function(e){"inactive"!==e.direction&&(n=!0)}),n)throw new Error("Cannot convert to Unified Plan because m-lines that are not bundled were found.")}var s;if("answer"===e.type)s="offer";else{if("offer"!==e.type)throw new Error("Type '"+e.type+"' not supported.");s="answer"}var a;void 0!==this.cache[s]&&(a=transform.parse(this.cache[s]));var d,c,p,u,f={audio:{},video:{}},m={},y=0,l=0,v={},h={},w={},g={};if(i.media.forEach(function(i){if(("string"!=typeof i.rtcpMux||"rtcp-mux"!==i.rtcpMux)&&"inactive"!==i.direction)throw new Error("Cannot convert to Unified Plan because m-lines without the rtcp-mux attribute were found.");if("application"===i.type)return void(m[i.mid]=i);var t=i.sources,o=i.ssrcGroups,n=i.port;if(void 0!==i.candidates&&(d=void 0!==d?d.concat(i.candidates):i.candidates),void 0!==c&&void 0!==i.iceUfrag&&c!=i.iceUfrag)throw new Error("Only BUNDLE supported, iceUfrag must be the same for all m-lines.\n\tLast iceUfrag: "+c+"\n\tNew iceUfrag: "+i.iceUfrag);if(void 0!==i.iceUfrag&&(c=i.iceUfrag),void 0!==p&&void 0!==i.icePwd&&p!=i.icePwd)throw new Error("Only BUNDLE supported, icePwd must be the same for all m-lines.\n\tLast icePwd: "+p+"\n\tNew icePwd: "+i.icePwd);if(void 0!==i.icePwd&&(p=i.icePwd),void 0!==u&&void 0!==i.fingerprint&&(u.type!=i.fingerprint.type||u.hash!=i.fingerprint.hash))throw new Error("Only BUNDLE supported, fingerprint must be the same for all m-lines.\n\tLast fingerprint: "+JSON.stringify(u)+"\n\tNew fingerprint: "+JSON.stringify(i.fingerprint));void 0!==i.fingerprint&&(u=i.fingerprint),h[i.type]=i.payloads,w[i.type]=i.rtcpFb,g[i.type]=i.rtp;var s={};void 0!==o&&Array.isArray(o)&&o.forEach(function(e){void 0!==e.ssrcs&&Array.isArray(e.ssrcs)&&e.ssrcs.forEach(function(r){void 0===s[r]&&(s[r]=[]),s[r].push(e)})});var E={};if("object"==typeof t)delete i.sources,delete i.ssrcGroups,delete i.candidates,delete i.iceUfrag,delete i.icePwd,delete i.fingerprint,delete i.port,delete i.mid,Object.keys(t).forEach(function(o){var h;if("offer"===e.type&&!t[o].msid)return void(f[i.type][o]=t[o]);void 0!==s[o]&&Array.isArray(s[o])&&s[o].some(function(e){return e.ssrcs.some(function(e){if("object"==typeof E[e])return h=E[e],!0})}),"object"==typeof h?(h.sources[o]=t[o],delete t[o].msid):(h=Object.create(i),E[o]=h,void 0!==t[o].msid&&(h.msid=t[o].msid,delete t[o].msid),h.sources={},h.sources[o]=t[o],h.ssrcGroups=s[o],void 0!==a&&void 0!==a.media&&Array.isArray(a.media)&&a.media.forEach(function(e){"object"==typeof e.sources&&Object.keys(e.sources).forEach(function(r){r===o&&(h.mid=e.mid)})}),void 0===h.mid&&(h.mid=[i.type,"-",o].join("")),h.candidates=d,h.iceUfrag=c,h.icePwd=p,h.fingerprint=u,h.port=n,m[h.mid]=h,v[l]=h.sources,r.cache.mlU2BMap[l]=y,void 0===r.cache.mlB2UMap[y]&&(r.cache.mlB2UMap[y]=l),l++)});else{var U=i;U.candidates=d,U.iceUfrag=c,U.icePwd=p,U.fingerprint=u,U.port=n,m[U.mid]=U,r.cache.mlU2BMap[l]=y,void 0===r.cache.mlB2UMap[y]&&(r.cache.mlB2UMap[y]=l)}y++}),i.media=[],t=[],"answer"===e.type)for(var E=0;E<a.media.length;E++){var U=a.media[E];delete U.msid,delete U.sources,delete U.ssrcGroups,void 0===v[E]?U.direction&&"sendrecv"!==U.direction?"sendonly"===U.direction&&(U.direction="inactive"):U.direction="recvonly":U.direction&&"sendrecv"!==U.direction?"recvonly"===U.direction&&(U.direction="sendonly"):U.direction="sendrecv",U.sources=v[E],U.candidates=d,U.iceUfrag=c,U.icePwd=p,U.fingerprint=u,U.rtp=g[U.type],U.payloads=h[U.type],U.rtcpFb=w[U.type],i.media.push(U),"string"==typeof U.mid&&t.push(U.mid)}else void 0!==a&&void 0!==a.media&&Array.isArray(a.media)&&a.media.forEach(function(e){t.push(e.mid),void 0!==m[e.mid]?i.media.push(m[e.mid]):(delete e.msid,delete e.sources,delete e.ssrcGroups,e.direction&&"sendrecv"!==e.direction||(e.direction="sendonly"),e.direction&&"recvonly"!==e.direction||(e.direction="inactive"),addSetupAttr(e),i.media.push(e))}),Object.keys(m).forEach(function(e){if(-1===t.indexOf(e))if(t.push(e),"recvonly"===m[e].direction){var r=!1;i.media.some(function(i){if(("sendrecv"===i.direction||"sendonly"===i.direction)&&i.type===m[e].type)return Object.keys(m[e].sources).forEach(function(r){i.sources[r]=m[e].sources[r]}),r=!0,!0}),r||i.media.push(m[e])}else i.media.push(m[e])});["audio","video"].forEach(function(e){if(i&&i.media&&Array.isArray(i.media)){var t=null;if(Object.keys(f[e]).length>0&&null===(t=r.getFirstSendingIndexFromAnswer(e)))for(var o=0;o<i.media.length;o++)if(i.media[o].type===e){t=o;break}if(t&&i.media.length>t){var n=i.media[t];Object.keys(f[e]).forEach(function(r){n.sources&&n.sources[r]&&console.warn("Replacing an existing SSRC."),n.sources||(n.sources={}),n.sources[r]=f[e][r]})}}}),void 0!==i.groups&&i.groups.some(function(e){if("BUNDLE"===e.type)return e.mids=t.join(" "),!0}),i.msidSemantic={semantic:"WMS",token:"*"};var b=transform.write(i);return this.cache[e.type]=b,new RTCSessionDescription({type:e.type,sdp:b})};
-},{"./array-equals":17,"./transform":20}],20:[function(require,module,exports){
-var transform=require("sdp-transform");exports.write=function(s,r){return void 0!==s&&void 0!==s.media&&Array.isArray(s.media)&&s.media.forEach(function(s){void 0!==s.sources&&0!==Object.keys(s.sources).length&&(s.ssrcs=[],Object.keys(s.sources).forEach(function(r){var o=s.sources[r];Object.keys(o).forEach(function(i){s.ssrcs.push({id:r,attribute:i,value:o[i]})})}),delete s.sources),void 0!==s.ssrcGroups&&Array.isArray(s.ssrcGroups)&&s.ssrcGroups.forEach(function(s){void 0!==s.ssrcs&&Array.isArray(s.ssrcs)&&(s.ssrcs=s.ssrcs.join(" "))})}),void 0!==s&&void 0!==s.groups&&Array.isArray(s.groups)&&s.groups.forEach(function(s){void 0!==s.mids&&Array.isArray(s.mids)&&(s.mids=s.mids.join(" "))}),transform.write(s,r)},exports.parse=function(s){var r=transform.parse(s);return void 0!==r&&void 0!==r.media&&Array.isArray(r.media)&&r.media.forEach(function(s){void 0!==s.ssrcs&&Array.isArray(s.ssrcs)&&(s.sources={},s.ssrcs.forEach(function(r){s.sources[r.id]||(s.sources[r.id]={}),s.sources[r.id][r.attribute]=r.value}),delete s.ssrcs),void 0!==s.ssrcGroups&&Array.isArray(s.ssrcGroups)&&s.ssrcGroups.forEach(function(s){"string"==typeof s.ssrcs&&(s.ssrcs=s.ssrcs.split(" "))})}),void 0!==r&&void 0!==r.groups&&Array.isArray(r.groups)&&r.groups.forEach(function(s){"string"==typeof s.mids&&(s.mids=s.mids.split(" "))}),r};
-},{"sdp-transform":14}],21:[function(require,module,exports){
-!function(i,e){"use strict";var s="model",o="name",r="type",n="vendor",a="version",t="mobile",w="tablet",d={extend:function(i,e){var s={};for(var o in i)e[o]&&e[o].length%2==0?s[o]=e[o].concat(i[o]):s[o]=i[o];return s},has:function(i,e){return"string"==typeof i&&-1!==e.toLowerCase().indexOf(i.toLowerCase())},lowerize:function(i){return i.toLowerCase()},major:function(i){return"string"==typeof i?i.replace(/[^\d\.]/g,"").split(".")[0]:void 0},trim:function(i){return i.replace(/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,"")}},l={rgx:function(){for(var i,e,s,o,r,n,a,t=0,w=arguments;t<w.length&&!n;){var d=w[t],l=w[t+1];if(void 0===i){i={};for(o in l)l.hasOwnProperty(o)&&(r=l[o],"object"==typeof r?i[r[0]]=void 0:i[r]=void 0)}for(e=s=0;e<d.length&&!n;)if(n=d[e++].exec(this.getUA()))for(o=0;o<l.length;o++)a=n[++s],r=l[o],"object"==typeof r&&r.length>0?2==r.length?"function"==typeof r[1]?i[r[0]]=r[1].call(this,a):i[r[0]]=r[1]:3==r.length?"function"!=typeof r[1]||r[1].exec&&r[1].test?i[r[0]]=a?a.replace(r[1],r[2]):void 0:i[r[0]]=a?r[1].call(this,a,r[2]):void 0:4==r.length&&(i[r[0]]=a?r[3].call(this,a.replace(r[1],r[2])):void 0):i[r]=a||void 0;t+=2}return i},str:function(i,e){for(var s in e)if("object"==typeof e[s]&&e[s].length>0){for(var o=0;o<e[s].length;o++)if(d.has(e[s][o],i))return"?"===s?void 0:s}else if(d.has(e[s],i))return"?"===s?void 0:s;return i}},c={browser:{oldsafari:{version:{"1.0":"/8",1.2:"/1",1.3:"/3","2.0":"/412","2.0.2":"/416","2.0.3":"/417","2.0.4":"/419","?":"/"}}},device:{amazon:{model:{"Fire Phone":["SD","KF"]}},sprint:{model:{"Evo Shift 4G":"7373KT"},vendor:{HTC:"APA",Sprint:"Sprint"}}},os:{windows:{version:{ME:"4.90","NT 3.11":"NT3.51","NT 4.0":"NT4.0",2000:"NT 5.0",XP:["NT 5.1","NT 5.2"],Vista:"NT 6.0",7:"NT 6.1",8:"NT 6.2",8.1:"NT 6.3",10:["NT 6.4","NT 10.0"],RT:"ARM"}}}},u={browser:[[/(opera\smini)\/([\w\.-]+)/i,/(opera\s[mobiletab]+).+version\/([\w\.-]+)/i,/(opera).+version\/([\w\.]+)/i,/(opera)[\/\s]+([\w\.]+)/i],[o,a],[/(opios)[\/\s]+([\w\.]+)/i],[[o,"Opera Mini"],a],[/\s(opr)\/([\w\.]+)/i],[[o,"Opera"],a],[/(kindle)\/([\w\.]+)/i,/(lunascape|maxthon|netfront|jasmine|blazer)[\/\s]?([\w\.]+)*/i,/(avant\s|iemobile|slim|baidu)(?:browser)?[\/\s]?([\w\.]*)/i,/(?:ms|\()(ie)\s([\w\.]+)/i,/(rekonq)\/([\w\.]+)*/i,/(chromium|flock|rockmelt|midori|epiphany|silk|skyfire|ovibrowser|bolt|iron|vivaldi|iridium|phantomjs)\/([\w\.-]+)/i],[o,a],[/(trident).+rv[:\s]([\w\.]+).+like\sgecko/i],[[o,"IE"],a],[/(edge)\/((\d+)?[\w\.]+)/i],[o,a],[/(yabrowser)\/([\w\.]+)/i],[[o,"Yandex"],a],[/(comodo_dragon)\/([\w\.]+)/i],[[o,/_/g," "],a],[/(micromessenger)\/([\w\.]+)/i],[[o,"WeChat"],a],[/xiaomi\/miuibrowser\/([\w\.]+)/i],[a,[o,"MIUI Browser"]],[/\swv\).+(chrome)\/([\w\.]+)/i],[[o,/(.+)/,"$1 WebView"],a],[/android.+samsungbrowser\/([\w\.]+)/i,/android.+version\/([\w\.]+)\s+(?:mobile\s?safari|safari)*/i],[a,[o,"Android Browser"]],[/(chrome|omniweb|arora|[tizenoka]{5}\s?browser)\/v?([\w\.]+)/i,/(qqbrowser)[\/\s]?([\w\.]+)/i],[o,a],[/(uc\s?browser)[\/\s]?([\w\.]+)/i,/ucweb.+(ucbrowser)[\/\s]?([\w\.]+)/i,/juc.+(ucweb)[\/\s]?([\w\.]+)/i],[[o,"UCBrowser"],a],[/(dolfin)\/([\w\.]+)/i],[[o,"Dolphin"],a],[/((?:android.+)crmo|crios)\/([\w\.]+)/i],[[o,"Chrome"],a],[/;fbav\/([\w\.]+);/i],[a,[o,"Facebook"]],[/fxios\/([\w\.-]+)/i],[a,[o,"Firefox"]],[/version\/([\w\.]+).+?mobile\/\w+\s(safari)/i],[a,[o,"Mobile Safari"]],[/version\/([\w\.]+).+?(mobile\s?safari|safari)/i],[a,o],[/webkit.+?(mobile\s?safari|safari)(\/[\w\.]+)/i],[o,[a,l.str,c.browser.oldsafari.version]],[/(konqueror)\/([\w\.]+)/i,/(webkit|khtml)\/([\w\.]+)/i],[o,a],[/(navigator|netscape)\/([\w\.-]+)/i],[[o,"Netscape"],a],[/(swiftfox)/i,/(icedragon|iceweasel|camino|chimera|fennec|maemo\sbrowser|minimo|conkeror)[\/\s]?([\w\.\+]+)/i,/(firefox|seamonkey|k-meleon|icecat|iceape|firebird|phoenix)\/([\w\.-]+)/i,/(mozilla)\/([\w\.]+).+rv\:.+gecko\/\d+/i,/(polaris|lynx|dillo|icab|doris|amaya|w3m|netsurf|sleipnir)[\/\s]?([\w\.]+)/i,/(links)\s\(([\w\.]+)/i,/(gobrowser)\/?([\w\.]+)*/i,/(ice\s?browser)\/v?([\w\._]+)/i,/(mosaic)[\/\s]([\w\.]+)/i],[o,a]],cpu:[[/(?:(amd|x(?:(?:86|64)[_-])?|wow|win)64)[;\)]/i],[["architecture","amd64"]],[/(ia32(?=;))/i],[["architecture",d.lowerize]],[/((?:i[346]|x)86)[;\)]/i],[["architecture","ia32"]],[/windows\s(ce|mobile);\sppc;/i],[["architecture","arm"]],[/((?:ppc|powerpc)(?:64)?)(?:\smac|;|\))/i],[["architecture",/ower/,"",d.lowerize]],[/(sun4\w)[;\)]/i],[["architecture","sparc"]],[/((?:avr32|ia64(?=;))|68k(?=\))|arm(?:64|(?=v\d+;))|(?=atmel\s)avr|(?:irix|mips|sparc)(?:64)?(?=;)|pa-risc)/i],[["architecture",d.lowerize]]],device:[[/\((ipad|playbook);[\w\s\);-]+(rim|apple)/i],[s,n,[r,w]],[/applecoremedia\/[\w\.]+ \((ipad)/],[s,[n,"Apple"],[r,w]],[/(apple\s{0,1}tv)/i],[[s,"Apple TV"],[n,"Apple"]],[/(archos)\s(gamepad2?)/i,/(hp).+(touchpad)/i,/(hp).+(tablet)/i,/(kindle)\/([\w\.]+)/i,/\s(nook)[\w\s]+build\/(\w+)/i,/(dell)\s(strea[kpr\s\d]*[\dko])/i],[n,s,[r,w]],[/(kf[A-z]+)\sbuild\/[\w\.]+.*silk\//i],[s,[n,"Amazon"],[r,w]],[/(sd|kf)[0349hijorstuw]+\sbuild\/[\w\.]+.*silk\//i],[[s,l.str,c.device.amazon.model],[n,"Amazon"],[r,t]],[/\((ip[honed|\s\w*]+);.+(apple)/i],[s,n,[r,t]],[/\((ip[honed|\s\w*]+);/i],[s,[n,"Apple"],[r,t]],[/(blackberry)[\s-]?(\w+)/i,/(blackberry|benq|palm(?=\-)|sonyericsson|acer|asus|dell|huawei|meizu|motorola|polytron)[\s_-]?([\w-]+)*/i,/(hp)\s([\w\s]+\w)/i,/(asus)-?(\w+)/i],[n,s,[r,t]],[/\(bb10;\s(\w+)/i],[s,[n,"BlackBerry"],[r,t]],[/android.+(transfo[prime\s]{4,10}\s\w+|eeepc|slider\s\w+|nexus 7|padfone)/i],[s,[n,"Asus"],[r,w]],[/(sony)\s(tablet\s[ps])\sbuild\//i,/(sony)?(?:sgp.+)\sbuild\//i],[[n,"Sony"],[s,"Xperia Tablet"],[r,w]],[/(?:sony)?(?:(?:(?:c|d)\d{4})|(?:so[-l].+))\sbuild\//i],[[n,"Sony"],[s,"Xperia Phone"],[r,t]],[/\s(ouya)\s/i,/(nintendo)\s([wids3u]+)/i],[n,s,[r,"console"]],[/android.+;\s(shield)\sbuild/i],[s,[n,"Nvidia"],[r,"console"]],[/(playstation\s[34portablevi]+)/i],[s,[n,"Sony"],[r,"console"]],[/(sprint\s(\w+))/i],[[n,l.str,c.device.sprint.vendor],[s,l.str,c.device.sprint.model],[r,t]],[/(lenovo)\s?(S(?:5000|6000)+(?:[-][\w+]))/i],[n,s,[r,w]],[/(htc)[;_\s-]+([\w\s]+(?=\))|\w+)*/i,/(zte)-(\w+)*/i,/(alcatel|geeksphone|huawei|lenovo|nexian|panasonic|(?=;\s)sony)[_\s-]?([\w-]+)*/i],[n,[s,/_/g," "],[r,t]],[/(nexus\s9)/i],[s,[n,"HTC"],[r,w]],[/(nexus\s6p)/i],[s,[n,"Huawei"],[r,t]],[/(microsoft);\s(lumia[\s\w]+)/i],[n,s,[r,t]],[/[\s\(;](xbox(?:\sone)?)[\s\);]/i],[s,[n,"Microsoft"],[r,"console"]],[/(kin\.[onetw]{3})/i],[[s,/\./g," "],[n,"Microsoft"],[r,t]],[/\s(milestone|droid(?:[2-4x]|\s(?:bionic|x2|pro|razr))?(:?\s4g)?)[\w\s]+build\//i,/mot[\s-]?(\w+)*/i,/(XT\d{3,4}) build\//i,/(nexus\s6)/i],[s,[n,"Motorola"],[r,t]],[/android.+\s(mz60\d|xoom[\s2]{0,2})\sbuild\//i],[s,[n,"Motorola"],[r,w]],[/hbbtv\/\d+\.\d+\.\d+\s+\([\w\s]*;\s*(\w[^;]*);([^;]*)/i],[[n,d.trim],[s,d.trim],[r,"smarttv"]],[/hbbtv.+maple;(\d+)/i],[[s,/^/,"SmartTV"],[n,"Samsung"],[r,"smarttv"]],[/\(dtv[\);].+(aquos)/i],[s,[n,"Sharp"],[r,"smarttv"]],[/android.+((sch-i[89]0\d|shw-m380s|gt-p\d{4}|gt-n\d+|sgh-t8[56]9|nexus 10))/i,/((SM-T\w+))/i],[[n,"Samsung"],s,[r,w]],[/smart-tv.+(samsung)/i],[n,[r,"smarttv"],s],[/((s[cgp]h-\w+|gt-\w+|galaxy\snexus|sm-\w[\w\d]+))/i,/(sam[sung]*)[\s-]*(\w+-?[\w-]*)*/i,/sec-((sgh\w+))/i],[[n,"Samsung"],s,[r,t]],[/sie-(\w+)*/i],[s,[n,"Siemens"],[r,t]],[/(maemo|nokia).*(n900|lumia\s\d+)/i,/(nokia)[\s_-]?([\w-]+)*/i],[[n,"Nokia"],s,[r,t]],[/android\s3\.[\s\w;-]{10}(a\d{3})/i],[s,[n,"Acer"],[r,w]],[/android\s3\.[\s\w;-]{10}(lg?)-([06cv9]{3,4})/i],[[n,"LG"],s,[r,w]],[/(lg) netcast\.tv/i],[n,s,[r,"smarttv"]],[/(nexus\s[45])/i,/lg[e;\s\/-]+(\w+)*/i],[s,[n,"LG"],[r,t]],[/android.+(ideatab[a-z0-9\-\s]+)/i],[s,[n,"Lenovo"],[r,w]],[/linux;.+((jolla));/i],[n,s,[r,t]],[/((pebble))app\/[\d\.]+\s/i],[n,s,[r,"wearable"]],[/android.+;\s(glass)\s\d/i],[s,[n,"Google"],[r,"wearable"]],[/android.+(\w+)\s+build\/hm\1/i,/android.+(hm[\s\-_]*note?[\s_]*(?:\d\w)?)\s+build/i,/android.+(mi[\s\-_]*(?:one|one[\s_]plus|note lte)?[\s_]*(?:\d\w)?)\s+build/i],[[s,/_/g," "],[n,"Xiaomi"],[r,t]],[/android.+a000(1)\s+build/i],[s,[n,"OnePlus"],[r,t]],[/\s(tablet)[;\/]/i,/\s(mobile)(?:[;\/]|\ssafari)/i],[[r,d.lowerize],n,s]],engine:[[/windows.+\sedge\/([\w\.]+)/i],[a,[o,"EdgeHTML"]],[/(presto)\/([\w\.]+)/i,/(webkit|trident|netfront|netsurf|amaya|lynx|w3m)\/([\w\.]+)/i,/(khtml|tasman|links)[\/\s]\(?([\w\.]+)/i,/(icab)[\/\s]([23]\.[\d\.]+)/i],[o,a],[/rv\:([\w\.]+).*(gecko)/i],[a,o]],os:[[/microsoft\s(windows)\s(vista|xp)/i],[o,a],[/(windows)\snt\s6\.2;\s(arm)/i,/(windows\sphone(?:\sos)*)[\s\/]?([\d\.\s]+\w)*/i,/(windows\smobile|windows)[\s\/]?([ntce\d\.\s]+\w)/i],[o,[a,l.str,c.os.windows.version]],[/(win(?=3|9|n)|win\s9x\s)([nt\d\.]+)/i],[[o,"Windows"],[a,l.str,c.os.windows.version]],[/\((bb)(10);/i],[[o,"BlackBerry"],a],[/(blackberry)\w*\/?([\w\.]+)*/i,/(tizen)[\/\s]([\w\.]+)/i,/(android|webos|palm\sos|qnx|bada|rim\stablet\sos|meego|contiki)[\/\s-]?([\w\.]+)*/i,/linux;.+(sailfish);/i],[o,a],[/(symbian\s?os|symbos|s60(?=;))[\/\s-]?([\w\.]+)*/i],[[o,"Symbian"],a],[/\((series40);/i],[o],[/mozilla.+\(mobile;.+gecko.+firefox/i],[[o,"Firefox OS"],a],[/(nintendo|playstation)\s([wids34portablevu]+)/i,/(mint)[\/\s\(]?(\w+)*/i,/(mageia|vectorlinux)[;\s]/i,/(joli|[kxln]?ubuntu|debian|[open]*suse|gentoo|(?=\s)arch|slackware|fedora|mandriva|centos|pclinuxos|redhat|zenwalk|linpus)[\/\s-]?(?!chrom)([\w\.-]+)*/i,/(hurd|linux)\s?([\w\.]+)*/i,/(gnu)\s?([\w\.]+)*/i],[o,a],[/(cros)\s[\w]+\s([\w\.]+\w)/i],[[o,"Chromium OS"],a],[/(sunos)\s?([\w\.]+\d)*/i],[[o,"Solaris"],a],[/\s([frentopc-]{0,4}bsd|dragonfly)\s?([\w\.]+)*/i],[o,a],[/(haiku)\s(\w+)/i],[o,a],[/(ip[honead]+)(?:.*os\s([\w]+)*\slike\smac|;\sopera)/i],[[o,"iOS"],[a,/_/g,"."]],[/(mac\sos\sx)\s?([\w\s\.]+\w)*/i,/(macintosh|mac(?=_powerpc)\s)/i],[[o,"Mac OS"],[a,/_/g,"."]],[/((?:open)?solaris)[\/\s-]?([\w\.]+)*/i,/(aix)\s((\d)(?=\.|\)|\s)[\w\.]*)*/i,/(plan\s9|minix|beos|os\/2|amigaos|morphos|risc\sos|openvms)/i,/(unix)\s?([\w\.]+)*/i],[o,a]]},p=function(e,s){if(!(this instanceof p))return new p(e,s).getResult();var o=e||(i&&i.navigator&&i.navigator.userAgent?i.navigator.userAgent:""),r=s?d.extend(u,s):u;return this.getBrowser=function(){var i=l.rgx.apply(this,r.browser);return i.major=d.major(i.version),i},this.getCPU=function(){return l.rgx.apply(this,r.cpu)},this.getDevice=function(){return l.rgx.apply(this,r.device)},this.getEngine=function(){return l.rgx.apply(this,r.engine)},this.getOS=function(){return l.rgx.apply(this,r.os)},this.getResult=function(){return{ua:this.getUA(),browser:this.getBrowser(),engine:this.getEngine(),os:this.getOS(),device:this.getDevice(),cpu:this.getCPU()}},this.getUA=function(){return o},this.setUA=function(i){return o=i,this},this};p.VERSION="0.7.12",p.BROWSER={NAME:o,MAJOR:"major",VERSION:a},p.CPU={ARCHITECTURE:"architecture"},p.DEVICE={MODEL:s,VENDOR:n,TYPE:r,CONSOLE:"console",MOBILE:t,SMARTTV:"smarttv",TABLET:w,WEARABLE:"wearable",EMBEDDED:"embedded"},p.ENGINE={NAME:o,VERSION:a},p.OS={NAME:o,VERSION:a},"undefined"!=typeof exports?("undefined"!=typeof module&&module.exports&&(exports=module.exports=p),exports.UAParser=p):"function"==typeof define&&define.amd?define(function(){return p}):i.UAParser=p;var m=i.jQuery||i.Zepto;if(void 0!==m){var b=new p;m.ua=b.getResult(),m.ua.get=function(){return b.getUA()},m.ua.set=function(i){b.setUA(i);var e=b.getResult();for(var s in e)m.ua[s]=e[s]}}}("object"==typeof window?window:this);
-},{}],22:[function(require,module,exports){
-(function (global){
-var rng,crypto=global.crypto||global.msCrypto;if(crypto&&crypto.getRandomValues){var _rnds8=new Uint8Array(16);rng=function(){return crypto.getRandomValues(_rnds8),_rnds8}}if(!rng){var _rnds=new Array(16);rng=function(){for(var r,n=0;n<16;n++)0==(3&n)&&(r=4294967296*Math.random()),_rnds[n]=r>>>((3&n)<<3)&255;return _rnds}}module.exports=rng;
-}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
-
-},{}],23:[function(require,module,exports){
-function parse(e,s,r){var t=s&&r||0,n=0;for(s=s||[],e.toLowerCase().replace(/[0-9a-f]{2}/g,function(e){n<16&&(s[t+n++]=_hexToByte[e])});n<16;)s[t+n++]=0;return s}function unparse(e,s){var r=s||0,t=_byteToHex;return t[e[r++]]+t[e[r++]]+t[e[r++]]+t[e[r++]]+"-"+t[e[r++]]+t[e[r++]]+"-"+t[e[r++]]+t[e[r++]]+"-"+t[e[r++]]+t[e[r++]]+"-"+t[e[r++]]+t[e[r++]]+t[e[r++]]+t[e[r++]]+t[e[r++]]+t[e[r++]]}function v1(e,s,r){var t=s&&r||0,n=s||[];e=e||{};var o=void 0!==e.clockseq?e.clockseq:_clockseq,a=void 0!==e.msecs?e.msecs:(new Date).getTime(),u=void 0!==e.nsecs?e.nsecs:_lastNSecs+1,c=a-_lastMSecs+(u-_lastNSecs)/1e4;if(c<0&&void 0===e.clockseq&&(o=o+1&16383),(c<0||a>_lastMSecs)&&void 0===e.nsecs&&(u=0),u>=1e4)throw new Error("uuid.v1(): Can't create more than 10M uuids/sec");_lastMSecs=a,_lastNSecs=u,_clockseq=o,a+=122192928e5;var i=(1e4*(268435455&a)+u)%4294967296;n[t++]=i>>>24&255,n[t++]=i>>>16&255,n[t++]=i>>>8&255,n[t++]=255&i;var _=a/4294967296*1e4&268435455;n[t++]=_>>>8&255,n[t++]=255&_,n[t++]=_>>>24&15|16,n[t++]=_>>>16&255,n[t++]=o>>>8|128,n[t++]=255&o;for(var d=e.node||_nodeId,v=0;v<6;v++)n[t+v]=d[v];return s||unparse(n)}function v4(e,s,r){var t=s&&r||0;"string"==typeof e&&(s="binary"==e?new Array(16):null,e=null),e=e||{};var n=e.random||(e.rng||_rng)();if(n[6]=15&n[6]|64,n[8]=63&n[8]|128,s)for(var o=0;o<16;o++)s[t+o]=n[o];return s||unparse(n)}for(var _rng=require("./rng"),_byteToHex=[],_hexToByte={},i=0;i<256;i++)_byteToHex[i]=(i+256).toString(16).substr(1),_hexToByte[_byteToHex[i]]=i;var _seedBytes=_rng(),_nodeId=[1|_seedBytes[0],_seedBytes[1],_seedBytes[2],_seedBytes[3],_seedBytes[4],_seedBytes[5]],_clockseq=16383&(_seedBytes[6]<<8|_seedBytes[7]),_lastMSecs=0,_lastNSecs=0,uuid=v4;uuid.v1=v1,uuid.v4=v4,uuid.parse=parse,uuid.unparse=unparse,module.exports=uuid;
-},{"./rng":22}],24:[function(require,module,exports){
-function WildEmitter(){}module.exports=WildEmitter,WildEmitter.mixin=function(t){var l=t.prototype||t;l.isWildEmitter=!0,l.on=function(t,l,i){this.callbacks=this.callbacks||{};var s=3===arguments.length,c=s?arguments[1]:void 0,a=s?arguments[2]:arguments[1];return a._groupName=c,(this.callbacks[t]=this.callbacks[t]||[]).push(a),this},l.once=function(t,l,i){function s(){c.off(t,s),h.apply(this,arguments)}var c=this,a=3===arguments.length,e=a?arguments[1]:void 0,h=a?arguments[2]:arguments[1];return this.on(t,e,s),this},l.releaseGroup=function(t){this.callbacks=this.callbacks||{};var l,i,s,c;for(l in this.callbacks)for(c=this.callbacks[l],i=0,s=c.length;i<s;i++)c[i]._groupName===t&&(c.splice(i,1),i--,s--);return this},l.off=function(t,l){this.callbacks=this.callbacks||{};var i,s=this.callbacks[t];return s?1===arguments.length?(delete this.callbacks[t],this):(i=s.indexOf(l),s.splice(i,1),0===s.length&&delete this.callbacks[t],this):this},l.emit=function(t){this.callbacks=this.callbacks||{};var l,i,s,c=[].slice.call(arguments,1),a=this.callbacks[t],e=this.getWildcardCallbacks(t);if(a)for(s=a.slice(),l=0,i=s.length;l<i&&s[l];++l)s[l].apply(this,c);if(e)for(i=e.length,s=e.slice(),l=0,i=s.length;l<i&&s[l];++l)s[l].apply(this,[t].concat(c));return this},l.getWildcardCallbacks=function(t){this.callbacks=this.callbacks||{};var l,i,s=[];for(l in this.callbacks)i=l.split("*"),("*"===l||2===i.length&&t.slice(0,i[0].length)===i[0])&&(s=s.concat(this.callbacks[l]));return s}},WildEmitter.mixin(WildEmitter);
-},{}]},{},[2])(2)
-});
-
-
-//# sourceMappingURL=kurento-utils.map
\ No newline at end of file
diff --git a/bigbluebutton-client/resources/prod/lib/reconnecting-websocket.min.js b/bigbluebutton-client/resources/prod/lib/reconnecting-websocket.min.js
new file mode 100644
index 0000000000000000000000000000000000000000..3015099ac17bb3ec057e545e21a4db524265d74f
--- /dev/null
+++ b/bigbluebutton-client/resources/prod/lib/reconnecting-websocket.min.js
@@ -0,0 +1 @@
+!function(a,b){"function"==typeof define&&define.amd?define([],b):"undefined"!=typeof module&&module.exports?module.exports=b():a.ReconnectingWebSocket=b()}(this,function(){function a(b,c,d){function l(a,b){var c=document.createEvent("CustomEvent");return c.initCustomEvent(a,!1,!1,b),c}var e={debug:!1,automaticOpen:!0,reconnectInterval:1e3,maxReconnectInterval:3e4,reconnectDecay:1.5,timeoutInterval:2e3};d||(d={});for(var f in e)this[f]="undefined"!=typeof d[f]?d[f]:e[f];this.url=b,this.reconnectAttempts=0,this.readyState=WebSocket.CONNECTING,this.protocol=null;var h,g=this,i=!1,j=!1,k=document.createElement("div");k.addEventListener("open",function(a){g.onopen(a)}),k.addEventListener("close",function(a){g.onclose(a)}),k.addEventListener("connecting",function(a){g.onconnecting(a)}),k.addEventListener("message",function(a){g.onmessage(a)}),k.addEventListener("error",function(a){g.onerror(a)}),this.addEventListener=k.addEventListener.bind(k),this.removeEventListener=k.removeEventListener.bind(k),this.dispatchEvent=k.dispatchEvent.bind(k),this.open=function(b){h=new WebSocket(g.url,c||[]),b||k.dispatchEvent(l("connecting")),(g.debug||a.debugAll)&&console.debug("ReconnectingWebSocket","attempt-connect",g.url);var d=h,e=setTimeout(function(){(g.debug||a.debugAll)&&console.debug("ReconnectingWebSocket","connection-timeout",g.url),j=!0,d.close(),j=!1},g.timeoutInterval);h.onopen=function(){clearTimeout(e),(g.debug||a.debugAll)&&console.debug("ReconnectingWebSocket","onopen",g.url),g.protocol=h.protocol,g.readyState=WebSocket.OPEN,g.reconnectAttempts=0;var d=l("open");d.isReconnect=b,b=!1,k.dispatchEvent(d)},h.onclose=function(c){if(clearTimeout(e),h=null,i)g.readyState=WebSocket.CLOSED,k.dispatchEvent(l("close"));else{g.readyState=WebSocket.CONNECTING;var d=l("connecting");d.code=c.code,d.reason=c.reason,d.wasClean=c.wasClean,k.dispatchEvent(d),b||j||((g.debug||a.debugAll)&&console.debug("ReconnectingWebSocket","onclose",g.url),k.dispatchEvent(l("close")));var e=g.reconnectInterval*Math.pow(g.reconnectDecay,g.reconnectAttempts);setTimeout(function(){g.reconnectAttempts++,g.open(!0)},e>g.maxReconnectInterval?g.maxReconnectInterval:e)}},h.onmessage=function(b){(g.debug||a.debugAll)&&console.debug("ReconnectingWebSocket","onmessage",g.url,b.data);var c=l("message");c.data=b.data,k.dispatchEvent(c)},h.onerror=function(b){(g.debug||a.debugAll)&&console.debug("ReconnectingWebSocket","onerror",g.url,b),k.dispatchEvent(l("error"))}},1==this.automaticOpen&&this.open(!1),this.send=function(b){if(h)return(g.debug||a.debugAll)&&console.debug("ReconnectingWebSocket","send",g.url,b),h.send(b);throw"INVALID_STATE_ERR : Pausing to reconnect websocket"},this.close=function(a,b){"undefined"==typeof a&&(a=1e3),i=!0,h&&h.close(a,b)},this.refresh=function(){h&&h.close()}}return a.prototype.onopen=function(){},a.prototype.onclose=function(){},a.prototype.onconnecting=function(){},a.prototype.onmessage=function(){},a.prototype.onerror=function(){},a.debugAll=!1,a.CONNECTING=WebSocket.CONNECTING,a.OPEN=WebSocket.OPEN,a.CLOSING=WebSocket.CLOSING,a.CLOSED=WebSocket.CLOSED,a});
diff --git a/bigbluebutton-html5/client/main.html b/bigbluebutton-html5/client/main.html
index 942e492c1a348abef542e318decf2231eba5e0c0..19441af93e6dc23e051acc57515bf13c9cea2fa8 100755
--- a/bigbluebutton-html5/client/main.html
+++ b/bigbluebutton-html5/client/main.html
@@ -51,13 +51,9 @@
<script src="/client/lib/jquery.json-2.4.min.js"></script>
<script src="/client/lib/verto-min.js"></script>
<script src="/client/lib/verto_extension.js"></script>
- <!--
- TODO: find a better way to include this
- Libs needed for kurento clientside communication.
- -->
- <script src="/html5client/js/bower_components/reconnectingWebsocket/reconnecting-websocket.js"></script>
- <script src="/html5client/js/bower_components/adapter.js/release/adapter.js"></script>
- <script src="/html5client/js/bower_components/kurento-utils/dist/kurento-utils.js"></script>
- <script src="/html5client/js/adjust-videos.js"></script>
+ <script src="/client/lib/reconnecting-websocket.min.js"></script>
+ <script src="/client/lib/kurento-utils.js"></script>
<script src="/client/lib/kurento-extension.js"></script>
+ <script src="/html5client/js/adapter.js"></script>
+ <script src="/html5client/js/adjust-videos.js"></script>
</body>
diff --git a/bigbluebutton-html5/public/js/adapter.js b/bigbluebutton-html5/public/js/adapter.js
new file mode 100644
index 0000000000000000000000000000000000000000..fc1d8c8ad9bf5df2141e314a6fcc09f01b627db4
--- /dev/null
+++ b/bigbluebutton-html5/public/js/adapter.js
@@ -0,0 +1,4450 @@
+(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.adapter = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(require,module,exports){
+/*
+ * Copyright (c) 2017 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+ /* eslint-env node */
+'use strict';
+
+var SDPUtils = require('sdp');
+
+function writeMediaSection(transceiver, caps, type, stream, dtlsRole) {
+ var sdp = SDPUtils.writeRtpDescription(transceiver.kind, caps);
+
+ // Map ICE parameters (ufrag, pwd) to SDP.
+ sdp += SDPUtils.writeIceParameters(
+ transceiver.iceGatherer.getLocalParameters());
+
+ // Map DTLS parameters to SDP.
+ sdp += SDPUtils.writeDtlsParameters(
+ transceiver.dtlsTransport.getLocalParameters(),
+ type === 'offer' ? 'actpass' : dtlsRole || 'active');
+
+ sdp += 'a=mid:' + transceiver.mid + '\r\n';
+
+ if (transceiver.direction) {
+ sdp += 'a=' + transceiver.direction + '\r\n';
+ } else if (transceiver.rtpSender && transceiver.rtpReceiver) {
+ sdp += 'a=sendrecv\r\n';
+ } else if (transceiver.rtpSender) {
+ sdp += 'a=sendonly\r\n';
+ } else if (transceiver.rtpReceiver) {
+ sdp += 'a=recvonly\r\n';
+ } else {
+ sdp += 'a=inactive\r\n';
+ }
+
+ if (transceiver.rtpSender) {
+ // spec.
+ var msid = 'msid:' + stream.id + ' ' +
+ transceiver.rtpSender.track.id + '\r\n';
+ sdp += 'a=' + msid;
+
+ // for Chrome.
+ sdp += 'a=ssrc:' + transceiver.sendEncodingParameters[0].ssrc +
+ ' ' + msid;
+ if (transceiver.sendEncodingParameters[0].rtx) {
+ sdp += 'a=ssrc:' + transceiver.sendEncodingParameters[0].rtx.ssrc +
+ ' ' + msid;
+ sdp += 'a=ssrc-group:FID ' +
+ transceiver.sendEncodingParameters[0].ssrc + ' ' +
+ transceiver.sendEncodingParameters[0].rtx.ssrc +
+ '\r\n';
+ }
+ }
+ // FIXME: this should be written by writeRtpDescription.
+ sdp += 'a=ssrc:' + transceiver.sendEncodingParameters[0].ssrc +
+ ' cname:' + SDPUtils.localCName + '\r\n';
+ if (transceiver.rtpSender && transceiver.sendEncodingParameters[0].rtx) {
+ sdp += 'a=ssrc:' + transceiver.sendEncodingParameters[0].rtx.ssrc +
+ ' cname:' + SDPUtils.localCName + '\r\n';
+ }
+ return sdp;
+}
+
+// Edge does not like
+// 1) stun: filtered after 14393 unless ?transport=udp is present
+// 2) turn: that does not have all of turn:host:port?transport=udp
+// 3) turn: with ipv6 addresses
+// 4) turn: occurring muliple times
+function filterIceServers(iceServers, edgeVersion) {
+ var hasTurn = false;
+ iceServers = JSON.parse(JSON.stringify(iceServers));
+ return iceServers.filter(function(server) {
+ if (server && (server.urls || server.url)) {
+ var urls = server.urls || server.url;
+ if (server.url && !server.urls) {
+ console.warn('RTCIceServer.url is deprecated! Use urls instead.');
+ }
+ var isString = typeof urls === 'string';
+ if (isString) {
+ urls = [urls];
+ }
+ urls = urls.filter(function(url) {
+ var validTurn = url.indexOf('turn:') === 0 &&
+ url.indexOf('transport=udp') !== -1 &&
+ url.indexOf('turn:[') === -1 &&
+ !hasTurn;
+
+ if (validTurn) {
+ hasTurn = true;
+ return true;
+ }
+ return url.indexOf('stun:') === 0 && edgeVersion >= 14393 &&
+ url.indexOf('?transport=udp') === -1;
+ });
+
+ delete server.url;
+ server.urls = isString ? urls[0] : urls;
+ return !!urls.length;
+ }
+ return false;
+ });
+}
+
+// Determines the intersection of local and remote capabilities.
+function getCommonCapabilities(localCapabilities, remoteCapabilities) {
+ var commonCapabilities = {
+ codecs: [],
+ headerExtensions: [],
+ fecMechanisms: []
+ };
+
+ var findCodecByPayloadType = function(pt, codecs) {
+ pt = parseInt(pt, 10);
+ for (var i = 0; i < codecs.length; i++) {
+ if (codecs[i].payloadType === pt ||
+ codecs[i].preferredPayloadType === pt) {
+ return codecs[i];
+ }
+ }
+ };
+
+ var rtxCapabilityMatches = function(lRtx, rRtx, lCodecs, rCodecs) {
+ var lCodec = findCodecByPayloadType(lRtx.parameters.apt, lCodecs);
+ var rCodec = findCodecByPayloadType(rRtx.parameters.apt, rCodecs);
+ return lCodec && rCodec &&
+ lCodec.name.toLowerCase() === rCodec.name.toLowerCase();
+ };
+
+ localCapabilities.codecs.forEach(function(lCodec) {
+ for (var i = 0; i < remoteCapabilities.codecs.length; i++) {
+ var rCodec = remoteCapabilities.codecs[i];
+ if (lCodec.name.toLowerCase() === rCodec.name.toLowerCase() &&
+ lCodec.clockRate === rCodec.clockRate) {
+ if (lCodec.name.toLowerCase() === 'rtx' &&
+ lCodec.parameters && rCodec.parameters.apt) {
+ // for RTX we need to find the local rtx that has a apt
+ // which points to the same local codec as the remote one.
+ if (!rtxCapabilityMatches(lCodec, rCodec,
+ localCapabilities.codecs, remoteCapabilities.codecs)) {
+ continue;
+ }
+ }
+ rCodec = JSON.parse(JSON.stringify(rCodec)); // deepcopy
+ // number of channels is the highest common number of channels
+ rCodec.numChannels = Math.min(lCodec.numChannels,
+ rCodec.numChannels);
+ // push rCodec so we reply with offerer payload type
+ commonCapabilities.codecs.push(rCodec);
+
+ // determine common feedback mechanisms
+ rCodec.rtcpFeedback = rCodec.rtcpFeedback.filter(function(fb) {
+ for (var j = 0; j < lCodec.rtcpFeedback.length; j++) {
+ if (lCodec.rtcpFeedback[j].type === fb.type &&
+ lCodec.rtcpFeedback[j].parameter === fb.parameter) {
+ return true;
+ }
+ }
+ return false;
+ });
+ // FIXME: also need to determine .parameters
+ // see https://github.com/openpeer/ortc/issues/569
+ break;
+ }
+ }
+ });
+
+ localCapabilities.headerExtensions.forEach(function(lHeaderExtension) {
+ for (var i = 0; i < remoteCapabilities.headerExtensions.length;
+ i++) {
+ var rHeaderExtension = remoteCapabilities.headerExtensions[i];
+ if (lHeaderExtension.uri === rHeaderExtension.uri) {
+ commonCapabilities.headerExtensions.push(rHeaderExtension);
+ break;
+ }
+ }
+ });
+
+ // FIXME: fecMechanisms
+ return commonCapabilities;
+}
+
+// is action=setLocalDescription with type allowed in signalingState
+function isActionAllowedInSignalingState(action, type, signalingState) {
+ return {
+ offer: {
+ setLocalDescription: ['stable', 'have-local-offer'],
+ setRemoteDescription: ['stable', 'have-remote-offer']
+ },
+ answer: {
+ setLocalDescription: ['have-remote-offer', 'have-local-pranswer'],
+ setRemoteDescription: ['have-local-offer', 'have-remote-pranswer']
+ }
+ }[type][action].indexOf(signalingState) !== -1;
+}
+
+function maybeAddCandidate(iceTransport, candidate) {
+ // Edge's internal representation adds some fields therefore
+ // not all fieldѕ are taken into account.
+ var alreadyAdded = iceTransport.getRemoteCandidates()
+ .find(function(remoteCandidate) {
+ return candidate.foundation === remoteCandidate.foundation &&
+ candidate.ip === remoteCandidate.ip &&
+ candidate.port === remoteCandidate.port &&
+ candidate.priority === remoteCandidate.priority &&
+ candidate.protocol === remoteCandidate.protocol &&
+ candidate.type === remoteCandidate.type;
+ });
+ if (!alreadyAdded) {
+ iceTransport.addRemoteCandidate(candidate);
+ }
+ return !alreadyAdded;
+}
+
+module.exports = function(window, edgeVersion) {
+ var RTCPeerConnection = function(config) {
+ var self = this;
+
+ var _eventTarget = document.createDocumentFragment();
+ ['addEventListener', 'removeEventListener', 'dispatchEvent']
+ .forEach(function(method) {
+ self[method] = _eventTarget[method].bind(_eventTarget);
+ });
+
+ this.onicecandidate = null;
+ this.onaddstream = null;
+ this.ontrack = null;
+ this.onremovestream = null;
+ this.onsignalingstatechange = null;
+ this.oniceconnectionstatechange = null;
+ this.onicegatheringstatechange = null;
+ this.onnegotiationneeded = null;
+ this.ondatachannel = null;
+ this.canTrickleIceCandidates = null;
+
+ this.needNegotiation = false;
+
+ this.localStreams = [];
+ this.remoteStreams = [];
+
+ this.localDescription = null;
+ this.remoteDescription = null;
+
+ this.signalingState = 'stable';
+ this.iceConnectionState = 'new';
+ this.iceGatheringState = 'new';
+
+ config = JSON.parse(JSON.stringify(config || {}));
+
+ this.usingBundle = config.bundlePolicy === 'max-bundle';
+ if (config.rtcpMuxPolicy === 'negotiate') {
+ var e = new Error('rtcpMuxPolicy \'negotiate\' is not supported');
+ e.name = 'NotSupportedError';
+ throw(e);
+ } else if (!config.rtcpMuxPolicy) {
+ config.rtcpMuxPolicy = 'require';
+ }
+
+ switch (config.iceTransportPolicy) {
+ case 'all':
+ case 'relay':
+ break;
+ default:
+ config.iceTransportPolicy = 'all';
+ break;
+ }
+
+ switch (config.bundlePolicy) {
+ case 'balanced':
+ case 'max-compat':
+ case 'max-bundle':
+ break;
+ default:
+ config.bundlePolicy = 'balanced';
+ break;
+ }
+
+ config.iceServers = filterIceServers(config.iceServers || [], edgeVersion);
+
+ this._iceGatherers = [];
+ if (config.iceCandidatePoolSize) {
+ for (var i = config.iceCandidatePoolSize; i > 0; i--) {
+ this._iceGatherers = new window.RTCIceGatherer({
+ iceServers: config.iceServers,
+ gatherPolicy: config.iceTransportPolicy
+ });
+ }
+ } else {
+ config.iceCandidatePoolSize = 0;
+ }
+
+ this._config = config;
+
+ // per-track iceGathers, iceTransports, dtlsTransports, rtpSenders, ...
+ // everything that is needed to describe a SDP m-line.
+ this.transceivers = [];
+
+ this._sdpSessionId = SDPUtils.generateSessionId();
+ this._sdpSessionVersion = 0;
+
+ this._dtlsRole = undefined; // role for a=setup to use in answers.
+ };
+
+ RTCPeerConnection.prototype._emitGatheringStateChange = function() {
+ var event = new Event('icegatheringstatechange');
+ this.dispatchEvent(event);
+ if (typeof this.onicegatheringstatechange === 'function') {
+ this.onicegatheringstatechange(event);
+ }
+ };
+
+ RTCPeerConnection.prototype.getConfiguration = function() {
+ return this._config;
+ };
+
+ RTCPeerConnection.prototype.getLocalStreams = function() {
+ return this.localStreams;
+ };
+
+ RTCPeerConnection.prototype.getRemoteStreams = function() {
+ return this.remoteStreams;
+ };
+
+ // internal helper to create a transceiver object.
+ // (whih is not yet the same as the WebRTC 1.0 transceiver)
+ RTCPeerConnection.prototype._createTransceiver = function(kind) {
+ var hasBundleTransport = this.transceivers.length > 0;
+ var transceiver = {
+ track: null,
+ iceGatherer: null,
+ iceTransport: null,
+ dtlsTransport: null,
+ localCapabilities: null,
+ remoteCapabilities: null,
+ rtpSender: null,
+ rtpReceiver: null,
+ kind: kind,
+ mid: null,
+ sendEncodingParameters: null,
+ recvEncodingParameters: null,
+ stream: null,
+ wantReceive: true
+ };
+ if (this.usingBundle && hasBundleTransport) {
+ transceiver.iceTransport = this.transceivers[0].iceTransport;
+ transceiver.dtlsTransport = this.transceivers[0].dtlsTransport;
+ } else {
+ var transports = this._createIceAndDtlsTransports();
+ transceiver.iceTransport = transports.iceTransport;
+ transceiver.dtlsTransport = transports.dtlsTransport;
+ }
+ this.transceivers.push(transceiver);
+ return transceiver;
+ };
+
+ RTCPeerConnection.prototype.addTrack = function(track, stream) {
+ var transceiver;
+ for (var i = 0; i < this.transceivers.length; i++) {
+ if (!this.transceivers[i].track &&
+ this.transceivers[i].kind === track.kind) {
+ transceiver = this.transceivers[i];
+ }
+ }
+ if (!transceiver) {
+ transceiver = this._createTransceiver(track.kind);
+ }
+
+ this._maybeFireNegotiationNeeded();
+
+ if (this.localStreams.indexOf(stream) === -1) {
+ this.localStreams.push(stream);
+ }
+
+ transceiver.track = track;
+ transceiver.stream = stream;
+ transceiver.rtpSender = new window.RTCRtpSender(track,
+ transceiver.dtlsTransport);
+ return transceiver.rtpSender;
+ };
+
+ RTCPeerConnection.prototype.addStream = function(stream) {
+ var self = this;
+ if (edgeVersion >= 15025) {
+ stream.getTracks().forEach(function(track) {
+ self.addTrack(track, stream);
+ });
+ } else {
+ // Clone is necessary for local demos mostly, attaching directly
+ // to two different senders does not work (build 10547).
+ // Fixed in 15025 (or earlier)
+ var clonedStream = stream.clone();
+ stream.getTracks().forEach(function(track, idx) {
+ var clonedTrack = clonedStream.getTracks()[idx];
+ track.addEventListener('enabled', function(event) {
+ clonedTrack.enabled = event.enabled;
+ });
+ });
+ clonedStream.getTracks().forEach(function(track) {
+ self.addTrack(track, clonedStream);
+ });
+ }
+ };
+
+ RTCPeerConnection.prototype.removeStream = function(stream) {
+ var idx = this.localStreams.indexOf(stream);
+ if (idx > -1) {
+ this.localStreams.splice(idx, 1);
+ this._maybeFireNegotiationNeeded();
+ }
+ };
+
+ RTCPeerConnection.prototype.getSenders = function() {
+ return this.transceivers.filter(function(transceiver) {
+ return !!transceiver.rtpSender;
+ })
+ .map(function(transceiver) {
+ return transceiver.rtpSender;
+ });
+ };
+
+ RTCPeerConnection.prototype.getReceivers = function() {
+ return this.transceivers.filter(function(transceiver) {
+ return !!transceiver.rtpReceiver;
+ })
+ .map(function(transceiver) {
+ return transceiver.rtpReceiver;
+ });
+ };
+
+
+ RTCPeerConnection.prototype._createIceGatherer = function(sdpMLineIndex,
+ usingBundle) {
+ var self = this;
+ if (usingBundle && sdpMLineIndex > 0) {
+ return this.transceivers[0].iceGatherer;
+ } else if (this._iceGatherers.length) {
+ return this._iceGatherers.shift();
+ }
+ var iceGatherer = new window.RTCIceGatherer({
+ iceServers: this._config.iceServers,
+ gatherPolicy: this._config.iceTransportPolicy
+ });
+ Object.defineProperty(iceGatherer, 'state',
+ {value: 'new', writable: true}
+ );
+
+ this.transceivers[sdpMLineIndex].candidates = [];
+ this.transceivers[sdpMLineIndex].bufferCandidates = function(event) {
+ var end = !event.candidate || Object.keys(event.candidate).length === 0;
+ // polyfill since RTCIceGatherer.state is not implemented in
+ // Edge 10547 yet.
+ iceGatherer.state = end ? 'completed' : 'gathering';
+ if (self.transceivers[sdpMLineIndex].candidates !== null) {
+ self.transceivers[sdpMLineIndex].candidates.push(event.candidate);
+ }
+ };
+ iceGatherer.addEventListener('localcandidate',
+ this.transceivers[sdpMLineIndex].bufferCandidates);
+ return iceGatherer;
+ };
+
+ // start gathering from an RTCIceGatherer.
+ RTCPeerConnection.prototype._gather = function(mid, sdpMLineIndex) {
+ var self = this;
+ var iceGatherer = this.transceivers[sdpMLineIndex].iceGatherer;
+ if (iceGatherer.onlocalcandidate) {
+ return;
+ }
+ var candidates = this.transceivers[sdpMLineIndex].candidates;
+ this.transceivers[sdpMLineIndex].candidates = null;
+ iceGatherer.removeEventListener('localcandidate',
+ this.transceivers[sdpMLineIndex].bufferCandidates);
+ iceGatherer.onlocalcandidate = function(evt) {
+ if (self.usingBundle && sdpMLineIndex > 0) {
+ // if we know that we use bundle we can drop candidates with
+ // Ñ•dpMLineIndex > 0. If we don't do this then our state gets
+ // confused since we dispose the extra ice gatherer.
+ return;
+ }
+ var event = new Event('icecandidate');
+ event.candidate = {sdpMid: mid, sdpMLineIndex: sdpMLineIndex};
+
+ var cand = evt.candidate;
+ // Edge emits an empty object for RTCIceCandidateComplete‥
+ var end = !cand || Object.keys(cand).length === 0;
+ if (end) {
+ // polyfill since RTCIceGatherer.state is not implemented in
+ // Edge 10547 yet.
+ if (iceGatherer.state === 'new' || iceGatherer.state === 'gathering') {
+ iceGatherer.state = 'completed';
+ }
+ } else {
+ if (iceGatherer.state === 'new') {
+ iceGatherer.state = 'gathering';
+ }
+ // RTCIceCandidate doesn't have a component, needs to be added
+ cand.component = 1;
+ event.candidate.candidate = SDPUtils.writeCandidate(cand);
+ }
+
+ // update local description.
+ var sections = SDPUtils.splitSections(self.localDescription.sdp);
+ if (!end) {
+ sections[event.candidate.sdpMLineIndex + 1] +=
+ 'a=' + event.candidate.candidate + '\r\n';
+ } else {
+ sections[event.candidate.sdpMLineIndex + 1] +=
+ 'a=end-of-candidates\r\n';
+ }
+ self.localDescription.sdp = sections.join('');
+ var complete = self.transceivers.every(function(transceiver) {
+ return transceiver.iceGatherer &&
+ transceiver.iceGatherer.state === 'completed';
+ });
+
+ if (self.iceGatheringState !== 'gathering') {
+ self.iceGatheringState = 'gathering';
+ self._emitGatheringStateChange();
+ }
+
+ // Emit candidate. Also emit null candidate when all gatherers are
+ // complete.
+ if (!end) {
+ self.dispatchEvent(event);
+ if (typeof self.onicecandidate === 'function') {
+ self.onicecandidate(event);
+ }
+ }
+ if (complete) {
+ self.dispatchEvent(new Event('icecandidate'));
+ if (typeof self.onicecandidate === 'function') {
+ self.onicecandidate(new Event('icecandidate'));
+ }
+ self.iceGatheringState = 'complete';
+ self._emitGatheringStateChange();
+ }
+ };
+
+ // emit already gathered candidates.
+ window.setTimeout(function() {
+ candidates.forEach(function(candidate) {
+ var e = new Event('RTCIceGatherEvent');
+ e.candidate = candidate;
+ iceGatherer.onlocalcandidate(e);
+ });
+ }, 0);
+ };
+
+ // Create ICE transport and DTLS transport.
+ RTCPeerConnection.prototype._createIceAndDtlsTransports = function() {
+ var self = this;
+ var iceTransport = new window.RTCIceTransport(null);
+ iceTransport.onicestatechange = function() {
+ self._updateConnectionState();
+ };
+
+ var dtlsTransport = new window.RTCDtlsTransport(iceTransport);
+ dtlsTransport.ondtlsstatechange = function() {
+ self._updateConnectionState();
+ };
+ dtlsTransport.onerror = function() {
+ // onerror does not set state to failed by itself.
+ Object.defineProperty(dtlsTransport, 'state',
+ {value: 'failed', writable: true});
+ self._updateConnectionState();
+ };
+
+ return {
+ iceTransport: iceTransport,
+ dtlsTransport: dtlsTransport
+ };
+ };
+
+ // Destroy ICE gatherer, ICE transport and DTLS transport.
+ // Without triggering the callbacks.
+ RTCPeerConnection.prototype._disposeIceAndDtlsTransports = function(
+ sdpMLineIndex) {
+ var iceGatherer = this.transceivers[sdpMLineIndex].iceGatherer;
+ if (iceGatherer) {
+ delete iceGatherer.onlocalcandidate;
+ delete this.transceivers[sdpMLineIndex].iceGatherer;
+ }
+ var iceTransport = this.transceivers[sdpMLineIndex].iceTransport;
+ if (iceTransport) {
+ delete iceTransport.onicestatechange;
+ delete this.transceivers[sdpMLineIndex].iceTransport;
+ }
+ var dtlsTransport = this.transceivers[sdpMLineIndex].dtlsTransport;
+ if (dtlsTransport) {
+ delete dtlsTransport.ondtlsstatechange;
+ delete dtlsTransport.onerror;
+ delete this.transceivers[sdpMLineIndex].dtlsTransport;
+ }
+ };
+
+ // Start the RTP Sender and Receiver for a transceiver.
+ RTCPeerConnection.prototype._transceive = function(transceiver,
+ send, recv) {
+ var params = getCommonCapabilities(transceiver.localCapabilities,
+ transceiver.remoteCapabilities);
+ if (send && transceiver.rtpSender) {
+ params.encodings = transceiver.sendEncodingParameters;
+ params.rtcp = {
+ cname: SDPUtils.localCName,
+ compound: transceiver.rtcpParameters.compound
+ };
+ if (transceiver.recvEncodingParameters.length) {
+ params.rtcp.ssrc = transceiver.recvEncodingParameters[0].ssrc;
+ }
+ transceiver.rtpSender.send(params);
+ }
+ if (recv && transceiver.rtpReceiver && params.codecs.length > 0) {
+ // remove RTX field in Edge 14942
+ if (transceiver.kind === 'video'
+ && transceiver.recvEncodingParameters
+ && edgeVersion < 15019) {
+ transceiver.recvEncodingParameters.forEach(function(p) {
+ delete p.rtx;
+ });
+ }
+ params.encodings = transceiver.recvEncodingParameters;
+ params.rtcp = {
+ cname: transceiver.rtcpParameters.cname,
+ compound: transceiver.rtcpParameters.compound
+ };
+ if (transceiver.sendEncodingParameters.length) {
+ params.rtcp.ssrc = transceiver.sendEncodingParameters[0].ssrc;
+ }
+ transceiver.rtpReceiver.receive(params);
+ }
+ };
+
+ RTCPeerConnection.prototype.setLocalDescription = function(description) {
+ var self = this;
+ var args = arguments;
+
+ if (!isActionAllowedInSignalingState('setLocalDescription',
+ description.type, this.signalingState)) {
+ return new Promise(function(resolve, reject) {
+ var e = new Error('Can not set local ' + description.type +
+ ' in state ' + self.signalingState);
+ e.name = 'InvalidStateError';
+ if (args.length > 2 && typeof args[2] === 'function') {
+ args[2].apply(null, [e]);
+ }
+ reject(e);
+ });
+ }
+
+ var sections;
+ var sessionpart;
+ if (description.type === 'offer') {
+ // VERY limited support for SDP munging. Limited to:
+ // * changing the order of codecs
+ sections = SDPUtils.splitSections(description.sdp);
+ sessionpart = sections.shift();
+ sections.forEach(function(mediaSection, sdpMLineIndex) {
+ var caps = SDPUtils.parseRtpParameters(mediaSection);
+ self.transceivers[sdpMLineIndex].localCapabilities = caps;
+ });
+
+ this.transceivers.forEach(function(transceiver, sdpMLineIndex) {
+ self._gather(transceiver.mid, sdpMLineIndex);
+ });
+ } else if (description.type === 'answer') {
+ sections = SDPUtils.splitSections(self.remoteDescription.sdp);
+ sessionpart = sections.shift();
+ var isIceLite = SDPUtils.matchPrefix(sessionpart,
+ 'a=ice-lite').length > 0;
+ sections.forEach(function(mediaSection, sdpMLineIndex) {
+ var transceiver = self.transceivers[sdpMLineIndex];
+ var iceGatherer = transceiver.iceGatherer;
+ var iceTransport = transceiver.iceTransport;
+ var dtlsTransport = transceiver.dtlsTransport;
+ var localCapabilities = transceiver.localCapabilities;
+ var remoteCapabilities = transceiver.remoteCapabilities;
+
+ // treat bundle-only as not-rejected.
+ var rejected = SDPUtils.isRejected(mediaSection) &&
+ !SDPUtils.matchPrefix(mediaSection, 'a=bundle-only').length === 1;
+
+ if (!rejected && !transceiver.isDatachannel) {
+ var remoteIceParameters = SDPUtils.getIceParameters(
+ mediaSection, sessionpart);
+ var remoteDtlsParameters = SDPUtils.getDtlsParameters(
+ mediaSection, sessionpart);
+ if (isIceLite) {
+ remoteDtlsParameters.role = 'server';
+ }
+
+ if (!self.usingBundle || sdpMLineIndex === 0) {
+ self._gather(transceiver.mid, sdpMLineIndex);
+ if (iceTransport.state === 'new') {
+ iceTransport.start(iceGatherer, remoteIceParameters,
+ isIceLite ? 'controlling' : 'controlled');
+ }
+ if (dtlsTransport.state === 'new') {
+ dtlsTransport.start(remoteDtlsParameters);
+ }
+ }
+
+ // Calculate intersection of capabilities.
+ var params = getCommonCapabilities(localCapabilities,
+ remoteCapabilities);
+
+ // Start the RTCRtpSender. The RTCRtpReceiver for this
+ // transceiver has already been started in setRemoteDescription.
+ self._transceive(transceiver,
+ params.codecs.length > 0,
+ false);
+ }
+ });
+ }
+
+ this.localDescription = {
+ type: description.type,
+ sdp: description.sdp
+ };
+ switch (description.type) {
+ case 'offer':
+ this._updateSignalingState('have-local-offer');
+ break;
+ case 'answer':
+ this._updateSignalingState('stable');
+ break;
+ default:
+ throw new TypeError('unsupported type "' + description.type +
+ '"');
+ }
+
+ // If a success callback was provided, emit ICE candidates after it
+ // has been executed. Otherwise, emit callback after the Promise is
+ // resolved.
+ var cb = arguments.length > 1 && typeof arguments[1] === 'function' &&
+ arguments[1];
+ return new Promise(function(resolve) {
+ if (cb) {
+ cb.apply(null);
+ }
+ resolve();
+ });
+ };
+
+ RTCPeerConnection.prototype.setRemoteDescription = function(description) {
+ var self = this;
+ var args = arguments;
+
+ if (!isActionAllowedInSignalingState('setRemoteDescription',
+ description.type, this.signalingState)) {
+ return new Promise(function(resolve, reject) {
+ var e = new Error('Can not set remote ' + description.type +
+ ' in state ' + self.signalingState);
+ e.name = 'InvalidStateError';
+ if (args.length > 2 && typeof args[2] === 'function') {
+ args[2].apply(null, [e]);
+ }
+ reject(e);
+ });
+ }
+
+ var streams = {};
+ this.remoteStreams.forEach(function(stream) {
+ streams[stream.id] = stream;
+ });
+ var receiverList = [];
+ var sections = SDPUtils.splitSections(description.sdp);
+ var sessionpart = sections.shift();
+ var isIceLite = SDPUtils.matchPrefix(sessionpart,
+ 'a=ice-lite').length > 0;
+ var usingBundle = SDPUtils.matchPrefix(sessionpart,
+ 'a=group:BUNDLE ').length > 0;
+ this.usingBundle = usingBundle;
+ var iceOptions = SDPUtils.matchPrefix(sessionpart,
+ 'a=ice-options:')[0];
+ if (iceOptions) {
+ this.canTrickleIceCandidates = iceOptions.substr(14).split(' ')
+ .indexOf('trickle') >= 0;
+ } else {
+ this.canTrickleIceCandidates = false;
+ }
+
+ sections.forEach(function(mediaSection, sdpMLineIndex) {
+ var lines = SDPUtils.splitLines(mediaSection);
+ var kind = SDPUtils.getKind(mediaSection);
+ // treat bundle-only as not-rejected.
+ var rejected = SDPUtils.isRejected(mediaSection) &&
+ !SDPUtils.matchPrefix(mediaSection, 'a=bundle-only').length === 1;
+ var protocol = lines[0].substr(2).split(' ')[2];
+
+ var direction = SDPUtils.getDirection(mediaSection, sessionpart);
+ var remoteMsid = SDPUtils.parseMsid(mediaSection);
+
+ var mid = SDPUtils.getMid(mediaSection) || SDPUtils.generateIdentifier();
+
+ // Reject datachannels which are not implemented yet.
+ if (kind === 'application' && protocol === 'DTLS/SCTP') {
+ self.transceivers[sdpMLineIndex] = {
+ mid: mid,
+ isDatachannel: true
+ };
+ return;
+ }
+
+ var transceiver;
+ var iceGatherer;
+ var iceTransport;
+ var dtlsTransport;
+ var rtpReceiver;
+ var sendEncodingParameters;
+ var recvEncodingParameters;
+ var localCapabilities;
+
+ var track;
+ // FIXME: ensure the mediaSection has rtcp-mux set.
+ var remoteCapabilities = SDPUtils.parseRtpParameters(mediaSection);
+ var remoteIceParameters;
+ var remoteDtlsParameters;
+ if (!rejected) {
+ remoteIceParameters = SDPUtils.getIceParameters(mediaSection,
+ sessionpart);
+ remoteDtlsParameters = SDPUtils.getDtlsParameters(mediaSection,
+ sessionpart);
+ remoteDtlsParameters.role = 'client';
+ }
+ recvEncodingParameters =
+ SDPUtils.parseRtpEncodingParameters(mediaSection);
+
+ var rtcpParameters = SDPUtils.parseRtcpParameters(mediaSection);
+
+ var isComplete = SDPUtils.matchPrefix(mediaSection,
+ 'a=end-of-candidates', sessionpart).length > 0;
+ var cands = SDPUtils.matchPrefix(mediaSection, 'a=candidate:')
+ .map(function(cand) {
+ return SDPUtils.parseCandidate(cand);
+ })
+ .filter(function(cand) {
+ return cand.component === 1;
+ });
+
+ // Check if we can use BUNDLE and dispose transports.
+ if ((description.type === 'offer' || description.type === 'answer') &&
+ !rejected && usingBundle && sdpMLineIndex > 0 &&
+ self.transceivers[sdpMLineIndex]) {
+ self._disposeIceAndDtlsTransports(sdpMLineIndex);
+ self.transceivers[sdpMLineIndex].iceGatherer =
+ self.transceivers[0].iceGatherer;
+ self.transceivers[sdpMLineIndex].iceTransport =
+ self.transceivers[0].iceTransport;
+ self.transceivers[sdpMLineIndex].dtlsTransport =
+ self.transceivers[0].dtlsTransport;
+ if (self.transceivers[sdpMLineIndex].rtpSender) {
+ self.transceivers[sdpMLineIndex].rtpSender.setTransport(
+ self.transceivers[0].dtlsTransport);
+ }
+ if (self.transceivers[sdpMLineIndex].rtpReceiver) {
+ self.transceivers[sdpMLineIndex].rtpReceiver.setTransport(
+ self.transceivers[0].dtlsTransport);
+ }
+ }
+ if (description.type === 'offer' && !rejected) {
+ transceiver = self.transceivers[sdpMLineIndex] ||
+ self._createTransceiver(kind);
+ transceiver.mid = mid;
+
+ if (!transceiver.iceGatherer) {
+ transceiver.iceGatherer = self._createIceGatherer(sdpMLineIndex,
+ usingBundle);
+ }
+
+ if (cands.length && transceiver.iceTransport.state === 'new') {
+ if (isComplete && (!usingBundle || sdpMLineIndex === 0)) {
+ transceiver.iceTransport.setRemoteCandidates(cands);
+ } else {
+ cands.forEach(function(candidate) {
+ maybeAddCandidate(transceiver.iceTransport, candidate);
+ });
+ }
+ }
+
+ localCapabilities = window.RTCRtpReceiver.getCapabilities(kind);
+
+ // filter RTX until additional stuff needed for RTX is implemented
+ // in adapter.js
+ if (edgeVersion < 15019) {
+ localCapabilities.codecs = localCapabilities.codecs.filter(
+ function(codec) {
+ return codec.name !== 'rtx';
+ });
+ }
+
+ sendEncodingParameters = transceiver.sendEncodingParameters || [{
+ ssrc: (2 * sdpMLineIndex + 2) * 1001
+ }];
+
+ var isNewTrack = false;
+ if (direction === 'sendrecv' || direction === 'sendonly') {
+ isNewTrack = !transceiver.rtpReceiver;
+ rtpReceiver = transceiver.rtpReceiver ||
+ new window.RTCRtpReceiver(transceiver.dtlsTransport, kind);
+
+ if (isNewTrack) {
+ var stream;
+ track = rtpReceiver.track;
+ // FIXME: does not work with Plan B.
+ if (remoteMsid) {
+ if (!streams[remoteMsid.stream]) {
+ streams[remoteMsid.stream] = new window.MediaStream();
+ Object.defineProperty(streams[remoteMsid.stream], 'id', {
+ get: function() {
+ return remoteMsid.stream;
+ }
+ });
+ }
+ Object.defineProperty(track, 'id', {
+ get: function() {
+ return remoteMsid.track;
+ }
+ });
+ stream = streams[remoteMsid.stream];
+ } else {
+ if (!streams.default) {
+ streams.default = new window.MediaStream();
+ }
+ stream = streams.default;
+ }
+ stream.addTrack(track);
+ receiverList.push([track, rtpReceiver, stream]);
+ }
+ }
+
+ transceiver.localCapabilities = localCapabilities;
+ transceiver.remoteCapabilities = remoteCapabilities;
+ transceiver.rtpReceiver = rtpReceiver;
+ transceiver.rtcpParameters = rtcpParameters;
+ transceiver.sendEncodingParameters = sendEncodingParameters;
+ transceiver.recvEncodingParameters = recvEncodingParameters;
+
+ // Start the RTCRtpReceiver now. The RTPSender is started in
+ // setLocalDescription.
+ self._transceive(self.transceivers[sdpMLineIndex],
+ false,
+ isNewTrack);
+ } else if (description.type === 'answer' && !rejected) {
+ transceiver = self.transceivers[sdpMLineIndex];
+ iceGatherer = transceiver.iceGatherer;
+ iceTransport = transceiver.iceTransport;
+ dtlsTransport = transceiver.dtlsTransport;
+ rtpReceiver = transceiver.rtpReceiver;
+ sendEncodingParameters = transceiver.sendEncodingParameters;
+ localCapabilities = transceiver.localCapabilities;
+
+ self.transceivers[sdpMLineIndex].recvEncodingParameters =
+ recvEncodingParameters;
+ self.transceivers[sdpMLineIndex].remoteCapabilities =
+ remoteCapabilities;
+ self.transceivers[sdpMLineIndex].rtcpParameters = rtcpParameters;
+
+ if (cands.length && iceTransport.state === 'new') {
+ if ((isIceLite || isComplete) &&
+ (!usingBundle || sdpMLineIndex === 0)) {
+ iceTransport.setRemoteCandidates(cands);
+ } else {
+ cands.forEach(function(candidate) {
+ maybeAddCandidate(transceiver.iceTransport, candidate);
+ });
+ }
+ }
+
+ if (!usingBundle || sdpMLineIndex === 0) {
+ if (iceTransport.state === 'new') {
+ iceTransport.start(iceGatherer, remoteIceParameters,
+ 'controlling');
+ }
+ if (dtlsTransport.state === 'new') {
+ dtlsTransport.start(remoteDtlsParameters);
+ }
+ }
+
+ self._transceive(transceiver,
+ direction === 'sendrecv' || direction === 'recvonly',
+ direction === 'sendrecv' || direction === 'sendonly');
+
+ if (rtpReceiver &&
+ (direction === 'sendrecv' || direction === 'sendonly')) {
+ track = rtpReceiver.track;
+ if (remoteMsid) {
+ if (!streams[remoteMsid.stream]) {
+ streams[remoteMsid.stream] = new window.MediaStream();
+ }
+ streams[remoteMsid.stream].addTrack(track);
+ receiverList.push([track, rtpReceiver, streams[remoteMsid.stream]]);
+ } else {
+ if (!streams.default) {
+ streams.default = new window.MediaStream();
+ }
+ streams.default.addTrack(track);
+ receiverList.push([track, rtpReceiver, streams.default]);
+ }
+ } else {
+ // FIXME: actually the receiver should be created later.
+ delete transceiver.rtpReceiver;
+ }
+ }
+ });
+
+ if (this._dtlsRole === undefined) {
+ this._dtlsRole = description.type === 'offer' ? 'active' : 'passive';
+ }
+
+ this.remoteDescription = {
+ type: description.type,
+ sdp: description.sdp
+ };
+ switch (description.type) {
+ case 'offer':
+ this._updateSignalingState('have-remote-offer');
+ break;
+ case 'answer':
+ this._updateSignalingState('stable');
+ break;
+ default:
+ throw new TypeError('unsupported type "' + description.type +
+ '"');
+ }
+ Object.keys(streams).forEach(function(sid) {
+ var stream = streams[sid];
+ if (stream.getTracks().length) {
+ if (self.remoteStreams.indexOf(stream) === -1) {
+ self.remoteStreams.push(stream);
+ var event = new Event('addstream');
+ event.stream = stream;
+ window.setTimeout(function() {
+ self.dispatchEvent(event);
+ if (typeof self.onaddstream === 'function') {
+ self.onaddstream(event);
+ }
+ });
+ }
+
+ receiverList.forEach(function(item) {
+ var track = item[0];
+ var receiver = item[1];
+ if (stream.id !== item[2].id) {
+ return;
+ }
+ var trackEvent = new Event('track');
+ trackEvent.track = track;
+ trackEvent.receiver = receiver;
+ trackEvent.transceiver = {receiver: receiver};
+ trackEvent.streams = [stream];
+ window.setTimeout(function() {
+ self.dispatchEvent(trackEvent);
+ if (typeof self.ontrack === 'function') {
+ self.ontrack(trackEvent);
+ }
+ });
+ });
+ }
+ });
+
+ // check whether addIceCandidate({}) was called within four seconds after
+ // setRemoteDescription.
+ window.setTimeout(function() {
+ if (!(self && self.transceivers)) {
+ return;
+ }
+ self.transceivers.forEach(function(transceiver) {
+ if (transceiver.iceTransport &&
+ transceiver.iceTransport.state === 'new' &&
+ transceiver.iceTransport.getRemoteCandidates().length > 0) {
+ console.warn('Timeout for addRemoteCandidate. Consider sending ' +
+ 'an end-of-candidates notification');
+ transceiver.iceTransport.addRemoteCandidate({});
+ }
+ });
+ }, 4000);
+
+ return new Promise(function(resolve) {
+ if (args.length > 1 && typeof args[1] === 'function') {
+ args[1].apply(null);
+ }
+ resolve();
+ });
+ };
+
+ RTCPeerConnection.prototype.close = function() {
+ this.transceivers.forEach(function(transceiver) {
+ /* not yet
+ if (transceiver.iceGatherer) {
+ transceiver.iceGatherer.close();
+ }
+ */
+ if (transceiver.iceTransport) {
+ transceiver.iceTransport.stop();
+ }
+ if (transceiver.dtlsTransport) {
+ transceiver.dtlsTransport.stop();
+ }
+ if (transceiver.rtpSender) {
+ transceiver.rtpSender.stop();
+ }
+ if (transceiver.rtpReceiver) {
+ transceiver.rtpReceiver.stop();
+ }
+ });
+ // FIXME: clean up tracks, local streams, remote streams, etc
+ this._updateSignalingState('closed');
+ };
+
+ // Update the signaling state.
+ RTCPeerConnection.prototype._updateSignalingState = function(newState) {
+ this.signalingState = newState;
+ var event = new Event('signalingstatechange');
+ this.dispatchEvent(event);
+ if (typeof this.onsignalingstatechange === 'function') {
+ this.onsignalingstatechange(event);
+ }
+ };
+
+ // Determine whether to fire the negotiationneeded event.
+ RTCPeerConnection.prototype._maybeFireNegotiationNeeded = function() {
+ var self = this;
+ if (this.signalingState !== 'stable' || this.needNegotiation === true) {
+ return;
+ }
+ this.needNegotiation = true;
+ window.setTimeout(function() {
+ if (self.needNegotiation === false) {
+ return;
+ }
+ self.needNegotiation = false;
+ var event = new Event('negotiationneeded');
+ self.dispatchEvent(event);
+ if (typeof self.onnegotiationneeded === 'function') {
+ self.onnegotiationneeded(event);
+ }
+ }, 0);
+ };
+
+ // Update the connection state.
+ RTCPeerConnection.prototype._updateConnectionState = function() {
+ var newState;
+ var states = {
+ 'new': 0,
+ closed: 0,
+ connecting: 0,
+ checking: 0,
+ connected: 0,
+ completed: 0,
+ disconnected: 0,
+ failed: 0
+ };
+ this.transceivers.forEach(function(transceiver) {
+ states[transceiver.iceTransport.state]++;
+ states[transceiver.dtlsTransport.state]++;
+ });
+ // ICETransport.completed and connected are the same for this purpose.
+ states.connected += states.completed;
+
+ newState = 'new';
+ if (states.failed > 0) {
+ newState = 'failed';
+ } else if (states.connecting > 0 || states.checking > 0) {
+ newState = 'connecting';
+ } else if (states.disconnected > 0) {
+ newState = 'disconnected';
+ } else if (states.new > 0) {
+ newState = 'new';
+ } else if (states.connected > 0 || states.completed > 0) {
+ newState = 'connected';
+ }
+
+ if (newState !== this.iceConnectionState) {
+ this.iceConnectionState = newState;
+ var event = new Event('iceconnectionstatechange');
+ this.dispatchEvent(event);
+ if (typeof this.oniceconnectionstatechange === 'function') {
+ this.oniceconnectionstatechange(event);
+ }
+ }
+ };
+
+ RTCPeerConnection.prototype.createOffer = function() {
+ var self = this;
+ var args = arguments;
+
+ var offerOptions;
+ if (arguments.length === 1 && typeof arguments[0] !== 'function') {
+ offerOptions = arguments[0];
+ } else if (arguments.length === 3) {
+ offerOptions = arguments[2];
+ }
+
+ var numAudioTracks = this.transceivers.filter(function(t) {
+ return t.kind === 'audio';
+ }).length;
+ var numVideoTracks = this.transceivers.filter(function(t) {
+ return t.kind === 'video';
+ }).length;
+
+ // Determine number of audio and video tracks we need to send/recv.
+ if (offerOptions) {
+ // Reject Chrome legacy constraints.
+ if (offerOptions.mandatory || offerOptions.optional) {
+ throw new TypeError(
+ 'Legacy mandatory/optional constraints not supported.');
+ }
+ if (offerOptions.offerToReceiveAudio !== undefined) {
+ if (offerOptions.offerToReceiveAudio === true) {
+ numAudioTracks = 1;
+ } else if (offerOptions.offerToReceiveAudio === false) {
+ numAudioTracks = 0;
+ } else {
+ numAudioTracks = offerOptions.offerToReceiveAudio;
+ }
+ }
+ if (offerOptions.offerToReceiveVideo !== undefined) {
+ if (offerOptions.offerToReceiveVideo === true) {
+ numVideoTracks = 1;
+ } else if (offerOptions.offerToReceiveVideo === false) {
+ numVideoTracks = 0;
+ } else {
+ numVideoTracks = offerOptions.offerToReceiveVideo;
+ }
+ }
+ }
+
+ this.transceivers.forEach(function(transceiver) {
+ if (transceiver.kind === 'audio') {
+ numAudioTracks--;
+ if (numAudioTracks < 0) {
+ transceiver.wantReceive = false;
+ }
+ } else if (transceiver.kind === 'video') {
+ numVideoTracks--;
+ if (numVideoTracks < 0) {
+ transceiver.wantReceive = false;
+ }
+ }
+ });
+
+ // Create M-lines for recvonly streams.
+ while (numAudioTracks > 0 || numVideoTracks > 0) {
+ if (numAudioTracks > 0) {
+ this._createTransceiver('audio');
+ numAudioTracks--;
+ }
+ if (numVideoTracks > 0) {
+ this._createTransceiver('video');
+ numVideoTracks--;
+ }
+ }
+
+ var sdp = SDPUtils.writeSessionBoilerplate(this._sdpSessionId,
+ this._sdpSessionVersion++);
+ this.transceivers.forEach(function(transceiver, sdpMLineIndex) {
+ // For each track, create an ice gatherer, ice transport,
+ // dtls transport, potentially rtpsender and rtpreceiver.
+ var track = transceiver.track;
+ var kind = transceiver.kind;
+ var mid = SDPUtils.generateIdentifier();
+ transceiver.mid = mid;
+
+ if (!transceiver.iceGatherer) {
+ transceiver.iceGatherer = self._createIceGatherer(sdpMLineIndex,
+ self.usingBundle);
+ }
+
+ var localCapabilities = window.RTCRtpSender.getCapabilities(kind);
+ // filter RTX until additional stuff needed for RTX is implemented
+ // in adapter.js
+ if (edgeVersion < 15019) {
+ localCapabilities.codecs = localCapabilities.codecs.filter(
+ function(codec) {
+ return codec.name !== 'rtx';
+ });
+ }
+ localCapabilities.codecs.forEach(function(codec) {
+ // work around https://bugs.chromium.org/p/webrtc/issues/detail?id=6552
+ // by adding level-asymmetry-allowed=1
+ if (codec.name === 'H264' &&
+ codec.parameters['level-asymmetry-allowed'] === undefined) {
+ codec.parameters['level-asymmetry-allowed'] = '1';
+ }
+ });
+
+ // generate an ssrc now, to be used later in rtpSender.send
+ var sendEncodingParameters = transceiver.sendEncodingParameters || [{
+ ssrc: (2 * sdpMLineIndex + 1) * 1001
+ }];
+ if (track) {
+ // add RTX
+ if (edgeVersion >= 15019 && kind === 'video' &&
+ !sendEncodingParameters[0].rtx) {
+ sendEncodingParameters[0].rtx = {
+ ssrc: sendEncodingParameters[0].ssrc + 1
+ };
+ }
+ }
+
+ if (transceiver.wantReceive) {
+ transceiver.rtpReceiver = new window.RTCRtpReceiver(
+ transceiver.dtlsTransport, kind);
+ }
+
+ transceiver.localCapabilities = localCapabilities;
+ transceiver.sendEncodingParameters = sendEncodingParameters;
+ });
+
+ // always offer BUNDLE and dispose on return if not supported.
+ if (this._config.bundlePolicy !== 'max-compat') {
+ sdp += 'a=group:BUNDLE ' + this.transceivers.map(function(t) {
+ return t.mid;
+ }).join(' ') + '\r\n';
+ }
+ sdp += 'a=ice-options:trickle\r\n';
+
+ this.transceivers.forEach(function(transceiver, sdpMLineIndex) {
+ sdp += writeMediaSection(transceiver, transceiver.localCapabilities,
+ 'offer', transceiver.stream, self._dtlsRole);
+ sdp += 'a=rtcp-rsize\r\n';
+
+ if (transceiver.iceGatherer && self.iceGatheringState !== 'new' &&
+ (sdpMLineIndex === 0 || !self.usingBundle)) {
+ transceiver.iceGatherer.getLocalCandidates().forEach(function(cand) {
+ cand.component = 1;
+ sdp += 'a=' + SDPUtils.writeCandidate(cand) + '\r\n';
+ });
+
+ if (transceiver.iceGatherer.state === 'completed') {
+ sdp += 'a=end-of-candidates\r\n';
+ }
+ }
+ });
+
+ var desc = new window.RTCSessionDescription({
+ type: 'offer',
+ sdp: sdp
+ });
+ return new Promise(function(resolve) {
+ if (args.length > 0 && typeof args[0] === 'function') {
+ args[0].apply(null, [desc]);
+ resolve();
+ return;
+ }
+ resolve(desc);
+ });
+ };
+
+ RTCPeerConnection.prototype.createAnswer = function() {
+ var self = this;
+ var args = arguments;
+
+ var sdp = SDPUtils.writeSessionBoilerplate(this._sdpSessionId,
+ this._sdpSessionVersion++);
+ if (this.usingBundle) {
+ sdp += 'a=group:BUNDLE ' + this.transceivers.map(function(t) {
+ return t.mid;
+ }).join(' ') + '\r\n';
+ }
+ var mediaSectionsInOffer = SDPUtils.splitSections(
+ this.remoteDescription.sdp).length - 1;
+ this.transceivers.forEach(function(transceiver, sdpMLineIndex) {
+ if (sdpMLineIndex + 1 > mediaSectionsInOffer) {
+ return;
+ }
+ if (transceiver.isDatachannel) {
+ sdp += 'm=application 0 DTLS/SCTP 5000\r\n' +
+ 'c=IN IP4 0.0.0.0\r\n' +
+ 'a=mid:' + transceiver.mid + '\r\n';
+ return;
+ }
+
+ // FIXME: look at direction.
+ if (transceiver.stream) {
+ var localTrack;
+ if (transceiver.kind === 'audio') {
+ localTrack = transceiver.stream.getAudioTracks()[0];
+ } else if (transceiver.kind === 'video') {
+ localTrack = transceiver.stream.getVideoTracks()[0];
+ }
+ if (localTrack) {
+ // add RTX
+ if (edgeVersion >= 15019 && transceiver.kind === 'video' &&
+ !transceiver.sendEncodingParameters[0].rtx) {
+ transceiver.sendEncodingParameters[0].rtx = {
+ ssrc: transceiver.sendEncodingParameters[0].ssrc + 1
+ };
+ }
+ }
+ }
+
+ // Calculate intersection of capabilities.
+ var commonCapabilities = getCommonCapabilities(
+ transceiver.localCapabilities,
+ transceiver.remoteCapabilities);
+
+ var hasRtx = commonCapabilities.codecs.filter(function(c) {
+ return c.name.toLowerCase() === 'rtx';
+ }).length;
+ if (!hasRtx && transceiver.sendEncodingParameters[0].rtx) {
+ delete transceiver.sendEncodingParameters[0].rtx;
+ }
+
+ sdp += writeMediaSection(transceiver, commonCapabilities,
+ 'answer', transceiver.stream, self._dtlsRole);
+ if (transceiver.rtcpParameters &&
+ transceiver.rtcpParameters.reducedSize) {
+ sdp += 'a=rtcp-rsize\r\n';
+ }
+ });
+
+ var desc = new window.RTCSessionDescription({
+ type: 'answer',
+ sdp: sdp
+ });
+ return new Promise(function(resolve) {
+ if (args.length > 0 && typeof args[0] === 'function') {
+ args[0].apply(null, [desc]);
+ resolve();
+ return;
+ }
+ resolve(desc);
+ });
+ };
+
+ RTCPeerConnection.prototype.addIceCandidate = function(candidate) {
+ var err;
+ var sections;
+ if (!candidate || candidate.candidate === '') {
+ for (var j = 0; j < this.transceivers.length; j++) {
+ if (this.transceivers[j].isDatachannel) {
+ continue;
+ }
+ this.transceivers[j].iceTransport.addRemoteCandidate({});
+ sections = SDPUtils.splitSections(this.remoteDescription.sdp);
+ sections[j + 1] += 'a=end-of-candidates\r\n';
+ this.remoteDescription.sdp = sections.join('');
+ if (this.usingBundle) {
+ break;
+ }
+ }
+ } else if (!(candidate.sdpMLineIndex !== undefined || candidate.sdpMid)) {
+ throw new TypeError('sdpMLineIndex or sdpMid required');
+ } else if (!this.remoteDescription) {
+ err = new Error('Can not add ICE candidate without ' +
+ 'a remote description');
+ err.name = 'InvalidStateError';
+ } else {
+ var sdpMLineIndex = candidate.sdpMLineIndex;
+ if (candidate.sdpMid) {
+ for (var i = 0; i < this.transceivers.length; i++) {
+ if (this.transceivers[i].mid === candidate.sdpMid) {
+ sdpMLineIndex = i;
+ break;
+ }
+ }
+ }
+ var transceiver = this.transceivers[sdpMLineIndex];
+ if (transceiver) {
+ if (transceiver.isDatachannel) {
+ return Promise.resolve();
+ }
+ var cand = Object.keys(candidate.candidate).length > 0 ?
+ SDPUtils.parseCandidate(candidate.candidate) : {};
+ // Ignore Chrome's invalid candidates since Edge does not like them.
+ if (cand.protocol === 'tcp' && (cand.port === 0 || cand.port === 9)) {
+ return Promise.resolve();
+ }
+ // Ignore RTCP candidates, we assume RTCP-MUX.
+ if (cand.component && cand.component !== 1) {
+ return Promise.resolve();
+ }
+ // when using bundle, avoid adding candidates to the wrong
+ // ice transport. And avoid adding candidates added in the SDP.
+ if (sdpMLineIndex === 0 || (sdpMLineIndex > 0 &&
+ transceiver.iceTransport !== this.transceivers[0].iceTransport)) {
+ if (!maybeAddCandidate(transceiver.iceTransport, cand)) {
+ err = new Error('Can not add ICE candidate');
+ err.name = 'OperationError';
+ }
+ }
+
+ if (!err) {
+ // update the remoteDescription.
+ var candidateString = candidate.candidate.trim();
+ if (candidateString.indexOf('a=') === 0) {
+ candidateString = candidateString.substr(2);
+ }
+ sections = SDPUtils.splitSections(this.remoteDescription.sdp);
+ sections[sdpMLineIndex + 1] += 'a=' +
+ (cand.type ? candidateString : 'end-of-candidates')
+ + '\r\n';
+ this.remoteDescription.sdp = sections.join('');
+ }
+ } else {
+ err = new Error('Can not add ICE candidate');
+ err.name = 'OperationError';
+ }
+ }
+ var args = arguments;
+ return new Promise(function(resolve, reject) {
+ if (err) {
+ if (args.length > 2 && typeof args[2] === 'function') {
+ args[2].apply(null, [err]);
+ }
+ reject(err);
+ } else {
+ if (args.length > 1 && typeof args[1] === 'function') {
+ args[1].apply(null);
+ }
+ resolve();
+ }
+ });
+ };
+
+ RTCPeerConnection.prototype.getStats = function() {
+ var promises = [];
+ this.transceivers.forEach(function(transceiver) {
+ ['rtpSender', 'rtpReceiver', 'iceGatherer', 'iceTransport',
+ 'dtlsTransport'].forEach(function(method) {
+ if (transceiver[method]) {
+ promises.push(transceiver[method].getStats());
+ }
+ });
+ });
+ var cb = arguments.length > 1 && typeof arguments[1] === 'function' &&
+ arguments[1];
+ var fixStatsType = function(stat) {
+ return {
+ inboundrtp: 'inbound-rtp',
+ outboundrtp: 'outbound-rtp',
+ candidatepair: 'candidate-pair',
+ localcandidate: 'local-candidate',
+ remotecandidate: 'remote-candidate'
+ }[stat.type] || stat.type;
+ };
+ return new Promise(function(resolve) {
+ // shim getStats with maplike support
+ var results = new Map();
+ Promise.all(promises).then(function(res) {
+ res.forEach(function(result) {
+ Object.keys(result).forEach(function(id) {
+ result[id].type = fixStatsType(result[id]);
+ results.set(id, result[id]);
+ });
+ });
+ if (cb) {
+ cb.apply(null, results);
+ }
+ resolve(results);
+ });
+ });
+ };
+ return RTCPeerConnection;
+};
+
+},{"sdp":2}],2:[function(require,module,exports){
+ /* eslint-env node */
+'use strict';
+
+// SDP helpers.
+var SDPUtils = {};
+
+// Generate an alphanumeric identifier for cname or mids.
+// TODO: use UUIDs instead? https://gist.github.com/jed/982883
+SDPUtils.generateIdentifier = function() {
+ return Math.random().toString(36).substr(2, 10);
+};
+
+// The RTCP CNAME used by all peerconnections from the same JS.
+SDPUtils.localCName = SDPUtils.generateIdentifier();
+
+// Splits SDP into lines, dealing with both CRLF and LF.
+SDPUtils.splitLines = function(blob) {
+ return blob.trim().split('\n').map(function(line) {
+ return line.trim();
+ });
+};
+// Splits SDP into sessionpart and mediasections. Ensures CRLF.
+SDPUtils.splitSections = function(blob) {
+ var parts = blob.split('\nm=');
+ return parts.map(function(part, index) {
+ return (index > 0 ? 'm=' + part : part).trim() + '\r\n';
+ });
+};
+
+// Returns lines that start with a certain prefix.
+SDPUtils.matchPrefix = function(blob, prefix) {
+ return SDPUtils.splitLines(blob).filter(function(line) {
+ return line.indexOf(prefix) === 0;
+ });
+};
+
+// Parses an ICE candidate line. Sample input:
+// candidate:702786350 2 udp 41819902 8.8.8.8 60769 typ relay raddr 8.8.8.8
+// rport 55996"
+SDPUtils.parseCandidate = function(line) {
+ var parts;
+ // Parse both variants.
+ if (line.indexOf('a=candidate:') === 0) {
+ parts = line.substring(12).split(' ');
+ } else {
+ parts = line.substring(10).split(' ');
+ }
+
+ var candidate = {
+ foundation: parts[0],
+ component: parseInt(parts[1], 10),
+ protocol: parts[2].toLowerCase(),
+ priority: parseInt(parts[3], 10),
+ ip: parts[4],
+ port: parseInt(parts[5], 10),
+ // skip parts[6] == 'typ'
+ type: parts[7]
+ };
+
+ for (var i = 8; i < parts.length; i += 2) {
+ switch (parts[i]) {
+ case 'raddr':
+ candidate.relatedAddress = parts[i + 1];
+ break;
+ case 'rport':
+ candidate.relatedPort = parseInt(parts[i + 1], 10);
+ break;
+ case 'tcptype':
+ candidate.tcpType = parts[i + 1];
+ break;
+ case 'ufrag':
+ candidate.ufrag = parts[i + 1]; // for backward compability.
+ candidate.usernameFragment = parts[i + 1];
+ break;
+ default: // extension handling, in particular ufrag
+ candidate[parts[i]] = parts[i + 1];
+ break;
+ }
+ }
+ return candidate;
+};
+
+// Translates a candidate object into SDP candidate attribute.
+SDPUtils.writeCandidate = function(candidate) {
+ var sdp = [];
+ sdp.push(candidate.foundation);
+ sdp.push(candidate.component);
+ sdp.push(candidate.protocol.toUpperCase());
+ sdp.push(candidate.priority);
+ sdp.push(candidate.ip);
+ sdp.push(candidate.port);
+
+ var type = candidate.type;
+ sdp.push('typ');
+ sdp.push(type);
+ if (type !== 'host' && candidate.relatedAddress &&
+ candidate.relatedPort) {
+ sdp.push('raddr');
+ sdp.push(candidate.relatedAddress); // was: relAddr
+ sdp.push('rport');
+ sdp.push(candidate.relatedPort); // was: relPort
+ }
+ if (candidate.tcpType && candidate.protocol.toLowerCase() === 'tcp') {
+ sdp.push('tcptype');
+ sdp.push(candidate.tcpType);
+ }
+ if (candidate.ufrag) {
+ sdp.push('ufrag');
+ sdp.push(candidate.ufrag);
+ }
+ return 'candidate:' + sdp.join(' ');
+};
+
+// Parses an ice-options line, returns an array of option tags.
+// a=ice-options:foo bar
+SDPUtils.parseIceOptions = function(line) {
+ return line.substr(14).split(' ');
+}
+
+// Parses an rtpmap line, returns RTCRtpCoddecParameters. Sample input:
+// a=rtpmap:111 opus/48000/2
+SDPUtils.parseRtpMap = function(line) {
+ var parts = line.substr(9).split(' ');
+ var parsed = {
+ payloadType: parseInt(parts.shift(), 10) // was: id
+ };
+
+ parts = parts[0].split('/');
+
+ parsed.name = parts[0];
+ parsed.clockRate = parseInt(parts[1], 10); // was: clockrate
+ // was: channels
+ parsed.numChannels = parts.length === 3 ? parseInt(parts[2], 10) : 1;
+ return parsed;
+};
+
+// Generate an a=rtpmap line from RTCRtpCodecCapability or
+// RTCRtpCodecParameters.
+SDPUtils.writeRtpMap = function(codec) {
+ var pt = codec.payloadType;
+ if (codec.preferredPayloadType !== undefined) {
+ pt = codec.preferredPayloadType;
+ }
+ return 'a=rtpmap:' + pt + ' ' + codec.name + '/' + codec.clockRate +
+ (codec.numChannels !== 1 ? '/' + codec.numChannels : '') + '\r\n';
+};
+
+// Parses an a=extmap line (headerextension from RFC 5285). Sample input:
+// a=extmap:2 urn:ietf:params:rtp-hdrext:toffset
+// a=extmap:2/sendonly urn:ietf:params:rtp-hdrext:toffset
+SDPUtils.parseExtmap = function(line) {
+ var parts = line.substr(9).split(' ');
+ return {
+ id: parseInt(parts[0], 10),
+ direction: parts[0].indexOf('/') > 0 ? parts[0].split('/')[1] : 'sendrecv',
+ uri: parts[1]
+ };
+};
+
+// Generates a=extmap line from RTCRtpHeaderExtensionParameters or
+// RTCRtpHeaderExtension.
+SDPUtils.writeExtmap = function(headerExtension) {
+ return 'a=extmap:' + (headerExtension.id || headerExtension.preferredId) +
+ (headerExtension.direction && headerExtension.direction !== 'sendrecv'
+ ? '/' + headerExtension.direction
+ : '') +
+ ' ' + headerExtension.uri + '\r\n';
+};
+
+// Parses an ftmp line, returns dictionary. Sample input:
+// a=fmtp:96 vbr=on;cng=on
+// Also deals with vbr=on; cng=on
+SDPUtils.parseFmtp = function(line) {
+ var parsed = {};
+ var kv;
+ var parts = line.substr(line.indexOf(' ') + 1).split(';');
+ for (var j = 0; j < parts.length; j++) {
+ kv = parts[j].trim().split('=');
+ parsed[kv[0].trim()] = kv[1];
+ }
+ return parsed;
+};
+
+// Generates an a=ftmp line from RTCRtpCodecCapability or RTCRtpCodecParameters.
+SDPUtils.writeFmtp = function(codec) {
+ var line = '';
+ var pt = codec.payloadType;
+ if (codec.preferredPayloadType !== undefined) {
+ pt = codec.preferredPayloadType;
+ }
+ if (codec.parameters && Object.keys(codec.parameters).length) {
+ var params = [];
+ Object.keys(codec.parameters).forEach(function(param) {
+ params.push(param + '=' + codec.parameters[param]);
+ });
+ line += 'a=fmtp:' + pt + ' ' + params.join(';') + '\r\n';
+ }
+ return line;
+};
+
+// Parses an rtcp-fb line, returns RTCPRtcpFeedback object. Sample input:
+// a=rtcp-fb:98 nack rpsi
+SDPUtils.parseRtcpFb = function(line) {
+ var parts = line.substr(line.indexOf(' ') + 1).split(' ');
+ return {
+ type: parts.shift(),
+ parameter: parts.join(' ')
+ };
+};
+// Generate a=rtcp-fb lines from RTCRtpCodecCapability or RTCRtpCodecParameters.
+SDPUtils.writeRtcpFb = function(codec) {
+ var lines = '';
+ var pt = codec.payloadType;
+ if (codec.preferredPayloadType !== undefined) {
+ pt = codec.preferredPayloadType;
+ }
+ if (codec.rtcpFeedback && codec.rtcpFeedback.length) {
+ // FIXME: special handling for trr-int?
+ codec.rtcpFeedback.forEach(function(fb) {
+ lines += 'a=rtcp-fb:' + pt + ' ' + fb.type +
+ (fb.parameter && fb.parameter.length ? ' ' + fb.parameter : '') +
+ '\r\n';
+ });
+ }
+ return lines;
+};
+
+// Parses an RFC 5576 ssrc media attribute. Sample input:
+// a=ssrc:3735928559 cname:something
+SDPUtils.parseSsrcMedia = function(line) {
+ var sp = line.indexOf(' ');
+ var parts = {
+ ssrc: parseInt(line.substr(7, sp - 7), 10)
+ };
+ var colon = line.indexOf(':', sp);
+ if (colon > -1) {
+ parts.attribute = line.substr(sp + 1, colon - sp - 1);
+ parts.value = line.substr(colon + 1);
+ } else {
+ parts.attribute = line.substr(sp + 1);
+ }
+ return parts;
+};
+
+// Extracts the MID (RFC 5888) from a media section.
+// returns the MID or undefined if no mid line was found.
+SDPUtils.getMid = function(mediaSection) {
+ var mid = SDPUtils.matchPrefix(mediaSection, 'a=mid:')[0];
+ if (mid) {
+ return mid.substr(6);
+ }
+}
+
+SDPUtils.parseFingerprint = function(line) {
+ var parts = line.substr(14).split(' ');
+ return {
+ algorithm: parts[0].toLowerCase(), // algorithm is case-sensitive in Edge.
+ value: parts[1]
+ };
+};
+
+// Extracts DTLS parameters from SDP media section or sessionpart.
+// FIXME: for consistency with other functions this should only
+// get the fingerprint line as input. See also getIceParameters.
+SDPUtils.getDtlsParameters = function(mediaSection, sessionpart) {
+ var lines = SDPUtils.matchPrefix(mediaSection + sessionpart,
+ 'a=fingerprint:');
+ // Note: a=setup line is ignored since we use the 'auto' role.
+ // Note2: 'algorithm' is not case sensitive except in Edge.
+ return {
+ role: 'auto',
+ fingerprints: lines.map(SDPUtils.parseFingerprint)
+ };
+};
+
+// Serializes DTLS parameters to SDP.
+SDPUtils.writeDtlsParameters = function(params, setupType) {
+ var sdp = 'a=setup:' + setupType + '\r\n';
+ params.fingerprints.forEach(function(fp) {
+ sdp += 'a=fingerprint:' + fp.algorithm + ' ' + fp.value + '\r\n';
+ });
+ return sdp;
+};
+// Parses ICE information from SDP media section or sessionpart.
+// FIXME: for consistency with other functions this should only
+// get the ice-ufrag and ice-pwd lines as input.
+SDPUtils.getIceParameters = function(mediaSection, sessionpart) {
+ var lines = SDPUtils.splitLines(mediaSection);
+ // Search in session part, too.
+ lines = lines.concat(SDPUtils.splitLines(sessionpart));
+ var iceParameters = {
+ usernameFragment: lines.filter(function(line) {
+ return line.indexOf('a=ice-ufrag:') === 0;
+ })[0].substr(12),
+ password: lines.filter(function(line) {
+ return line.indexOf('a=ice-pwd:') === 0;
+ })[0].substr(10)
+ };
+ return iceParameters;
+};
+
+// Serializes ICE parameters to SDP.
+SDPUtils.writeIceParameters = function(params) {
+ return 'a=ice-ufrag:' + params.usernameFragment + '\r\n' +
+ 'a=ice-pwd:' + params.password + '\r\n';
+};
+
+// Parses the SDP media section and returns RTCRtpParameters.
+SDPUtils.parseRtpParameters = function(mediaSection) {
+ var description = {
+ codecs: [],
+ headerExtensions: [],
+ fecMechanisms: [],
+ rtcp: []
+ };
+ var lines = SDPUtils.splitLines(mediaSection);
+ var mline = lines[0].split(' ');
+ for (var i = 3; i < mline.length; i++) { // find all codecs from mline[3..]
+ var pt = mline[i];
+ var rtpmapline = SDPUtils.matchPrefix(
+ mediaSection, 'a=rtpmap:' + pt + ' ')[0];
+ if (rtpmapline) {
+ var codec = SDPUtils.parseRtpMap(rtpmapline);
+ var fmtps = SDPUtils.matchPrefix(
+ mediaSection, 'a=fmtp:' + pt + ' ');
+ // Only the first a=fmtp:<pt> is considered.
+ codec.parameters = fmtps.length ? SDPUtils.parseFmtp(fmtps[0]) : {};
+ codec.rtcpFeedback = SDPUtils.matchPrefix(
+ mediaSection, 'a=rtcp-fb:' + pt + ' ')
+ .map(SDPUtils.parseRtcpFb);
+ description.codecs.push(codec);
+ // parse FEC mechanisms from rtpmap lines.
+ switch (codec.name.toUpperCase()) {
+ case 'RED':
+ case 'ULPFEC':
+ description.fecMechanisms.push(codec.name.toUpperCase());
+ break;
+ default: // only RED and ULPFEC are recognized as FEC mechanisms.
+ break;
+ }
+ }
+ }
+ SDPUtils.matchPrefix(mediaSection, 'a=extmap:').forEach(function(line) {
+ description.headerExtensions.push(SDPUtils.parseExtmap(line));
+ });
+ // FIXME: parse rtcp.
+ return description;
+};
+
+// Generates parts of the SDP media section describing the capabilities /
+// parameters.
+SDPUtils.writeRtpDescription = function(kind, caps) {
+ var sdp = '';
+
+ // Build the mline.
+ sdp += 'm=' + kind + ' ';
+ sdp += caps.codecs.length > 0 ? '9' : '0'; // reject if no codecs.
+ sdp += ' UDP/TLS/RTP/SAVPF ';
+ sdp += caps.codecs.map(function(codec) {
+ if (codec.preferredPayloadType !== undefined) {
+ return codec.preferredPayloadType;
+ }
+ return codec.payloadType;
+ }).join(' ') + '\r\n';
+
+ sdp += 'c=IN IP4 0.0.0.0\r\n';
+ sdp += 'a=rtcp:9 IN IP4 0.0.0.0\r\n';
+
+ // Add a=rtpmap lines for each codec. Also fmtp and rtcp-fb.
+ caps.codecs.forEach(function(codec) {
+ sdp += SDPUtils.writeRtpMap(codec);
+ sdp += SDPUtils.writeFmtp(codec);
+ sdp += SDPUtils.writeRtcpFb(codec);
+ });
+ var maxptime = 0;
+ caps.codecs.forEach(function(codec) {
+ if (codec.maxptime > maxptime) {
+ maxptime = codec.maxptime;
+ }
+ });
+ if (maxptime > 0) {
+ sdp += 'a=maxptime:' + maxptime + '\r\n';
+ }
+ sdp += 'a=rtcp-mux\r\n';
+
+ caps.headerExtensions.forEach(function(extension) {
+ sdp += SDPUtils.writeExtmap(extension);
+ });
+ // FIXME: write fecMechanisms.
+ return sdp;
+};
+
+// Parses the SDP media section and returns an array of
+// RTCRtpEncodingParameters.
+SDPUtils.parseRtpEncodingParameters = function(mediaSection) {
+ var encodingParameters = [];
+ var description = SDPUtils.parseRtpParameters(mediaSection);
+ var hasRed = description.fecMechanisms.indexOf('RED') !== -1;
+ var hasUlpfec = description.fecMechanisms.indexOf('ULPFEC') !== -1;
+
+ // filter a=ssrc:... cname:, ignore PlanB-msid
+ var ssrcs = SDPUtils.matchPrefix(mediaSection, 'a=ssrc:')
+ .map(function(line) {
+ return SDPUtils.parseSsrcMedia(line);
+ })
+ .filter(function(parts) {
+ return parts.attribute === 'cname';
+ });
+ var primarySsrc = ssrcs.length > 0 && ssrcs[0].ssrc;
+ var secondarySsrc;
+
+ var flows = SDPUtils.matchPrefix(mediaSection, 'a=ssrc-group:FID')
+ .map(function(line) {
+ var parts = line.split(' ');
+ parts.shift();
+ return parts.map(function(part) {
+ return parseInt(part, 10);
+ });
+ });
+ if (flows.length > 0 && flows[0].length > 1 && flows[0][0] === primarySsrc) {
+ secondarySsrc = flows[0][1];
+ }
+
+ description.codecs.forEach(function(codec) {
+ if (codec.name.toUpperCase() === 'RTX' && codec.parameters.apt) {
+ var encParam = {
+ ssrc: primarySsrc,
+ codecPayloadType: parseInt(codec.parameters.apt, 10),
+ rtx: {
+ ssrc: secondarySsrc
+ }
+ };
+ encodingParameters.push(encParam);
+ if (hasRed) {
+ encParam = JSON.parse(JSON.stringify(encParam));
+ encParam.fec = {
+ ssrc: secondarySsrc,
+ mechanism: hasUlpfec ? 'red+ulpfec' : 'red'
+ };
+ encodingParameters.push(encParam);
+ }
+ }
+ });
+ if (encodingParameters.length === 0 && primarySsrc) {
+ encodingParameters.push({
+ ssrc: primarySsrc
+ });
+ }
+
+ // we support both b=AS and b=TIAS but interpret AS as TIAS.
+ var bandwidth = SDPUtils.matchPrefix(mediaSection, 'b=');
+ if (bandwidth.length) {
+ if (bandwidth[0].indexOf('b=TIAS:') === 0) {
+ bandwidth = parseInt(bandwidth[0].substr(7), 10);
+ } else if (bandwidth[0].indexOf('b=AS:') === 0) {
+ // use formula from JSEP to convert b=AS to TIAS value.
+ bandwidth = parseInt(bandwidth[0].substr(5), 10) * 1000 * 0.95
+ - (50 * 40 * 8);
+ } else {
+ bandwidth = undefined;
+ }
+ encodingParameters.forEach(function(params) {
+ params.maxBitrate = bandwidth;
+ });
+ }
+ return encodingParameters;
+};
+
+// parses http://draft.ortc.org/#rtcrtcpparameters*
+SDPUtils.parseRtcpParameters = function(mediaSection) {
+ var rtcpParameters = {};
+
+ var cname;
+ // Gets the first SSRC. Note that with RTX there might be multiple
+ // SSRCs.
+ var remoteSsrc = SDPUtils.matchPrefix(mediaSection, 'a=ssrc:')
+ .map(function(line) {
+ return SDPUtils.parseSsrcMedia(line);
+ })
+ .filter(function(obj) {
+ return obj.attribute === 'cname';
+ })[0];
+ if (remoteSsrc) {
+ rtcpParameters.cname = remoteSsrc.value;
+ rtcpParameters.ssrc = remoteSsrc.ssrc;
+ }
+
+ // Edge uses the compound attribute instead of reducedSize
+ // compound is !reducedSize
+ var rsize = SDPUtils.matchPrefix(mediaSection, 'a=rtcp-rsize');
+ rtcpParameters.reducedSize = rsize.length > 0;
+ rtcpParameters.compound = rsize.length === 0;
+
+ // parses the rtcp-mux attrÑ–bute.
+ // Note that Edge does not support unmuxed RTCP.
+ var mux = SDPUtils.matchPrefix(mediaSection, 'a=rtcp-mux');
+ rtcpParameters.mux = mux.length > 0;
+
+ return rtcpParameters;
+};
+
+// parses either a=msid: or a=ssrc:... msid lines and returns
+// the id of the MediaStream and MediaStreamTrack.
+SDPUtils.parseMsid = function(mediaSection) {
+ var parts;
+ var spec = SDPUtils.matchPrefix(mediaSection, 'a=msid:');
+ if (spec.length === 1) {
+ parts = spec[0].substr(7).split(' ');
+ return {stream: parts[0], track: parts[1]};
+ }
+ var planB = SDPUtils.matchPrefix(mediaSection, 'a=ssrc:')
+ .map(function(line) {
+ return SDPUtils.parseSsrcMedia(line);
+ })
+ .filter(function(parts) {
+ return parts.attribute === 'msid';
+ });
+ if (planB.length > 0) {
+ parts = planB[0].value.split(' ');
+ return {stream: parts[0], track: parts[1]};
+ }
+};
+
+// Generate a session ID for SDP.
+// https://tools.ietf.org/html/draft-ietf-rtcweb-jsep-20#section-5.2.1
+// recommends using a cryptographically random +ve 64-bit value
+// but right now this should be acceptable and within the right range
+SDPUtils.generateSessionId = function() {
+ return Math.random().toString().substr(2, 21);
+};
+
+// Write boilder plate for start of SDP
+// sessId argument is optional - if not supplied it will
+// be generated randomly
+// sessVersion is optional and defaults to 2
+SDPUtils.writeSessionBoilerplate = function(sessId, sessVer) {
+ var sessionId;
+ var version = sessVer !== undefined ? sessVer : 2;
+ if (sessId) {
+ sessionId = sessId;
+ } else {
+ sessionId = SDPUtils.generateSessionId();
+ }
+ // FIXME: sess-id should be an NTP timestamp.
+ return 'v=0\r\n' +
+ 'o=thisisadapterortc ' + sessionId + ' ' + version + ' IN IP4 127.0.0.1\r\n' +
+ 's=-\r\n' +
+ 't=0 0\r\n';
+};
+
+SDPUtils.writeMediaSection = function(transceiver, caps, type, stream) {
+ var sdp = SDPUtils.writeRtpDescription(transceiver.kind, caps);
+
+ // Map ICE parameters (ufrag, pwd) to SDP.
+ sdp += SDPUtils.writeIceParameters(
+ transceiver.iceGatherer.getLocalParameters());
+
+ // Map DTLS parameters to SDP.
+ sdp += SDPUtils.writeDtlsParameters(
+ transceiver.dtlsTransport.getLocalParameters(),
+ type === 'offer' ? 'actpass' : 'active');
+
+ sdp += 'a=mid:' + transceiver.mid + '\r\n';
+
+ if (transceiver.direction) {
+ sdp += 'a=' + transceiver.direction + '\r\n';
+ } else if (transceiver.rtpSender && transceiver.rtpReceiver) {
+ sdp += 'a=sendrecv\r\n';
+ } else if (transceiver.rtpSender) {
+ sdp += 'a=sendonly\r\n';
+ } else if (transceiver.rtpReceiver) {
+ sdp += 'a=recvonly\r\n';
+ } else {
+ sdp += 'a=inactive\r\n';
+ }
+
+ if (transceiver.rtpSender) {
+ // spec.
+ var msid = 'msid:' + stream.id + ' ' +
+ transceiver.rtpSender.track.id + '\r\n';
+ sdp += 'a=' + msid;
+
+ // for Chrome.
+ sdp += 'a=ssrc:' + transceiver.sendEncodingParameters[0].ssrc +
+ ' ' + msid;
+ if (transceiver.sendEncodingParameters[0].rtx) {
+ sdp += 'a=ssrc:' + transceiver.sendEncodingParameters[0].rtx.ssrc +
+ ' ' + msid;
+ sdp += 'a=ssrc-group:FID ' +
+ transceiver.sendEncodingParameters[0].ssrc + ' ' +
+ transceiver.sendEncodingParameters[0].rtx.ssrc +
+ '\r\n';
+ }
+ }
+ // FIXME: this should be written by writeRtpDescription.
+ sdp += 'a=ssrc:' + transceiver.sendEncodingParameters[0].ssrc +
+ ' cname:' + SDPUtils.localCName + '\r\n';
+ if (transceiver.rtpSender && transceiver.sendEncodingParameters[0].rtx) {
+ sdp += 'a=ssrc:' + transceiver.sendEncodingParameters[0].rtx.ssrc +
+ ' cname:' + SDPUtils.localCName + '\r\n';
+ }
+ return sdp;
+};
+
+// Gets the direction from the mediaSection or the sessionpart.
+SDPUtils.getDirection = function(mediaSection, sessionpart) {
+ // Look for sendrecv, sendonly, recvonly, inactive, default to sendrecv.
+ var lines = SDPUtils.splitLines(mediaSection);
+ for (var i = 0; i < lines.length; i++) {
+ switch (lines[i]) {
+ case 'a=sendrecv':
+ case 'a=sendonly':
+ case 'a=recvonly':
+ case 'a=inactive':
+ return lines[i].substr(2);
+ default:
+ // FIXME: What should happen here?
+ }
+ }
+ if (sessionpart) {
+ return SDPUtils.getDirection(sessionpart);
+ }
+ return 'sendrecv';
+};
+
+SDPUtils.getKind = function(mediaSection) {
+ var lines = SDPUtils.splitLines(mediaSection);
+ var mline = lines[0].split(' ');
+ return mline[0].substr(2);
+};
+
+SDPUtils.isRejected = function(mediaSection) {
+ return mediaSection.split(' ', 2)[1] === '0';
+};
+
+SDPUtils.parseMLine = function(mediaSection) {
+ var lines = SDPUtils.splitLines(mediaSection);
+ var mline = lines[0].split(' ');
+ return {
+ kind: mline[0].substr(2),
+ port: parseInt(mline[1], 10),
+ protocol: mline[2],
+ fmt: mline.slice(3).join(' ')
+ };
+};
+
+// Expose public methods.
+if (typeof module === 'object') {
+ module.exports = SDPUtils;
+}
+
+},{}],3:[function(require,module,exports){
+(function (global){
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+ /* eslint-env node */
+
+'use strict';
+
+var adapterFactory = require('./adapter_factory.js');
+module.exports = adapterFactory({window: global.window});
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./adapter_factory.js":4}],4:[function(require,module,exports){
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+ /* eslint-env node */
+
+'use strict';
+
+var utils = require('./utils');
+// Shimming starts here.
+module.exports = function(dependencies, opts) {
+ var window = dependencies && dependencies.window;
+
+ var options = {
+ shimChrome: true,
+ shimFirefox: true,
+ shimEdge: true,
+ shimSafari: true,
+ };
+
+ for (var key in opts) {
+ if (hasOwnProperty.call(opts, key)) {
+ options[key] = opts[key];
+ }
+ }
+
+ // Utils.
+ var logging = utils.log;
+ var browserDetails = utils.detectBrowser(window);
+
+ // Export to the adapter global object visible in the browser.
+ var adapter = {
+ browserDetails: browserDetails,
+ extractVersion: utils.extractVersion,
+ disableLog: utils.disableLog,
+ disableWarnings: utils.disableWarnings
+ };
+
+ // Uncomment the line below if you want logging to occur, including logging
+ // for the switch statement below. Can also be turned on in the browser via
+ // adapter.disableLog(false), but then logging from the switch statement below
+ // will not appear.
+ // require('./utils').disableLog(false);
+
+ // Browser shims.
+ var chromeShim = require('./chrome/chrome_shim') || null;
+ var edgeShim = require('./edge/edge_shim') || null;
+ var firefoxShim = require('./firefox/firefox_shim') || null;
+ var safariShim = require('./safari/safari_shim') || null;
+ var commonShim = require('./common_shim') || null;
+
+ // Shim browser if found.
+ switch (browserDetails.browser) {
+ case 'chrome':
+ if (!chromeShim || !chromeShim.shimPeerConnection ||
+ !options.shimChrome) {
+ logging('Chrome shim is not included in this adapter release.');
+ return adapter;
+ }
+ logging('adapter.js shimming chrome.');
+ // Export to the adapter global object visible in the browser.
+ adapter.browserShim = chromeShim;
+ commonShim.shimCreateObjectURL(window);
+
+ chromeShim.shimGetUserMedia(window);
+ chromeShim.shimMediaStream(window);
+ chromeShim.shimSourceObject(window);
+ chromeShim.shimPeerConnection(window);
+ chromeShim.shimOnTrack(window);
+ chromeShim.shimAddTrackRemoveTrack(window);
+ chromeShim.shimGetSendersWithDtmf(window);
+
+ commonShim.shimRTCIceCandidate(window);
+ break;
+ case 'firefox':
+ if (!firefoxShim || !firefoxShim.shimPeerConnection ||
+ !options.shimFirefox) {
+ logging('Firefox shim is not included in this adapter release.');
+ return adapter;
+ }
+ logging('adapter.js shimming firefox.');
+ // Export to the adapter global object visible in the browser.
+ adapter.browserShim = firefoxShim;
+ commonShim.shimCreateObjectURL(window);
+
+ firefoxShim.shimGetUserMedia(window);
+ firefoxShim.shimSourceObject(window);
+ firefoxShim.shimPeerConnection(window);
+ firefoxShim.shimOnTrack(window);
+
+ commonShim.shimRTCIceCandidate(window);
+ break;
+ case 'edge':
+ if (!edgeShim || !edgeShim.shimPeerConnection || !options.shimEdge) {
+ logging('MS edge shim is not included in this adapter release.');
+ return adapter;
+ }
+ logging('adapter.js shimming edge.');
+ // Export to the adapter global object visible in the browser.
+ adapter.browserShim = edgeShim;
+ commonShim.shimCreateObjectURL(window);
+
+ edgeShim.shimGetUserMedia(window);
+ edgeShim.shimPeerConnection(window);
+ edgeShim.shimReplaceTrack(window);
+
+ // the edge shim implements the full RTCIceCandidate object.
+ break;
+ case 'safari':
+ if (!safariShim || !options.shimSafari) {
+ logging('Safari shim is not included in this adapter release.');
+ return adapter;
+ }
+ logging('adapter.js shimming safari.');
+ // Export to the adapter global object visible in the browser.
+ adapter.browserShim = safariShim;
+ commonShim.shimCreateObjectURL(window);
+
+ safariShim.shimRTCIceServerUrls(window);
+ safariShim.shimCallbacksAPI(window);
+ safariShim.shimLocalStreamsAPI(window);
+ safariShim.shimRemoteStreamsAPI(window);
+ safariShim.shimTrackEventTransceiver(window);
+ safariShim.shimGetUserMedia(window);
+ safariShim.shimCreateOfferLegacy(window);
+
+ commonShim.shimRTCIceCandidate(window);
+ break;
+ default:
+ logging('Unsupported browser!');
+ break;
+ }
+
+ return adapter;
+};
+
+},{"./chrome/chrome_shim":5,"./common_shim":7,"./edge/edge_shim":8,"./firefox/firefox_shim":10,"./safari/safari_shim":12,"./utils":13}],5:[function(require,module,exports){
+
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+ /* eslint-env node */
+'use strict';
+var utils = require('../utils.js');
+var logging = utils.log;
+
+var chromeShim = {
+ shimMediaStream: function(window) {
+ window.MediaStream = window.MediaStream || window.webkitMediaStream;
+ },
+
+ shimOnTrack: function(window) {
+ if (typeof window === 'object' && window.RTCPeerConnection && !('ontrack' in
+ window.RTCPeerConnection.prototype)) {
+ Object.defineProperty(window.RTCPeerConnection.prototype, 'ontrack', {
+ get: function() {
+ return this._ontrack;
+ },
+ set: function(f) {
+ if (this._ontrack) {
+ this.removeEventListener('track', this._ontrack);
+ }
+ this.addEventListener('track', this._ontrack = f);
+ }
+ });
+ var origSetRemoteDescription =
+ window.RTCPeerConnection.prototype.setRemoteDescription;
+ window.RTCPeerConnection.prototype.setRemoteDescription = function() {
+ var pc = this;
+ if (!pc._ontrackpoly) {
+ pc._ontrackpoly = function(e) {
+ // onaddstream does not fire when a track is added to an existing
+ // stream. But stream.onaddtrack is implemented so we use that.
+ e.stream.addEventListener('addtrack', function(te) {
+ var receiver;
+ if (window.RTCPeerConnection.prototype.getReceivers) {
+ receiver = pc.getReceivers().find(function(r) {
+ return r.track && r.track.id === te.track.id;
+ });
+ } else {
+ receiver = {track: te.track};
+ }
+
+ var event = new Event('track');
+ event.track = te.track;
+ event.receiver = receiver;
+ event.transceiver = {receiver: receiver};
+ event.streams = [e.stream];
+ pc.dispatchEvent(event);
+ });
+ e.stream.getTracks().forEach(function(track) {
+ var receiver;
+ if (window.RTCPeerConnection.prototype.getReceivers) {
+ receiver = pc.getReceivers().find(function(r) {
+ return r.track && r.track.id === track.id;
+ });
+ } else {
+ receiver = {track: track};
+ }
+ var event = new Event('track');
+ event.track = track;
+ event.receiver = receiver;
+ event.transceiver = {receiver: receiver};
+ event.streams = [e.stream];
+ pc.dispatchEvent(event);
+ });
+ };
+ pc.addEventListener('addstream', pc._ontrackpoly);
+ }
+ return origSetRemoteDescription.apply(pc, arguments);
+ };
+ }
+ },
+
+ shimGetSendersWithDtmf: function(window) {
+ // Overrides addTrack/removeTrack, depends on shimAddTrackRemoveTrack.
+ if (typeof window === 'object' && window.RTCPeerConnection &&
+ !('getSenders' in window.RTCPeerConnection.prototype) &&
+ 'createDTMFSender' in window.RTCPeerConnection.prototype) {
+ var shimSenderWithDtmf = function(pc, track) {
+ return {
+ track: track,
+ get dtmf() {
+ if (this._dtmf === undefined) {
+ if (track.kind === 'audio') {
+ this._dtmf = pc.createDTMFSender(track);
+ } else {
+ this._dtmf = null;
+ }
+ }
+ return this._dtmf;
+ },
+ _pc: pc
+ };
+ };
+
+ // augment addTrack when getSenders is not available.
+ if (!window.RTCPeerConnection.prototype.getSenders) {
+ window.RTCPeerConnection.prototype.getSenders = function() {
+ this._senders = this._senders || [];
+ return this._senders.slice(); // return a copy of the internal state.
+ };
+ var origAddTrack = window.RTCPeerConnection.prototype.addTrack;
+ window.RTCPeerConnection.prototype.addTrack = function(track, stream) {
+ var pc = this;
+ var sender = origAddTrack.apply(pc, arguments);
+ if (!sender) {
+ sender = shimSenderWithDtmf(pc, track);
+ pc._senders.push(sender);
+ }
+ return sender;
+ };
+
+ var origRemoveTrack = window.RTCPeerConnection.prototype.removeTrack;
+ window.RTCPeerConnection.prototype.removeTrack = function(sender) {
+ var pc = this;
+ origRemoveTrack.apply(pc, arguments);
+ var idx = pc._senders.indexOf(sender);
+ if (idx !== -1) {
+ pc._senders.splice(idx, 1);
+ }
+ };
+ }
+ var origAddStream = window.RTCPeerConnection.prototype.addStream;
+ window.RTCPeerConnection.prototype.addStream = function(stream) {
+ var pc = this;
+ pc._senders = pc._senders || [];
+ origAddStream.apply(pc, [stream]);
+ stream.getTracks().forEach(function(track) {
+ pc._senders.push(shimSenderWithDtmf(pc, track));
+ });
+ };
+
+ var origRemoveStream = window.RTCPeerConnection.prototype.removeStream;
+ window.RTCPeerConnection.prototype.removeStream = function(stream) {
+ var pc = this;
+ pc._senders = pc._senders || [];
+ origRemoveStream.apply(pc, [stream]);
+
+ stream.getTracks().forEach(function(track) {
+ var sender = pc._senders.find(function(s) {
+ return s.track === track;
+ });
+ if (sender) {
+ pc._senders.splice(pc._senders.indexOf(sender), 1); // remove sender
+ }
+ });
+ };
+ } else if (typeof window === 'object' && window.RTCPeerConnection &&
+ 'getSenders' in window.RTCPeerConnection.prototype &&
+ 'createDTMFSender' in window.RTCPeerConnection.prototype &&
+ window.RTCRtpSender &&
+ !('dtmf' in window.RTCRtpSender.prototype)) {
+ var origGetSenders = window.RTCPeerConnection.prototype.getSenders;
+ window.RTCPeerConnection.prototype.getSenders = function() {
+ var pc = this;
+ var senders = origGetSenders.apply(pc, []);
+ senders.forEach(function(sender) {
+ sender._pc = pc;
+ });
+ return senders;
+ };
+
+ Object.defineProperty(window.RTCRtpSender.prototype, 'dtmf', {
+ get: function() {
+ if (this._dtmf === undefined) {
+ if (this.track.kind === 'audio') {
+ this._dtmf = this._pc.createDTMFSender(this.track);
+ } else {
+ this._dtmf = null;
+ }
+ }
+ return this._dtmf;
+ }
+ });
+ }
+ },
+
+ shimSourceObject: function(window) {
+ var URL = window && window.URL;
+
+ if (typeof window === 'object') {
+ if (window.HTMLMediaElement &&
+ !('srcObject' in window.HTMLMediaElement.prototype)) {
+ // Shim the srcObject property, once, when HTMLMediaElement is found.
+ Object.defineProperty(window.HTMLMediaElement.prototype, 'srcObject', {
+ get: function() {
+ return this._srcObject;
+ },
+ set: function(stream) {
+ var self = this;
+ // Use _srcObject as a private property for this shim
+ this._srcObject = stream;
+ if (this.src) {
+ URL.revokeObjectURL(this.src);
+ }
+
+ if (!stream) {
+ this.src = '';
+ return undefined;
+ }
+ this.src = URL.createObjectURL(stream);
+ // We need to recreate the blob url when a track is added or
+ // removed. Doing it manually since we want to avoid a recursion.
+ stream.addEventListener('addtrack', function() {
+ if (self.src) {
+ URL.revokeObjectURL(self.src);
+ }
+ self.src = URL.createObjectURL(stream);
+ });
+ stream.addEventListener('removetrack', function() {
+ if (self.src) {
+ URL.revokeObjectURL(self.src);
+ }
+ self.src = URL.createObjectURL(stream);
+ });
+ }
+ });
+ }
+ }
+ },
+
+ shimAddTrackRemoveTrack: function(window) {
+ var browserDetails = utils.detectBrowser(window);
+ // shim addTrack and removeTrack.
+ if (window.RTCPeerConnection.prototype.addTrack &&
+ browserDetails.version >= 63) {
+ return;
+ }
+
+ // also shim pc.getLocalStreams when addTrack is shimmed
+ // to return the original streams.
+ var origGetLocalStreams = window.RTCPeerConnection.prototype
+ .getLocalStreams;
+ window.RTCPeerConnection.prototype.getLocalStreams = function() {
+ var self = this;
+ var nativeStreams = origGetLocalStreams.apply(this);
+ self._reverseStreams = self._reverseStreams || {};
+ return nativeStreams.map(function(stream) {
+ return self._reverseStreams[stream.id];
+ });
+ };
+
+ var origAddStream = window.RTCPeerConnection.prototype.addStream;
+ window.RTCPeerConnection.prototype.addStream = function(stream) {
+ var pc = this;
+ pc._streams = pc._streams || {};
+ pc._reverseStreams = pc._reverseStreams || {};
+
+ stream.getTracks().forEach(function(track) {
+ var alreadyExists = pc.getSenders().find(function(s) {
+ return s.track === track;
+ });
+ if (alreadyExists) {
+ throw new DOMException('Track already exists.',
+ 'InvalidAccessError');
+ }
+ });
+ // Add identity mapping for consistency with addTrack.
+ // Unless this is being used with a stream from addTrack.
+ if (!pc._reverseStreams[stream.id]) {
+ var newStream = new window.MediaStream(stream.getTracks());
+ pc._streams[stream.id] = newStream;
+ pc._reverseStreams[newStream.id] = stream;
+ stream = newStream;
+ }
+ origAddStream.apply(pc, [stream]);
+ };
+
+ var origRemoveStream = window.RTCPeerConnection.prototype.removeStream;
+ window.RTCPeerConnection.prototype.removeStream = function(stream) {
+ var pc = this;
+ pc._streams = pc._streams || {};
+ pc._reverseStreams = pc._reverseStreams || {};
+
+ origRemoveStream.apply(pc, [(pc._streams[stream.id] || stream)]);
+ delete pc._reverseStreams[(pc._streams[stream.id] ?
+ pc._streams[stream.id].id : stream.id)];
+ delete pc._streams[stream.id];
+ };
+
+ window.RTCPeerConnection.prototype.addTrack = function(track, stream) {
+ var pc = this;
+ if (pc.signalingState === 'closed') {
+ throw new DOMException(
+ 'The RTCPeerConnection\'s signalingState is \'closed\'.',
+ 'InvalidStateError');
+ }
+ var streams = [].slice.call(arguments, 1);
+ if (streams.length !== 1 ||
+ !streams[0].getTracks().find(function(t) {
+ return t === track;
+ })) {
+ // this is not fully correct but all we can manage without
+ // [[associated MediaStreams]] internal slot.
+ throw new DOMException(
+ 'The adapter.js addTrack polyfill only supports a single ' +
+ ' stream which is associated with the specified track.',
+ 'NotSupportedError');
+ }
+
+ var alreadyExists = pc.getSenders().find(function(s) {
+ return s.track === track;
+ });
+ if (alreadyExists) {
+ throw new DOMException('Track already exists.',
+ 'InvalidAccessError');
+ }
+
+ pc._streams = pc._streams || {};
+ pc._reverseStreams = pc._reverseStreams || {};
+ var oldStream = pc._streams[stream.id];
+ if (oldStream) {
+ // this is using odd Chrome behaviour, use with caution:
+ // https://bugs.chromium.org/p/webrtc/issues/detail?id=7815
+ // Note: we rely on the high-level addTrack/dtmf shim to
+ // create the sender with a dtmf sender.
+ oldStream.addTrack(track);
+
+ // Trigger ONN async.
+ Promise.resolve().then(function() {
+ pc.dispatchEvent(new Event('negotiationneeded'));
+ });
+ } else {
+ var newStream = new window.MediaStream([track]);
+ pc._streams[stream.id] = newStream;
+ pc._reverseStreams[newStream.id] = stream;
+ pc.addStream(newStream);
+ }
+ return pc.getSenders().find(function(s) {
+ return s.track === track;
+ });
+ };
+
+ // replace the internal stream id with the external one and
+ // vice versa.
+ function replaceInternalStreamId(pc, description) {
+ var sdp = description.sdp;
+ Object.keys(pc._reverseStreams || []).forEach(function(internalId) {
+ var externalStream = pc._reverseStreams[internalId];
+ var internalStream = pc._streams[externalStream.id];
+ sdp = sdp.replace(new RegExp(internalStream.id, 'g'),
+ externalStream.id);
+ });
+ return new RTCSessionDescription({
+ type: description.type,
+ sdp: sdp
+ });
+ }
+ function replaceExternalStreamId(pc, description) {
+ var sdp = description.sdp;
+ Object.keys(pc._reverseStreams || []).forEach(function(internalId) {
+ var externalStream = pc._reverseStreams[internalId];
+ var internalStream = pc._streams[externalStream.id];
+ sdp = sdp.replace(new RegExp(externalStream.id, 'g'),
+ internalStream.id);
+ });
+ return new RTCSessionDescription({
+ type: description.type,
+ sdp: sdp
+ });
+ }
+ ['createOffer', 'createAnswer'].forEach(function(method) {
+ var nativeMethod = window.RTCPeerConnection.prototype[method];
+ window.RTCPeerConnection.prototype[method] = function() {
+ var pc = this;
+ var args = arguments;
+ var isLegacyCall = arguments.length &&
+ typeof arguments[0] === 'function';
+ if (isLegacyCall) {
+ return nativeMethod.apply(pc, [
+ function(description) {
+ var desc = replaceInternalStreamId(pc, description);
+ args[0].apply(null, [desc]);
+ },
+ function(err) {
+ if (args[1]) {
+ args[1].apply(null, err);
+ }
+ }, arguments[2]
+ ]);
+ }
+ return nativeMethod.apply(pc, arguments)
+ .then(function(description) {
+ return replaceInternalStreamId(pc, description);
+ });
+ };
+ });
+
+ var origSetLocalDescription =
+ window.RTCPeerConnection.prototype.setLocalDescription;
+ window.RTCPeerConnection.prototype.setLocalDescription = function() {
+ var pc = this;
+ if (!arguments.length || !arguments[0].type) {
+ return origSetLocalDescription.apply(pc, arguments);
+ }
+ arguments[0] = replaceExternalStreamId(pc, arguments[0]);
+ return origSetLocalDescription.apply(pc, arguments);
+ };
+
+ // TODO: mangle getStats: https://w3c.github.io/webrtc-stats/#dom-rtcmediastreamstats-streamidentifier
+
+ var origLocalDescription = Object.getOwnPropertyDescriptor(
+ window.RTCPeerConnection.prototype, 'localDescription');
+ Object.defineProperty(window.RTCPeerConnection.prototype,
+ 'localDescription', {
+ get: function() {
+ var pc = this;
+ var description = origLocalDescription.get.apply(this);
+ if (description.type === '') {
+ return description;
+ }
+ return replaceInternalStreamId(pc, description);
+ }
+ });
+
+ window.RTCPeerConnection.prototype.removeTrack = function(sender) {
+ var pc = this;
+ if (pc.signalingState === 'closed') {
+ throw new DOMException(
+ 'The RTCPeerConnection\'s signalingState is \'closed\'.',
+ 'InvalidStateError');
+ }
+ // We can not yet check for sender instanceof RTCRtpSender
+ // since we shim RTPSender. So we check if sender._pc is set.
+ if (!sender._pc) {
+ throw new DOMException('Argument 1 of RTCPeerConnection.removeTrack ' +
+ 'does not implement interface RTCRtpSender.', 'TypeError');
+ }
+ var isLocal = sender._pc === pc;
+ if (!isLocal) {
+ throw new DOMException('Sender was not created by this connection.',
+ 'InvalidAccessError');
+ }
+
+ // Search for the native stream the senders track belongs to.
+ pc._streams = pc._streams || {};
+ var stream;
+ Object.keys(pc._streams).forEach(function(streamid) {
+ var hasTrack = pc._streams[streamid].getTracks().find(function(track) {
+ return sender.track === track;
+ });
+ if (hasTrack) {
+ stream = pc._streams[streamid];
+ }
+ });
+
+ if (stream) {
+ if (stream.getTracks().length === 1) {
+ // if this is the last track of the stream, remove the stream. This
+ // takes care of any shimmed _senders.
+ pc.removeStream(pc._reverseStreams[stream.id]);
+ } else {
+ // relying on the same odd chrome behaviour as above.
+ stream.removeTrack(sender.track);
+ }
+ pc.dispatchEvent(new Event('negotiationneeded'));
+ }
+ };
+ },
+
+ shimPeerConnection: function(window) {
+ var browserDetails = utils.detectBrowser(window);
+
+ // The RTCPeerConnection object.
+ if (!window.RTCPeerConnection) {
+ window.RTCPeerConnection = function(pcConfig, pcConstraints) {
+ // Translate iceTransportPolicy to iceTransports,
+ // see https://code.google.com/p/webrtc/issues/detail?id=4869
+ // this was fixed in M56 along with unprefixing RTCPeerConnection.
+ logging('PeerConnection');
+ if (pcConfig && pcConfig.iceTransportPolicy) {
+ pcConfig.iceTransports = pcConfig.iceTransportPolicy;
+ }
+
+ return new window.webkitRTCPeerConnection(pcConfig, pcConstraints);
+ };
+ window.RTCPeerConnection.prototype =
+ window.webkitRTCPeerConnection.prototype;
+ // wrap static methods. Currently just generateCertificate.
+ if (window.webkitRTCPeerConnection.generateCertificate) {
+ Object.defineProperty(window.RTCPeerConnection, 'generateCertificate', {
+ get: function() {
+ return window.webkitRTCPeerConnection.generateCertificate;
+ }
+ });
+ }
+ } else {
+ // migrate from non-spec RTCIceServer.url to RTCIceServer.urls
+ var OrigPeerConnection = window.RTCPeerConnection;
+ window.RTCPeerConnection = function(pcConfig, pcConstraints) {
+ if (pcConfig && pcConfig.iceServers) {
+ var newIceServers = [];
+ for (var i = 0; i < pcConfig.iceServers.length; i++) {
+ var server = pcConfig.iceServers[i];
+ if (!server.hasOwnProperty('urls') &&
+ server.hasOwnProperty('url')) {
+ utils.deprecated('RTCIceServer.url', 'RTCIceServer.urls');
+ server = JSON.parse(JSON.stringify(server));
+ server.urls = server.url;
+ newIceServers.push(server);
+ } else {
+ newIceServers.push(pcConfig.iceServers[i]);
+ }
+ }
+ pcConfig.iceServers = newIceServers;
+ }
+ return new OrigPeerConnection(pcConfig, pcConstraints);
+ };
+ window.RTCPeerConnection.prototype = OrigPeerConnection.prototype;
+ // wrap static methods. Currently just generateCertificate.
+ Object.defineProperty(window.RTCPeerConnection, 'generateCertificate', {
+ get: function() {
+ return OrigPeerConnection.generateCertificate;
+ }
+ });
+ }
+
+ var origGetStats = window.RTCPeerConnection.prototype.getStats;
+ window.RTCPeerConnection.prototype.getStats = function(selector,
+ successCallback, errorCallback) {
+ var self = this;
+ var args = arguments;
+
+ // If selector is a function then we are in the old style stats so just
+ // pass back the original getStats format to avoid breaking old users.
+ if (arguments.length > 0 && typeof selector === 'function') {
+ return origGetStats.apply(this, arguments);
+ }
+
+ // When spec-style getStats is supported, return those when called with
+ // either no arguments or the selector argument is null.
+ if (origGetStats.length === 0 && (arguments.length === 0 ||
+ typeof arguments[0] !== 'function')) {
+ return origGetStats.apply(this, []);
+ }
+
+ var fixChromeStats_ = function(response) {
+ var standardReport = {};
+ var reports = response.result();
+ reports.forEach(function(report) {
+ var standardStats = {
+ id: report.id,
+ timestamp: report.timestamp,
+ type: {
+ localcandidate: 'local-candidate',
+ remotecandidate: 'remote-candidate'
+ }[report.type] || report.type
+ };
+ report.names().forEach(function(name) {
+ standardStats[name] = report.stat(name);
+ });
+ standardReport[standardStats.id] = standardStats;
+ });
+
+ return standardReport;
+ };
+
+ // shim getStats with maplike support
+ var makeMapStats = function(stats) {
+ return new Map(Object.keys(stats).map(function(key) {
+ return [key, stats[key]];
+ }));
+ };
+
+ if (arguments.length >= 2) {
+ var successCallbackWrapper_ = function(response) {
+ args[1](makeMapStats(fixChromeStats_(response)));
+ };
+
+ return origGetStats.apply(this, [successCallbackWrapper_,
+ arguments[0]]);
+ }
+
+ // promise-support
+ return new Promise(function(resolve, reject) {
+ origGetStats.apply(self, [
+ function(response) {
+ resolve(makeMapStats(fixChromeStats_(response)));
+ }, reject]);
+ }).then(successCallback, errorCallback);
+ };
+
+ // add promise support -- natively available in Chrome 51
+ if (browserDetails.version < 51) {
+ ['setLocalDescription', 'setRemoteDescription', 'addIceCandidate']
+ .forEach(function(method) {
+ var nativeMethod = window.RTCPeerConnection.prototype[method];
+ window.RTCPeerConnection.prototype[method] = function() {
+ var args = arguments;
+ var self = this;
+ var promise = new Promise(function(resolve, reject) {
+ nativeMethod.apply(self, [args[0], resolve, reject]);
+ });
+ if (args.length < 2) {
+ return promise;
+ }
+ return promise.then(function() {
+ args[1].apply(null, []);
+ },
+ function(err) {
+ if (args.length >= 3) {
+ args[2].apply(null, [err]);
+ }
+ });
+ };
+ });
+ }
+
+ // promise support for createOffer and createAnswer. Available (without
+ // bugs) since M52: crbug/619289
+ if (browserDetails.version < 52) {
+ ['createOffer', 'createAnswer'].forEach(function(method) {
+ var nativeMethod = window.RTCPeerConnection.prototype[method];
+ window.RTCPeerConnection.prototype[method] = function() {
+ var self = this;
+ if (arguments.length < 1 || (arguments.length === 1 &&
+ typeof arguments[0] === 'object')) {
+ var opts = arguments.length === 1 ? arguments[0] : undefined;
+ return new Promise(function(resolve, reject) {
+ nativeMethod.apply(self, [resolve, reject, opts]);
+ });
+ }
+ return nativeMethod.apply(this, arguments);
+ };
+ });
+ }
+
+ // shim implicit creation of RTCSessionDescription/RTCIceCandidate
+ ['setLocalDescription', 'setRemoteDescription', 'addIceCandidate']
+ .forEach(function(method) {
+ var nativeMethod = window.RTCPeerConnection.prototype[method];
+ window.RTCPeerConnection.prototype[method] = function() {
+ arguments[0] = new ((method === 'addIceCandidate') ?
+ window.RTCIceCandidate :
+ window.RTCSessionDescription)(arguments[0]);
+ return nativeMethod.apply(this, arguments);
+ };
+ });
+
+ // support for addIceCandidate(null or undefined)
+ var nativeAddIceCandidate =
+ window.RTCPeerConnection.prototype.addIceCandidate;
+ window.RTCPeerConnection.prototype.addIceCandidate = function() {
+ if (!arguments[0]) {
+ if (arguments[1]) {
+ arguments[1].apply(null);
+ }
+ return Promise.resolve();
+ }
+ return nativeAddIceCandidate.apply(this, arguments);
+ };
+ }
+};
+
+
+// Expose public methods.
+module.exports = {
+ shimMediaStream: chromeShim.shimMediaStream,
+ shimOnTrack: chromeShim.shimOnTrack,
+ shimAddTrackRemoveTrack: chromeShim.shimAddTrackRemoveTrack,
+ shimGetSendersWithDtmf: chromeShim.shimGetSendersWithDtmf,
+ shimSourceObject: chromeShim.shimSourceObject,
+ shimPeerConnection: chromeShim.shimPeerConnection,
+ shimGetUserMedia: require('./getusermedia')
+};
+
+},{"../utils.js":13,"./getusermedia":6}],6:[function(require,module,exports){
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+ /* eslint-env node */
+'use strict';
+var utils = require('../utils.js');
+var logging = utils.log;
+
+// Expose public methods.
+module.exports = function(window) {
+ var browserDetails = utils.detectBrowser(window);
+ var navigator = window && window.navigator;
+
+ var constraintsToChrome_ = function(c) {
+ if (typeof c !== 'object' || c.mandatory || c.optional) {
+ return c;
+ }
+ var cc = {};
+ Object.keys(c).forEach(function(key) {
+ if (key === 'require' || key === 'advanced' || key === 'mediaSource') {
+ return;
+ }
+ var r = (typeof c[key] === 'object') ? c[key] : {ideal: c[key]};
+ if (r.exact !== undefined && typeof r.exact === 'number') {
+ r.min = r.max = r.exact;
+ }
+ var oldname_ = function(prefix, name) {
+ if (prefix) {
+ return prefix + name.charAt(0).toUpperCase() + name.slice(1);
+ }
+ return (name === 'deviceId') ? 'sourceId' : name;
+ };
+ if (r.ideal !== undefined) {
+ cc.optional = cc.optional || [];
+ var oc = {};
+ if (typeof r.ideal === 'number') {
+ oc[oldname_('min', key)] = r.ideal;
+ cc.optional.push(oc);
+ oc = {};
+ oc[oldname_('max', key)] = r.ideal;
+ cc.optional.push(oc);
+ } else {
+ oc[oldname_('', key)] = r.ideal;
+ cc.optional.push(oc);
+ }
+ }
+ if (r.exact !== undefined && typeof r.exact !== 'number') {
+ cc.mandatory = cc.mandatory || {};
+ cc.mandatory[oldname_('', key)] = r.exact;
+ } else {
+ ['min', 'max'].forEach(function(mix) {
+ if (r[mix] !== undefined) {
+ cc.mandatory = cc.mandatory || {};
+ cc.mandatory[oldname_(mix, key)] = r[mix];
+ }
+ });
+ }
+ });
+ if (c.advanced) {
+ cc.optional = (cc.optional || []).concat(c.advanced);
+ }
+ return cc;
+ };
+
+ var shimConstraints_ = function(constraints, func) {
+ constraints = JSON.parse(JSON.stringify(constraints));
+ if (constraints && typeof constraints.audio === 'object') {
+ var remap = function(obj, a, b) {
+ if (a in obj && !(b in obj)) {
+ obj[b] = obj[a];
+ delete obj[a];
+ }
+ };
+ constraints = JSON.parse(JSON.stringify(constraints));
+ remap(constraints.audio, 'autoGainControl', 'googAutoGainControl');
+ remap(constraints.audio, 'noiseSuppression', 'googNoiseSuppression');
+ constraints.audio = constraintsToChrome_(constraints.audio);
+ }
+ if (constraints && typeof constraints.video === 'object') {
+ // Shim facingMode for mobile & surface pro.
+ var face = constraints.video.facingMode;
+ face = face && ((typeof face === 'object') ? face : {ideal: face});
+ var getSupportedFacingModeLies = browserDetails.version < 66;
+
+ if ((face && (face.exact === 'user' || face.exact === 'environment' ||
+ face.ideal === 'user' || face.ideal === 'environment')) &&
+ !(navigator.mediaDevices.getSupportedConstraints &&
+ navigator.mediaDevices.getSupportedConstraints().facingMode &&
+ !getSupportedFacingModeLies)) {
+ delete constraints.video.facingMode;
+ var matches;
+ if (face.exact === 'environment' || face.ideal === 'environment') {
+ matches = ['back', 'rear'];
+ } else if (face.exact === 'user' || face.ideal === 'user') {
+ matches = ['front'];
+ }
+ if (matches) {
+ // Look for matches in label, or use last cam for back (typical).
+ return navigator.mediaDevices.enumerateDevices()
+ .then(function(devices) {
+ devices = devices.filter(function(d) {
+ return d.kind === 'videoinput';
+ });
+ var dev = devices.find(function(d) {
+ return matches.some(function(match) {
+ return d.label.toLowerCase().indexOf(match) !== -1;
+ });
+ });
+ if (!dev && devices.length && matches.indexOf('back') !== -1) {
+ dev = devices[devices.length - 1]; // more likely the back cam
+ }
+ if (dev) {
+ constraints.video.deviceId = face.exact ? {exact: dev.deviceId} :
+ {ideal: dev.deviceId};
+ }
+ constraints.video = constraintsToChrome_(constraints.video);
+ logging('chrome: ' + JSON.stringify(constraints));
+ return func(constraints);
+ });
+ }
+ }
+ constraints.video = constraintsToChrome_(constraints.video);
+ }
+ logging('chrome: ' + JSON.stringify(constraints));
+ return func(constraints);
+ };
+
+ var shimError_ = function(e) {
+ return {
+ name: {
+ PermissionDeniedError: 'NotAllowedError',
+ InvalidStateError: 'NotReadableError',
+ DevicesNotFoundError: 'NotFoundError',
+ ConstraintNotSatisfiedError: 'OverconstrainedError',
+ TrackStartError: 'NotReadableError',
+ MediaDeviceFailedDueToShutdown: 'NotReadableError',
+ MediaDeviceKillSwitchOn: 'NotReadableError'
+ }[e.name] || e.name,
+ message: e.message,
+ constraint: e.constraintName,
+ toString: function() {
+ return this.name + (this.message && ': ') + this.message;
+ }
+ };
+ };
+
+ var getUserMedia_ = function(constraints, onSuccess, onError) {
+ shimConstraints_(constraints, function(c) {
+ navigator.webkitGetUserMedia(c, onSuccess, function(e) {
+ if (onError) {
+ onError(shimError_(e));
+ }
+ });
+ });
+ };
+
+ navigator.getUserMedia = getUserMedia_;
+
+ // Returns the result of getUserMedia as a Promise.
+ var getUserMediaPromise_ = function(constraints) {
+ return new Promise(function(resolve, reject) {
+ navigator.getUserMedia(constraints, resolve, reject);
+ });
+ };
+
+ if (!navigator.mediaDevices) {
+ navigator.mediaDevices = {
+ getUserMedia: getUserMediaPromise_,
+ enumerateDevices: function() {
+ return new Promise(function(resolve) {
+ var kinds = {audio: 'audioinput', video: 'videoinput'};
+ return window.MediaStreamTrack.getSources(function(devices) {
+ resolve(devices.map(function(device) {
+ return {label: device.label,
+ kind: kinds[device.kind],
+ deviceId: device.id,
+ groupId: ''};
+ }));
+ });
+ });
+ },
+ getSupportedConstraints: function() {
+ return {
+ deviceId: true, echoCancellation: true, facingMode: true,
+ frameRate: true, height: true, width: true
+ };
+ }
+ };
+ }
+
+ // A shim for getUserMedia method on the mediaDevices object.
+ // TODO(KaptenJansson) remove once implemented in Chrome stable.
+ if (!navigator.mediaDevices.getUserMedia) {
+ navigator.mediaDevices.getUserMedia = function(constraints) {
+ return getUserMediaPromise_(constraints);
+ };
+ } else {
+ // Even though Chrome 45 has navigator.mediaDevices and a getUserMedia
+ // function which returns a Promise, it does not accept spec-style
+ // constraints.
+ var origGetUserMedia = navigator.mediaDevices.getUserMedia.
+ bind(navigator.mediaDevices);
+ navigator.mediaDevices.getUserMedia = function(cs) {
+ return shimConstraints_(cs, function(c) {
+ return origGetUserMedia(c).then(function(stream) {
+ if (c.audio && !stream.getAudioTracks().length ||
+ c.video && !stream.getVideoTracks().length) {
+ stream.getTracks().forEach(function(track) {
+ track.stop();
+ });
+ throw new DOMException('', 'NotFoundError');
+ }
+ return stream;
+ }, function(e) {
+ return Promise.reject(shimError_(e));
+ });
+ });
+ };
+ }
+
+ // Dummy devicechange event methods.
+ // TODO(KaptenJansson) remove once implemented in Chrome stable.
+ if (typeof navigator.mediaDevices.addEventListener === 'undefined') {
+ navigator.mediaDevices.addEventListener = function() {
+ logging('Dummy mediaDevices.addEventListener called.');
+ };
+ }
+ if (typeof navigator.mediaDevices.removeEventListener === 'undefined') {
+ navigator.mediaDevices.removeEventListener = function() {
+ logging('Dummy mediaDevices.removeEventListener called.');
+ };
+ }
+};
+
+},{"../utils.js":13}],7:[function(require,module,exports){
+/*
+ * Copyright (c) 2017 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+ /* eslint-env node */
+'use strict';
+
+var SDPUtils = require('sdp');
+var utils = require('./utils');
+
+// Wraps the peerconnection event eventNameToWrap in a function
+// which returns the modified event object.
+function wrapPeerConnectionEvent(window, eventNameToWrap, wrapper) {
+ if (!window.RTCPeerConnection) {
+ return;
+ }
+ var proto = window.RTCPeerConnection.prototype;
+ var nativeAddEventListener = proto.addEventListener;
+ proto.addEventListener = function(nativeEventName, cb) {
+ if (nativeEventName !== eventNameToWrap) {
+ return nativeAddEventListener.apply(this, arguments);
+ }
+ var wrappedCallback = function(e) {
+ cb(wrapper(e));
+ };
+ this._eventMap = this._eventMap || {};
+ this._eventMap[cb] = wrappedCallback;
+ return nativeAddEventListener.apply(this, [nativeEventName,
+ wrappedCallback]);
+ };
+
+ var nativeRemoveEventListener = proto.removeEventListener;
+ proto.removeEventListener = function(nativeEventName, cb) {
+ if (nativeEventName !== eventNameToWrap || !this._eventMap
+ || !this._eventMap[cb]) {
+ return nativeRemoveEventListener.apply(this, arguments);
+ }
+ var unwrappedCb = this._eventMap[cb];
+ delete this._eventMap[cb];
+ return nativeRemoveEventListener.apply(this, [nativeEventName,
+ unwrappedCb]);
+ };
+
+ Object.defineProperty(proto, 'on' + eventNameToWrap, {
+ get: function() {
+ return this['_on' + eventNameToWrap];
+ },
+ set: function(cb) {
+ if (this['_on' + eventNameToWrap]) {
+ this.removeEventListener(eventNameToWrap,
+ this['_on' + eventNameToWrap]);
+ delete this['_on' + eventNameToWrap];
+ }
+ if (cb) {
+ this.addEventListener(eventNameToWrap,
+ this['_on' + eventNameToWrap] = cb);
+ }
+ }
+ });
+}
+
+module.exports = {
+ shimRTCIceCandidate: function(window) {
+ // foundation is arbitrarily chosen as an indicator for full support for
+ // https://w3c.github.io/webrtc-pc/#rtcicecandidate-interface
+ if (window.RTCIceCandidate && 'foundation' in
+ window.RTCIceCandidate.prototype) {
+ return;
+ }
+
+ var NativeRTCIceCandidate = window.RTCIceCandidate;
+ window.RTCIceCandidate = function(args) {
+ // Remove the a= which shouldn't be part of the candidate string.
+ if (typeof args === 'object' && args.candidate &&
+ args.candidate.indexOf('a=') === 0) {
+ args = JSON.parse(JSON.stringify(args));
+ args.candidate = args.candidate.substr(2);
+ }
+
+ // Augment the native candidate with the parsed fields.
+ var nativeCandidate = new NativeRTCIceCandidate(args);
+ var parsedCandidate = SDPUtils.parseCandidate(args.candidate);
+ var augmentedCandidate = Object.assign(nativeCandidate,
+ parsedCandidate);
+
+ // Add a serializer that does not serialize the extra attributes.
+ augmentedCandidate.toJSON = function() {
+ return {
+ candidate: augmentedCandidate.candidate,
+ sdpMid: augmentedCandidate.sdpMid,
+ sdpMLineIndex: augmentedCandidate.sdpMLineIndex,
+ usernameFragment: augmentedCandidate.usernameFragment,
+ };
+ };
+ return augmentedCandidate;
+ };
+
+ // Hook up the augmented candidate in onicecandidate and
+ // addEventListener('icecandidate', ...)
+ wrapPeerConnectionEvent(window, 'icecandidate', function(e) {
+ if (e.candidate) {
+ Object.defineProperty(e, 'candidate', {
+ value: new window.RTCIceCandidate(e.candidate),
+ writable: 'false'
+ });
+ }
+ return e;
+ });
+ },
+
+ // shimCreateObjectURL must be called before shimSourceObject to avoid loop.
+
+ shimCreateObjectURL: function(window) {
+ var URL = window && window.URL;
+
+ if (!(typeof window === 'object' && window.HTMLMediaElement &&
+ 'srcObject' in window.HTMLMediaElement.prototype &&
+ URL.createObjectURL && URL.revokeObjectURL)) {
+ // Only shim CreateObjectURL using srcObject if srcObject exists.
+ return undefined;
+ }
+
+ var nativeCreateObjectURL = URL.createObjectURL.bind(URL);
+ var nativeRevokeObjectURL = URL.revokeObjectURL.bind(URL);
+ var streams = new Map(), newId = 0;
+
+ URL.createObjectURL = function(stream) {
+ if ('getTracks' in stream) {
+ var url = 'polyblob:' + (++newId);
+ streams.set(url, stream);
+ utils.deprecated('URL.createObjectURL(stream)',
+ 'elem.srcObject = stream');
+ return url;
+ }
+ return nativeCreateObjectURL(stream);
+ };
+ URL.revokeObjectURL = function(url) {
+ nativeRevokeObjectURL(url);
+ streams.delete(url);
+ };
+
+ var dsc = Object.getOwnPropertyDescriptor(window.HTMLMediaElement.prototype,
+ 'src');
+ Object.defineProperty(window.HTMLMediaElement.prototype, 'src', {
+ get: function() {
+ return dsc.get.apply(this);
+ },
+ set: function(url) {
+ this.srcObject = streams.get(url) || null;
+ return dsc.set.apply(this, [url]);
+ }
+ });
+
+ var nativeSetAttribute = window.HTMLMediaElement.prototype.setAttribute;
+ window.HTMLMediaElement.prototype.setAttribute = function() {
+ if (arguments.length === 2 &&
+ ('' + arguments[0]).toLowerCase() === 'src') {
+ this.srcObject = streams.get(arguments[1]) || null;
+ }
+ return nativeSetAttribute.apply(this, arguments);
+ };
+ }
+};
+
+},{"./utils":13,"sdp":2}],8:[function(require,module,exports){
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+ /* eslint-env node */
+'use strict';
+
+var utils = require('../utils');
+var shimRTCPeerConnection = require('rtcpeerconnection-shim');
+
+module.exports = {
+ shimGetUserMedia: require('./getusermedia'),
+ shimPeerConnection: function(window) {
+ var browserDetails = utils.detectBrowser(window);
+
+ if (window.RTCIceGatherer) {
+ // ORTC defines an RTCIceCandidate object but no constructor.
+ // Not implemented in Edge.
+ if (!window.RTCIceCandidate) {
+ window.RTCIceCandidate = function(args) {
+ return args;
+ };
+ }
+ // ORTC does not have a session description object but
+ // other browsers (i.e. Chrome) that will support both PC and ORTC
+ // in the future might have this defined already.
+ if (!window.RTCSessionDescription) {
+ window.RTCSessionDescription = function(args) {
+ return args;
+ };
+ }
+ // this adds an additional event listener to MediaStrackTrack that signals
+ // when a tracks enabled property was changed. Workaround for a bug in
+ // addStream, see below. No longer required in 15025+
+ if (browserDetails.version < 15025) {
+ var origMSTEnabled = Object.getOwnPropertyDescriptor(
+ window.MediaStreamTrack.prototype, 'enabled');
+ Object.defineProperty(window.MediaStreamTrack.prototype, 'enabled', {
+ set: function(value) {
+ origMSTEnabled.set.call(this, value);
+ var ev = new Event('enabled');
+ ev.enabled = value;
+ this.dispatchEvent(ev);
+ }
+ });
+ }
+ }
+
+ // ORTC defines the DTMF sender a bit different.
+ // https://github.com/w3c/ortc/issues/714
+ if (window.RTCRtpSender && !('dtmf' in window.RTCRtpSender.prototype)) {
+ Object.defineProperty(window.RTCRtpSender.prototype, 'dtmf', {
+ get: function() {
+ if (this._dtmf === undefined) {
+ if (this.track.kind === 'audio') {
+ this._dtmf = new window.RTCDtmfSender(this);
+ } else if (this.track.kind === 'video') {
+ this._dtmf = null;
+ }
+ }
+ return this._dtmf;
+ }
+ });
+ }
+
+ window.RTCPeerConnection =
+ shimRTCPeerConnection(window, browserDetails.version);
+ },
+ shimReplaceTrack: function(window) {
+ // ORTC has replaceTrack -- https://github.com/w3c/ortc/issues/614
+ if (window.RTCRtpSender &&
+ !('replaceTrack' in window.RTCRtpSender.prototype)) {
+ window.RTCRtpSender.prototype.replaceTrack =
+ window.RTCRtpSender.prototype.setTrack;
+ }
+ }
+};
+
+},{"../utils":13,"./getusermedia":9,"rtcpeerconnection-shim":1}],9:[function(require,module,exports){
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+ /* eslint-env node */
+'use strict';
+
+// Expose public methods.
+module.exports = function(window) {
+ var navigator = window && window.navigator;
+
+ var shimError_ = function(e) {
+ return {
+ name: {PermissionDeniedError: 'NotAllowedError'}[e.name] || e.name,
+ message: e.message,
+ constraint: e.constraint,
+ toString: function() {
+ return this.name;
+ }
+ };
+ };
+
+ // getUserMedia error shim.
+ var origGetUserMedia = navigator.mediaDevices.getUserMedia.
+ bind(navigator.mediaDevices);
+ navigator.mediaDevices.getUserMedia = function(c) {
+ return origGetUserMedia(c).catch(function(e) {
+ return Promise.reject(shimError_(e));
+ });
+ };
+};
+
+},{}],10:[function(require,module,exports){
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+ /* eslint-env node */
+'use strict';
+
+var utils = require('../utils');
+
+var firefoxShim = {
+ shimOnTrack: function(window) {
+ if (typeof window === 'object' && window.RTCPeerConnection && !('ontrack' in
+ window.RTCPeerConnection.prototype)) {
+ Object.defineProperty(window.RTCPeerConnection.prototype, 'ontrack', {
+ get: function() {
+ return this._ontrack;
+ },
+ set: function(f) {
+ if (this._ontrack) {
+ this.removeEventListener('track', this._ontrack);
+ this.removeEventListener('addstream', this._ontrackpoly);
+ }
+ this.addEventListener('track', this._ontrack = f);
+ this.addEventListener('addstream', this._ontrackpoly = function(e) {
+ e.stream.getTracks().forEach(function(track) {
+ var event = new Event('track');
+ event.track = track;
+ event.receiver = {track: track};
+ event.transceiver = {receiver: event.receiver};
+ event.streams = [e.stream];
+ this.dispatchEvent(event);
+ }.bind(this));
+ }.bind(this));
+ }
+ });
+ }
+ if (typeof window === 'object' && window.RTCTrackEvent &&
+ ('receiver' in window.RTCTrackEvent.prototype) &&
+ !('transceiver' in window.RTCTrackEvent.prototype)) {
+ Object.defineProperty(window.RTCTrackEvent.prototype, 'transceiver', {
+ get: function() {
+ return {receiver: this.receiver};
+ }
+ });
+ }
+ },
+
+ shimSourceObject: function(window) {
+ // Firefox has supported mozSrcObject since FF22, unprefixed in 42.
+ if (typeof window === 'object') {
+ if (window.HTMLMediaElement &&
+ !('srcObject' in window.HTMLMediaElement.prototype)) {
+ // Shim the srcObject property, once, when HTMLMediaElement is found.
+ Object.defineProperty(window.HTMLMediaElement.prototype, 'srcObject', {
+ get: function() {
+ return this.mozSrcObject;
+ },
+ set: function(stream) {
+ this.mozSrcObject = stream;
+ }
+ });
+ }
+ }
+ },
+
+ shimPeerConnection: function(window) {
+ var browserDetails = utils.detectBrowser(window);
+
+ if (typeof window !== 'object' || !(window.RTCPeerConnection ||
+ window.mozRTCPeerConnection)) {
+ return; // probably media.peerconnection.enabled=false in about:config
+ }
+ // The RTCPeerConnection object.
+ if (!window.RTCPeerConnection) {
+ window.RTCPeerConnection = function(pcConfig, pcConstraints) {
+ if (browserDetails.version < 38) {
+ // .urls is not supported in FF < 38.
+ // create RTCIceServers with a single url.
+ if (pcConfig && pcConfig.iceServers) {
+ var newIceServers = [];
+ for (var i = 0; i < pcConfig.iceServers.length; i++) {
+ var server = pcConfig.iceServers[i];
+ if (server.hasOwnProperty('urls')) {
+ for (var j = 0; j < server.urls.length; j++) {
+ var newServer = {
+ url: server.urls[j]
+ };
+ if (server.urls[j].indexOf('turn') === 0) {
+ newServer.username = server.username;
+ newServer.credential = server.credential;
+ }
+ newIceServers.push(newServer);
+ }
+ } else {
+ newIceServers.push(pcConfig.iceServers[i]);
+ }
+ }
+ pcConfig.iceServers = newIceServers;
+ }
+ }
+ return new window.mozRTCPeerConnection(pcConfig, pcConstraints);
+ };
+ window.RTCPeerConnection.prototype =
+ window.mozRTCPeerConnection.prototype;
+
+ // wrap static methods. Currently just generateCertificate.
+ if (window.mozRTCPeerConnection.generateCertificate) {
+ Object.defineProperty(window.RTCPeerConnection, 'generateCertificate', {
+ get: function() {
+ return window.mozRTCPeerConnection.generateCertificate;
+ }
+ });
+ }
+
+ window.RTCSessionDescription = window.mozRTCSessionDescription;
+ window.RTCIceCandidate = window.mozRTCIceCandidate;
+ }
+
+ // shim away need for obsolete RTCIceCandidate/RTCSessionDescription.
+ ['setLocalDescription', 'setRemoteDescription', 'addIceCandidate']
+ .forEach(function(method) {
+ var nativeMethod = window.RTCPeerConnection.prototype[method];
+ window.RTCPeerConnection.prototype[method] = function() {
+ arguments[0] = new ((method === 'addIceCandidate') ?
+ window.RTCIceCandidate :
+ window.RTCSessionDescription)(arguments[0]);
+ return nativeMethod.apply(this, arguments);
+ };
+ });
+
+ // support for addIceCandidate(null or undefined)
+ var nativeAddIceCandidate =
+ window.RTCPeerConnection.prototype.addIceCandidate;
+ window.RTCPeerConnection.prototype.addIceCandidate = function() {
+ if (!arguments[0]) {
+ if (arguments[1]) {
+ arguments[1].apply(null);
+ }
+ return Promise.resolve();
+ }
+ return nativeAddIceCandidate.apply(this, arguments);
+ };
+
+ // shim getStats with maplike support
+ var makeMapStats = function(stats) {
+ var map = new Map();
+ Object.keys(stats).forEach(function(key) {
+ map.set(key, stats[key]);
+ map[key] = stats[key];
+ });
+ return map;
+ };
+
+ var modernStatsTypes = {
+ inboundrtp: 'inbound-rtp',
+ outboundrtp: 'outbound-rtp',
+ candidatepair: 'candidate-pair',
+ localcandidate: 'local-candidate',
+ remotecandidate: 'remote-candidate'
+ };
+
+ var nativeGetStats = window.RTCPeerConnection.prototype.getStats;
+ window.RTCPeerConnection.prototype.getStats = function(
+ selector,
+ onSucc,
+ onErr
+ ) {
+ return nativeGetStats.apply(this, [selector || null])
+ .then(function(stats) {
+ if (browserDetails.version < 48) {
+ stats = makeMapStats(stats);
+ }
+ if (browserDetails.version < 53 && !onSucc) {
+ // Shim only promise getStats with spec-hyphens in type names
+ // Leave callback version alone; misc old uses of forEach before Map
+ try {
+ stats.forEach(function(stat) {
+ stat.type = modernStatsTypes[stat.type] || stat.type;
+ });
+ } catch (e) {
+ if (e.name !== 'TypeError') {
+ throw e;
+ }
+ // Avoid TypeError: "type" is read-only, in old versions. 34-43ish
+ stats.forEach(function(stat, i) {
+ stats.set(i, Object.assign({}, stat, {
+ type: modernStatsTypes[stat.type] || stat.type
+ }));
+ });
+ }
+ }
+ return stats;
+ })
+ .then(onSucc, onErr);
+ };
+ }
+};
+
+// Expose public methods.
+module.exports = {
+ shimOnTrack: firefoxShim.shimOnTrack,
+ shimSourceObject: firefoxShim.shimSourceObject,
+ shimPeerConnection: firefoxShim.shimPeerConnection,
+ shimGetUserMedia: require('./getusermedia')
+};
+
+},{"../utils":13,"./getusermedia":11}],11:[function(require,module,exports){
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+ /* eslint-env node */
+'use strict';
+
+var utils = require('../utils');
+var logging = utils.log;
+
+// Expose public methods.
+module.exports = function(window) {
+ var browserDetails = utils.detectBrowser(window);
+ var navigator = window && window.navigator;
+ var MediaStreamTrack = window && window.MediaStreamTrack;
+
+ var shimError_ = function(e) {
+ return {
+ name: {
+ InternalError: 'NotReadableError',
+ NotSupportedError: 'TypeError',
+ PermissionDeniedError: 'NotAllowedError',
+ SecurityError: 'NotAllowedError'
+ }[e.name] || e.name,
+ message: {
+ 'The operation is insecure.': 'The request is not allowed by the ' +
+ 'user agent or the platform in the current context.'
+ }[e.message] || e.message,
+ constraint: e.constraint,
+ toString: function() {
+ return this.name + (this.message && ': ') + this.message;
+ }
+ };
+ };
+
+ // getUserMedia constraints shim.
+ var getUserMedia_ = function(constraints, onSuccess, onError) {
+ var constraintsToFF37_ = function(c) {
+ if (typeof c !== 'object' || c.require) {
+ return c;
+ }
+ var require = [];
+ Object.keys(c).forEach(function(key) {
+ if (key === 'require' || key === 'advanced' || key === 'mediaSource') {
+ return;
+ }
+ var r = c[key] = (typeof c[key] === 'object') ?
+ c[key] : {ideal: c[key]};
+ if (r.min !== undefined ||
+ r.max !== undefined || r.exact !== undefined) {
+ require.push(key);
+ }
+ if (r.exact !== undefined) {
+ if (typeof r.exact === 'number') {
+ r. min = r.max = r.exact;
+ } else {
+ c[key] = r.exact;
+ }
+ delete r.exact;
+ }
+ if (r.ideal !== undefined) {
+ c.advanced = c.advanced || [];
+ var oc = {};
+ if (typeof r.ideal === 'number') {
+ oc[key] = {min: r.ideal, max: r.ideal};
+ } else {
+ oc[key] = r.ideal;
+ }
+ c.advanced.push(oc);
+ delete r.ideal;
+ if (!Object.keys(r).length) {
+ delete c[key];
+ }
+ }
+ });
+ if (require.length) {
+ c.require = require;
+ }
+ return c;
+ };
+ constraints = JSON.parse(JSON.stringify(constraints));
+ if (browserDetails.version < 38) {
+ logging('spec: ' + JSON.stringify(constraints));
+ if (constraints.audio) {
+ constraints.audio = constraintsToFF37_(constraints.audio);
+ }
+ if (constraints.video) {
+ constraints.video = constraintsToFF37_(constraints.video);
+ }
+ logging('ff37: ' + JSON.stringify(constraints));
+ }
+ return navigator.mozGetUserMedia(constraints, onSuccess, function(e) {
+ onError(shimError_(e));
+ });
+ };
+
+ // Returns the result of getUserMedia as a Promise.
+ var getUserMediaPromise_ = function(constraints) {
+ return new Promise(function(resolve, reject) {
+ getUserMedia_(constraints, resolve, reject);
+ });
+ };
+
+ // Shim for mediaDevices on older versions.
+ if (!navigator.mediaDevices) {
+ navigator.mediaDevices = {getUserMedia: getUserMediaPromise_,
+ addEventListener: function() { },
+ removeEventListener: function() { }
+ };
+ }
+ navigator.mediaDevices.enumerateDevices =
+ navigator.mediaDevices.enumerateDevices || function() {
+ return new Promise(function(resolve) {
+ var infos = [
+ {kind: 'audioinput', deviceId: 'default', label: '', groupId: ''},
+ {kind: 'videoinput', deviceId: 'default', label: '', groupId: ''}
+ ];
+ resolve(infos);
+ });
+ };
+
+ if (browserDetails.version < 41) {
+ // Work around http://bugzil.la/1169665
+ var orgEnumerateDevices =
+ navigator.mediaDevices.enumerateDevices.bind(navigator.mediaDevices);
+ navigator.mediaDevices.enumerateDevices = function() {
+ return orgEnumerateDevices().then(undefined, function(e) {
+ if (e.name === 'NotFoundError') {
+ return [];
+ }
+ throw e;
+ });
+ };
+ }
+ if (browserDetails.version < 49) {
+ var origGetUserMedia = navigator.mediaDevices.getUserMedia.
+ bind(navigator.mediaDevices);
+ navigator.mediaDevices.getUserMedia = function(c) {
+ return origGetUserMedia(c).then(function(stream) {
+ // Work around https://bugzil.la/802326
+ if (c.audio && !stream.getAudioTracks().length ||
+ c.video && !stream.getVideoTracks().length) {
+ stream.getTracks().forEach(function(track) {
+ track.stop();
+ });
+ throw new DOMException('The object can not be found here.',
+ 'NotFoundError');
+ }
+ return stream;
+ }, function(e) {
+ return Promise.reject(shimError_(e));
+ });
+ };
+ }
+ if (!(browserDetails.version > 55 &&
+ 'autoGainControl' in navigator.mediaDevices.getSupportedConstraints())) {
+ var remap = function(obj, a, b) {
+ if (a in obj && !(b in obj)) {
+ obj[b] = obj[a];
+ delete obj[a];
+ }
+ };
+
+ var nativeGetUserMedia = navigator.mediaDevices.getUserMedia.
+ bind(navigator.mediaDevices);
+ navigator.mediaDevices.getUserMedia = function(c) {
+ if (typeof c === 'object' && typeof c.audio === 'object') {
+ c = JSON.parse(JSON.stringify(c));
+ remap(c.audio, 'autoGainControl', 'mozAutoGainControl');
+ remap(c.audio, 'noiseSuppression', 'mozNoiseSuppression');
+ }
+ return nativeGetUserMedia(c);
+ };
+
+ if (MediaStreamTrack && MediaStreamTrack.prototype.getSettings) {
+ var nativeGetSettings = MediaStreamTrack.prototype.getSettings;
+ MediaStreamTrack.prototype.getSettings = function() {
+ var obj = nativeGetSettings.apply(this, arguments);
+ remap(obj, 'mozAutoGainControl', 'autoGainControl');
+ remap(obj, 'mozNoiseSuppression', 'noiseSuppression');
+ return obj;
+ };
+ }
+
+ if (MediaStreamTrack && MediaStreamTrack.prototype.applyConstraints) {
+ var nativeApplyConstraints = MediaStreamTrack.prototype.applyConstraints;
+ MediaStreamTrack.prototype.applyConstraints = function(c) {
+ if (this.kind === 'audio' && typeof c === 'object') {
+ c = JSON.parse(JSON.stringify(c));
+ remap(c, 'autoGainControl', 'mozAutoGainControl');
+ remap(c, 'noiseSuppression', 'mozNoiseSuppression');
+ }
+ return nativeApplyConstraints.apply(this, [c]);
+ };
+ }
+ }
+ navigator.getUserMedia = function(constraints, onSuccess, onError) {
+ if (browserDetails.version < 44) {
+ return getUserMedia_(constraints, onSuccess, onError);
+ }
+ // Replace Firefox 44+'s deprecation warning with unprefixed version.
+ utils.deprecated('navigator.getUserMedia',
+ 'navigator.mediaDevices.getUserMedia');
+ navigator.mediaDevices.getUserMedia(constraints).then(onSuccess, onError);
+ };
+};
+
+},{"../utils":13}],12:[function(require,module,exports){
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+'use strict';
+var utils = require('../utils');
+
+var safariShim = {
+ // TODO: DrAlex, should be here, double check against LayoutTests
+
+ // TODO: once the back-end for the mac port is done, add.
+ // TODO: check for webkitGTK+
+ // shimPeerConnection: function() { },
+
+ shimLocalStreamsAPI: function(window) {
+ if (typeof window !== 'object' || !window.RTCPeerConnection) {
+ return;
+ }
+ if (!('getLocalStreams' in window.RTCPeerConnection.prototype)) {
+ window.RTCPeerConnection.prototype.getLocalStreams = function() {
+ if (!this._localStreams) {
+ this._localStreams = [];
+ }
+ return this._localStreams;
+ };
+ }
+ if (!('getStreamById' in window.RTCPeerConnection.prototype)) {
+ window.RTCPeerConnection.prototype.getStreamById = function(id) {
+ var result = null;
+ if (this._localStreams) {
+ this._localStreams.forEach(function(stream) {
+ if (stream.id === id) {
+ result = stream;
+ }
+ });
+ }
+ if (this._remoteStreams) {
+ this._remoteStreams.forEach(function(stream) {
+ if (stream.id === id) {
+ result = stream;
+ }
+ });
+ }
+ return result;
+ };
+ }
+ if (!('addStream' in window.RTCPeerConnection.prototype)) {
+ var _addTrack = window.RTCPeerConnection.prototype.addTrack;
+ window.RTCPeerConnection.prototype.addStream = function(stream) {
+ if (!this._localStreams) {
+ this._localStreams = [];
+ }
+ if (this._localStreams.indexOf(stream) === -1) {
+ this._localStreams.push(stream);
+ }
+ var self = this;
+ stream.getTracks().forEach(function(track) {
+ _addTrack.call(self, track, stream);
+ });
+ };
+
+ window.RTCPeerConnection.prototype.addTrack = function(track, stream) {
+ if (stream) {
+ if (!this._localStreams) {
+ this._localStreams = [stream];
+ } else if (this._localStreams.indexOf(stream) === -1) {
+ this._localStreams.push(stream);
+ }
+ }
+ _addTrack.call(this, track, stream);
+ };
+ }
+ if (!('removeStream' in window.RTCPeerConnection.prototype)) {
+ window.RTCPeerConnection.prototype.removeStream = function(stream) {
+ if (!this._localStreams) {
+ this._localStreams = [];
+ }
+ var index = this._localStreams.indexOf(stream);
+ if (index === -1) {
+ return;
+ }
+ this._localStreams.splice(index, 1);
+ var self = this;
+ var tracks = stream.getTracks();
+ this.getSenders().forEach(function(sender) {
+ if (tracks.indexOf(sender.track) !== -1) {
+ self.removeTrack(sender);
+ }
+ });
+ };
+ }
+ },
+ shimRemoteStreamsAPI: function(window) {
+ if (typeof window !== 'object' || !window.RTCPeerConnection) {
+ return;
+ }
+ if (!('getRemoteStreams' in window.RTCPeerConnection.prototype)) {
+ window.RTCPeerConnection.prototype.getRemoteStreams = function() {
+ return this._remoteStreams ? this._remoteStreams : [];
+ };
+ }
+ if (!('onaddstream' in window.RTCPeerConnection.prototype)) {
+ Object.defineProperty(window.RTCPeerConnection.prototype, 'onaddstream', {
+ get: function() {
+ return this._onaddstream;
+ },
+ set: function(f) {
+ if (this._onaddstream) {
+ this.removeEventListener('addstream', this._onaddstream);
+ this.removeEventListener('track', this._onaddstreampoly);
+ }
+ this.addEventListener('addstream', this._onaddstream = f);
+ this.addEventListener('track', this._onaddstreampoly = function(e) {
+ var stream = e.streams[0];
+ if (!this._remoteStreams) {
+ this._remoteStreams = [];
+ }
+ if (this._remoteStreams.indexOf(stream) >= 0) {
+ return;
+ }
+ this._remoteStreams.push(stream);
+ var event = new Event('addstream');
+ event.stream = e.streams[0];
+ this.dispatchEvent(event);
+ }.bind(this));
+ }
+ });
+ }
+ },
+ shimCallbacksAPI: function(window) {
+ if (typeof window !== 'object' || !window.RTCPeerConnection) {
+ return;
+ }
+ var prototype = window.RTCPeerConnection.prototype;
+ var createOffer = prototype.createOffer;
+ var createAnswer = prototype.createAnswer;
+ var setLocalDescription = prototype.setLocalDescription;
+ var setRemoteDescription = prototype.setRemoteDescription;
+ var addIceCandidate = prototype.addIceCandidate;
+
+ prototype.createOffer = function(successCallback, failureCallback) {
+ var options = (arguments.length >= 2) ? arguments[2] : arguments[0];
+ var promise = createOffer.apply(this, [options]);
+ if (!failureCallback) {
+ return promise;
+ }
+ promise.then(successCallback, failureCallback);
+ return Promise.resolve();
+ };
+
+ prototype.createAnswer = function(successCallback, failureCallback) {
+ var options = (arguments.length >= 2) ? arguments[2] : arguments[0];
+ var promise = createAnswer.apply(this, [options]);
+ if (!failureCallback) {
+ return promise;
+ }
+ promise.then(successCallback, failureCallback);
+ return Promise.resolve();
+ };
+
+ var withCallback = function(description, successCallback, failureCallback) {
+ var promise = setLocalDescription.apply(this, [description]);
+ if (!failureCallback) {
+ return promise;
+ }
+ promise.then(successCallback, failureCallback);
+ return Promise.resolve();
+ };
+ prototype.setLocalDescription = withCallback;
+
+ withCallback = function(description, successCallback, failureCallback) {
+ var promise = setRemoteDescription.apply(this, [description]);
+ if (!failureCallback) {
+ return promise;
+ }
+ promise.then(successCallback, failureCallback);
+ return Promise.resolve();
+ };
+ prototype.setRemoteDescription = withCallback;
+
+ withCallback = function(candidate, successCallback, failureCallback) {
+ var promise = addIceCandidate.apply(this, [candidate]);
+ if (!failureCallback) {
+ return promise;
+ }
+ promise.then(successCallback, failureCallback);
+ return Promise.resolve();
+ };
+ prototype.addIceCandidate = withCallback;
+ },
+ shimGetUserMedia: function(window) {
+ var navigator = window && window.navigator;
+
+ if (!navigator.getUserMedia) {
+ if (navigator.webkitGetUserMedia) {
+ navigator.getUserMedia = navigator.webkitGetUserMedia.bind(navigator);
+ } else if (navigator.mediaDevices &&
+ navigator.mediaDevices.getUserMedia) {
+ navigator.getUserMedia = function(constraints, cb, errcb) {
+ navigator.mediaDevices.getUserMedia(constraints)
+ .then(cb, errcb);
+ }.bind(navigator);
+ }
+ }
+ },
+ shimRTCIceServerUrls: function(window) {
+ // migrate from non-spec RTCIceServer.url to RTCIceServer.urls
+ var OrigPeerConnection = window.RTCPeerConnection;
+ window.RTCPeerConnection = function(pcConfig, pcConstraints) {
+ if (pcConfig && pcConfig.iceServers) {
+ var newIceServers = [];
+ for (var i = 0; i < pcConfig.iceServers.length; i++) {
+ var server = pcConfig.iceServers[i];
+ if (!server.hasOwnProperty('urls') &&
+ server.hasOwnProperty('url')) {
+ utils.deprecated('RTCIceServer.url', 'RTCIceServer.urls');
+ server = JSON.parse(JSON.stringify(server));
+ server.urls = server.url;
+ delete server.url;
+ newIceServers.push(server);
+ } else {
+ newIceServers.push(pcConfig.iceServers[i]);
+ }
+ }
+ pcConfig.iceServers = newIceServers;
+ }
+ return new OrigPeerConnection(pcConfig, pcConstraints);
+ };
+ window.RTCPeerConnection.prototype = OrigPeerConnection.prototype;
+ // wrap static methods. Currently just generateCertificate.
+ if ('generateCertificate' in window.RTCPeerConnection) {
+ Object.defineProperty(window.RTCPeerConnection, 'generateCertificate', {
+ get: function() {
+ return OrigPeerConnection.generateCertificate;
+ }
+ });
+ }
+ },
+ shimTrackEventTransceiver: function(window) {
+ // Add event.transceiver member over deprecated event.receiver
+ if (typeof window === 'object' && window.RTCPeerConnection &&
+ ('receiver' in window.RTCTrackEvent.prototype) &&
+ // can't check 'transceiver' in window.RTCTrackEvent.prototype, as it is
+ // defined for some reason even when window.RTCTransceiver is not.
+ !window.RTCTransceiver) {
+ Object.defineProperty(window.RTCTrackEvent.prototype, 'transceiver', {
+ get: function() {
+ return {receiver: this.receiver};
+ }
+ });
+ }
+ },
+
+ shimCreateOfferLegacy: function(window) {
+ var origCreateOffer = window.RTCPeerConnection.prototype.createOffer;
+ window.RTCPeerConnection.prototype.createOffer = function(offerOptions) {
+ var pc = this;
+ if (offerOptions) {
+ var audioTransceiver = pc.getTransceivers().find(function(transceiver) {
+ return transceiver.sender.track &&
+ transceiver.sender.track.kind === 'audio';
+ });
+ if (offerOptions.offerToReceiveAudio === false && audioTransceiver) {
+ if (audioTransceiver.direction === 'sendrecv') {
+ audioTransceiver.setDirection('sendonly');
+ } else if (audioTransceiver.direction === 'recvonly') {
+ audioTransceiver.setDirection('inactive');
+ }
+ } else if (offerOptions.offerToReceiveAudio === true &&
+ !audioTransceiver) {
+ pc.addTransceiver('audio');
+ }
+
+ var videoTransceiver = pc.getTransceivers().find(function(transceiver) {
+ return transceiver.sender.track &&
+ transceiver.sender.track.kind === 'video';
+ });
+ if (offerOptions.offerToReceiveVideo === false && videoTransceiver) {
+ if (videoTransceiver.direction === 'sendrecv') {
+ videoTransceiver.setDirection('sendonly');
+ } else if (videoTransceiver.direction === 'recvonly') {
+ videoTransceiver.setDirection('inactive');
+ }
+ } else if (offerOptions.offerToReceiveVideo === true &&
+ !videoTransceiver) {
+ pc.addTransceiver('video');
+ }
+ }
+ return origCreateOffer.apply(pc, arguments);
+ };
+ }
+};
+
+// Expose public methods.
+module.exports = {
+ shimCallbacksAPI: safariShim.shimCallbacksAPI,
+ shimLocalStreamsAPI: safariShim.shimLocalStreamsAPI,
+ shimRemoteStreamsAPI: safariShim.shimRemoteStreamsAPI,
+ shimGetUserMedia: safariShim.shimGetUserMedia,
+ shimRTCIceServerUrls: safariShim.shimRTCIceServerUrls,
+ shimTrackEventTransceiver: safariShim.shimTrackEventTransceiver,
+ shimCreateOfferLegacy: safariShim.shimCreateOfferLegacy
+ // TODO
+ // shimPeerConnection: safariShim.shimPeerConnection
+};
+
+},{"../utils":13}],13:[function(require,module,exports){
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+ /* eslint-env node */
+'use strict';
+
+var logDisabled_ = true;
+var deprecationWarnings_ = true;
+
+// Utility methods.
+var utils = {
+ disableLog: function(bool) {
+ if (typeof bool !== 'boolean') {
+ return new Error('Argument type: ' + typeof bool +
+ '. Please use a boolean.');
+ }
+ logDisabled_ = bool;
+ return (bool) ? 'adapter.js logging disabled' :
+ 'adapter.js logging enabled';
+ },
+
+ /**
+ * Disable or enable deprecation warnings
+ * @param {!boolean} bool set to true to disable warnings.
+ */
+ disableWarnings: function(bool) {
+ if (typeof bool !== 'boolean') {
+ return new Error('Argument type: ' + typeof bool +
+ '. Please use a boolean.');
+ }
+ deprecationWarnings_ = !bool;
+ return 'adapter.js deprecation warnings ' + (bool ? 'disabled' : 'enabled');
+ },
+
+ log: function() {
+ if (typeof window === 'object') {
+ if (logDisabled_) {
+ return;
+ }
+ if (typeof console !== 'undefined' && typeof console.log === 'function') {
+ console.log.apply(console, arguments);
+ }
+ }
+ },
+
+ /**
+ * Shows a deprecation warning suggesting the modern and spec-compatible API.
+ */
+ deprecated: function(oldMethod, newMethod) {
+ if (!deprecationWarnings_) {
+ return;
+ }
+ console.warn(oldMethod + ' is deprecated, please use ' + newMethod +
+ ' instead.');
+ },
+
+ /**
+ * Extract browser version out of the provided user agent string.
+ *
+ * @param {!string} uastring userAgent string.
+ * @param {!string} expr Regular expression used as match criteria.
+ * @param {!number} pos position in the version string to be returned.
+ * @return {!number} browser version.
+ */
+ extractVersion: function(uastring, expr, pos) {
+ var match = uastring.match(expr);
+ return match && match.length >= pos && parseInt(match[pos], 10);
+ },
+
+ /**
+ * Browser detector.
+ *
+ * @return {object} result containing browser and version
+ * properties.
+ */
+ detectBrowser: function(window) {
+ var navigator = window && window.navigator;
+
+ // Returned result object.
+ var result = {};
+ result.browser = null;
+ result.version = null;
+
+ // Fail early if it's not a browser
+ if (typeof window === 'undefined' || !window.navigator) {
+ result.browser = 'Not a browser.';
+ return result;
+ }
+
+ // Firefox.
+ if (navigator.mozGetUserMedia) {
+ result.browser = 'firefox';
+ result.version = this.extractVersion(navigator.userAgent,
+ /Firefox\/(\d+)\./, 1);
+ } else if (navigator.webkitGetUserMedia) {
+ // Chrome, Chromium, Webview, Opera, all use the chrome shim for now
+ if (window.webkitRTCPeerConnection) {
+ result.browser = 'chrome';
+ result.version = this.extractVersion(navigator.userAgent,
+ /Chrom(e|ium)\/(\d+)\./, 2);
+ } else { // Safari (in an unpublished version) or unknown webkit-based.
+ if (navigator.userAgent.match(/Version\/(\d+).(\d+)/)) {
+ result.browser = 'safari';
+ result.version = this.extractVersion(navigator.userAgent,
+ /AppleWebKit\/(\d+)\./, 1);
+ } else { // unknown webkit-based browser.
+ result.browser = 'Unsupported webkit-based browser ' +
+ 'with GUM support but no WebRTC support.';
+ return result;
+ }
+ }
+ } else if (navigator.mediaDevices &&
+ navigator.userAgent.match(/Edge\/(\d+).(\d+)$/)) { // Edge.
+ result.browser = 'edge';
+ result.version = this.extractVersion(navigator.userAgent,
+ /Edge\/(\d+).(\d+)$/, 2);
+ } else if (navigator.mediaDevices &&
+ navigator.userAgent.match(/AppleWebKit\/(\d+)\./)) {
+ // Safari, with webkitGetUserMedia removed.
+ result.browser = 'safari';
+ result.version = this.extractVersion(navigator.userAgent,
+ /AppleWebKit\/(\d+)\./, 1);
+ } else { // Default fallthrough: not supported.
+ result.browser = 'Not a supported browser.';
+ return result;
+ }
+
+ return result;
+ },
+
+};
+
+// Export.
+module.exports = {
+ log: utils.log,
+ deprecated: utils.deprecated,
+ disableLog: utils.disableLog,
+ disableWarnings: utils.disableWarnings,
+ extractVersion: utils.extractVersion,
+ shimCreateObjectURL: utils.shimCreateObjectURL,
+ detectBrowser: utils.detectBrowser.bind(utils)
+};
+
+},{}]},{},[3])(3)
+});
\ No newline at end of file
diff --git a/bigbluebutton-html5/public/js/bower.json b/bigbluebutton-html5/public/js/bower.json
deleted file mode 100644
index 965dfb86df825ec42fedc9c14cfb63cc40714146..0000000000000000000000000000000000000000
--- a/bigbluebutton-html5/public/js/bower.json
+++ /dev/null
@@ -1,32 +0,0 @@
-{
- "name": "kurento-hello-world",
- "description": "Kurento Browser JavaScript Tutorial",
- "authors": [
- "Kurento <info@kurento.org>"
- ],
- "main": "index.html",
- "moduleType": [
- "globals"
- ],
- "license": "LGPL",
- "homepage": "http://www.kurento.org/",
- "private": true,
- "ignore": [
- "**/.*",
- "node_modules",
- "bower_components",
- "test",
- "tests"
- ],
- "dependencies": {
- "adapter.js": "5.0.6",
- "bootstrap": "3.3.6",
- "kurento-utils": "https://github.com/lfzawacki/kurento-utils-js.git#safari11",
- "react": "15.1.0",
- "reconnectingWebsocket": "1.0.0",
- "requirejs": "2.2.0",
- "requirejs-react-jsx": "1.0.2",
- "requirejs-text": "2.0.15",
- "font-awesome": "fontawesome#^4.6.3"
- }
-}